DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0042939tripeptide transport; IMP:EcoliWiki.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006265DNA topological change; IDA:EcoliWiki.
# GO_processGO:0006268DNA unwinding involved in DNA replication; IBA:GO_Central.
# GO_processGO:0007059chromosome segregation; IDA:EcoliWiki.
# GO_processGO:0007062sister chromatid cohesion; IMP:EcoliWiki.
# GO_processGO:0030541plasmid partitioning; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0015846polyamine transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# GO_processGO:1902815N,N'-diacetylchitobiose import; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0000162tryptophan biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0002143tRNA wobble position uridine thiolation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006813potassium ion transport; IDA:EcoCyc.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046183L-idonate catabolic process; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006520cellular amino acid metabolic process; IEA:InterPro.
# GO_processGO:0009252peptidoglycan biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0010447response to acidic pH; IMP:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015724formate transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006779porphyrin-containing compound biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006783heme biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006152purine nucleoside catabolic process; IBA:GO_Central.
# GO_processGO:0006206pyrimidine nucleobase metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IEA:InterPro.
# GO_processGO:0046133pyrimidine ribonucleoside catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0042838D-glucarate catabolic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0044781bacterial-type flagellum organization; IEA:UniProtKB-KW.
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0001887selenium compound metabolic process; IGI:EcoCyc.
# GO_processGO:0006534cysteine metabolic process; IEA:InterPro.
# GO_processGO:0006790sulfur compound metabolic process; IDA:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
# GO_processGO:0031162sulfur incorporation into metallo-sulfur cluster; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0019303D-ribose catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0019563glycerol catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0046168glycerol-3-phosphate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IMP:EcoCyc.
# GO_processGO:0007165signal transduction; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019324L-lyxose metabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:1901575organic substance catabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0015803branched-chain amino acid transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006605protein targeting; IEA:InterPro.
# GO_processGO:0044780bacterial-type flagellum assembly; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:00060155-phosphoribose 1-diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009264deoxyribonucleotide catabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0043094cellular metabolic compound salvage; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006777Mo-molybdopterin cofactor biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0032324molybdopterin cofactor biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006559L-phenylalanine catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009435NAD biosynthetic process; IDA:EcoliWiki.
# GO_processGO:00461964-nitrophenol catabolic process; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:InterPro.
# GO_processGO:0015685ferric-enterobactin transport; IMP:EcoCyc.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009432SOS response; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0033359lysine biosynthetic process via diaminopimelate and N-succinyl-2-amino-6-ketopimelate; IGI:EcoCyc.
# GO_processGO:0042450arginine biosynthetic process via ornithine; IGI:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006827high-affinity iron ion transmembrane transport; IBA:GO_Central.
# GO_processGO:0015684ferrous iron transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:InterPro.
# GO_processGO:0098656anion transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006308DNA catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006422aspartyl-tRNA aminoacylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006829zinc II ion transport; IDA:EcoCyc.
# GO_processGO:0006876cellular cadmium ion homeostasis; IDA:EcoCyc.
# GO_processGO:0006882cellular zinc ion homeostasis; IDA:EcoCyc.
# GO_processGO:0010043response to zinc ion; IBA:GO_Central.
# GO_processGO:0015684ferrous iron transport; IDA:EcoCyc.
# GO_processGO:0015691cadmium ion transport; IDA:EcoCyc.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
# GO_processGO:0061088regulation of sequestering of zinc ion; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009447putrescine catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009250glucan biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0032951regulation of beta-glucan biosynthetic process; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0055130D-alanine catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019698D-galacturonate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
# GO_processGO:0090549response to carbon starvation; IEP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0015074DNA integration; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006014D-ribose metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:1901530response to hypochlorite; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006097glyoxylate cycle; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0042493response to drug; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006554lysine catabolic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006633fatty acid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0008610lipid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009102biotin biosynthetic process; IMP:EcoCyc.
# GO_processGO:0030497fatty acid elongation; IMP:UniProtKB.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0010468regulation of gene expression; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0090529cell septum assembly; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IBA:GO_Central.
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IMP:UniProtKB.
# GO_processGO:0009253peptidoglycan catabolic process; IMP:UniProtKB.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0046618drug export; IMP:EcoCyc.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0046677response to antibiotic; IMP:EcoliWiki.
# GO_processGO:0051301cell division; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006879cellular iron ion homeostasis; IBA:GO_Central.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
# GO_processGO:0044571[2Fe-2S] cluster assembly; IBA:GO_Central.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0034219carbohydrate transmembrane transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006833water transport; IMP:CACAO.
# GO_processGO:0006970response to osmotic stress; IMP:EcoCyc.
# GO_processGO:0009992cellular water homeostasis; IMP:EcoCyc.
# GO_processGO:0034220ion transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009245lipid A biosynthetic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0019301rhamnose catabolic process; IMP:EcoCyc.
# GO_processGO:0042355L-fucose catabolic process; IEP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009405pathogenesis; IBA:GO_Central.
# GO_processGO:0030260entry into host cell; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009082branched-chain amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009098leucine biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009245lipid A biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:00361084-amino-4-deoxy-alpha-L-arabinopyranosyl undecaprenyl phosphate biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006424glutamyl-tRNA aminoacylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0015944formate oxidation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009164nucleoside catabolic process; IEA:InterPro.
# GO_processGO:0019284L-methionine biosynthetic process from S-adenosylmethionine; IDA:EcoCyc.
# GO_processGO:0019509L-methionine biosynthetic process from methylthioadenosine; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0034355NAD salvage; IMP:EcoCyc.
# GO_processGO:0034628'de novo' NAD biosynthetic process from aspartate; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0014070response to organic cyclic compound; IMP:EcoliWiki.
# GO_processGO:0042930enterobactin transport; IGI:EcoliWiki.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; EXP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0043137DNA replication, removal of RNA primer; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009132nucleoside diphosphate metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006807nitrogen compound metabolic process; IDA:EcoCyc.
# GO_processGO:0042542response to hydrogen peroxide; IEP:EcoliWiki.
# GO_processGO:0055114oxidation-reduction process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0043709cell adhesion involved in single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0044283small molecule biosynthetic process; IBA:GO_Central.
# GO_processGO:0051479mannosylglycerate biosynthetic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0031669cellular response to nutrient levels; IEP:EcoCyc.
# GO_processGO:0034220ion transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0034224cellular response to zinc ion starvation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0012501programmed cell death; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IEP:EcoliWiki.
# GO_processGO:0051603proteolysis involved in cellular protein catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0043711pilus organization; IEA:InterPro.
# GO_processGO:0061077chaperone-mediated protein folding; IEA:InterPro.
# GO_processGO:0071555cell wall organization; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009063cellular amino acid catabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006629lipid metabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006096glycolytic process; IEA:UniProtKB-KW.
# GO_processGO:0006099tricarboxylic acid cycle; IBA:GO_Central.
DataBaseIDURL or Descriptions
# AltNameFructose-like phosphotransferase enzyme IIB component 1 {ECO:0000250|UniProtKBP20966}
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- fructose(Side 1) = [protein]-L-histidine + D-fructose 1- phosphate(Side 2). {ECO:0000250|UniProtKBP20966}.
# FUNCTIONPTFB1_ECOLIThe phosphoenolpyruvate-dependent sugar phosphotransferase system (sugar PTS), a major carbohydrate active transport system, catalyzes the phosphorylation of incoming sugar substrates concomitantly with their translocation across the cell membrane. The enzyme II FryABC PTS system is involved in fructose transport. {ECO 0000250|UniProtKB P20966}.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# RecNamePTS system fructose-like EIIB component 1 {ECO:0000250|UniProtKBP20966}
EC_numberEC: {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
ENZYME2.7.1.202 {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
IntEnz2.7.1.202 {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0043433negative regulation of sequence-specific DNA binding transcription factor activity; IDA:EcoCyc.
# GO_processGO:1902201negative regulation of bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
# GO_processGO:2000678negative regulation of transcription regulatory region DNA binding; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006807nitrogen compound metabolic process; IEA:InterPro.
# GO_processGO:0042158lipoprotein biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009245lipid A biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0036104Kdo2-lipid A biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006878cellular copper ion homeostasis; IMP:EcoCyc.
# GO_processGO:0010272response to silver ion; IMP:EcoCyc.
# GO_processGO:0010273detoxification of copper ion; IMP:EcoCyc.
# GO_processGO:0015679plasma membrane copper ion transport; IGI:EcoCyc.
# GO_processGO:0046688response to copper ion; IMP:EcoliWiki.
# GO_processGO:0060003copper ion export; IGI:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015847putrescine transport; IMP:EcoCyc.
# GO_processGO:0048870cell motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006474N-terminal protein amino acid acetylation; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006536glutamate metabolic process; IEA:InterPro.
# GO_processGO:0051454intracellular pH elevation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IGI:EcoCyc.
# GO_processGO:0009252peptidoglycan biosynthetic process; IGI:EcoCyc.
# GO_processGO:0046677response to antibiotic; IGI:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0071705nitrogen compound transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0015833peptide transport; IEA:UniProtKB-KW.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-HAMAP.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009267cellular response to starvation; IEA:InterPro.
# GO_processGO:0031669cellular response to nutrient levels; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015823phenylalanine transport; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006950response to stress; IEA:UniProtKB-HAMAP.
# GO_processGO:0030091protein repair; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006824cobalt ion transport; IMP:EcoCyc.
# GO_processGO:0006829zinc II ion transport; IMP:EcoliWiki.
# GO_processGO:0010312detoxification of zinc ion; IMP:EcoliWiki.
# GO_processGO:0015692lead ion transport; IMP:EcoCyc.
# GO_processGO:0046686response to cadmium ion; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009063cellular amino acid catabolic process; IEA:InterPro.
# GO_processGO:0009254peptidoglycan turnover; IEA:UniProtKB-UniPathway.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0000725recombinational repair; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009249protein lipoylation; IMP:EcoCyc.
# GO_processGO:0018055peptidyl-lysine lipoylation; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006265DNA topological change; IMP:EcoliWiki.
# GO_processGO:0006268DNA unwinding involved in DNA replication; IBA:GO_Central.
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoliWiki.
# GO_processGO:0007059chromosome segregation; IBA:GO_Central.
# GO_processGO:0042493response to drug; IMP:EcoliWiki.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006564L-serine biosynthetic process; IDA:EcoliWiki.
# GO_processGO:0008652cellular amino acid biosynthetic process; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015889cobalamin transport; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITYPhosphoenolpyruvate + protein L-histidine = pyruvate + protein N(pi)-phospho-L-histidine. {ECO:0000250|UniProtKBP08839}.
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- fructose(Side 1) = [protein]-L-histidine + D-fructose 1- phosphate(Side 2). {ECO:0000250|UniProtKBP20966}.
# COFACTORPTFX1_ECOLIName=Mg(2+); Xref=ChEBI CHEBI 18420; Evidence={ECO 0000250|UniProtKB P08839};
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
EC_numberEC: {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
EC_numberEC: {ECO:0000250|UniProtKB:P08839} {ECO:0000250|UniProtKB:P08839}
ENZYME2.7.1.202 {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
ENZYME2.7.3.9 {ECO:0000250|UniProtKB:P08839} {ECO:0000250|UniProtKB:P08839}
IntEnz2.7.1.202 {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
IntEnz2.7.3.9 {ECO:0000250|UniProtKB:P08839} {ECO:0000250|UniProtKB:P08839}
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006526arginine biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006633fatty acid biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006527arginine catabolic process; IMP:EcoliWiki.
# GO_processGO:0019544arginine catabolic process to glutamate; IEA:UniProtKB-HAMAP.
# GO_processGO:0019545arginine catabolic process to succinate; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015739sialic acid transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006465signal peptide processing; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000917barrier septum assembly; IMP:EcoliWiki.
# GO_processGO:0043093FtsZ-dependent cytokinesis; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:19027776-sulfoquinovose(1-) catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015847putrescine transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006793phosphorus metabolic process; IMP:EcoCyc.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IMP:EcoCyc.
# GO_processGO:0015970guanosine tetraphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0015974guanosine pentaphosphate catabolic process; IEA:InterPro.
# GO_processGO:0042594response to starvation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IEA:InterPro.
# GO_processGO:0006520cellular amino acid metabolic process; IEA:InterPro.
# GO_processGO:0009220pyrimidine ribonucleotide biosynthetic process; IBA:GO_Central.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006457protein folding; IEA:UniProtKB-HAMAP.
# GO_processGO:0044781bacterial-type flagellum organization; IEA:UniProtKB-KW.
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
# GO_processGO:1902209negative regulation of bacterial-type flagellum assembly; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IEP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IGI:EcoCyc.
# GO_processGO:0009108coenzyme biosynthetic process; IGI:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006817phosphate ion transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009992cellular water homeostasis; IBA:GO_Central.
# GO_processGO:0015793glycerol transport; IDA:UniProtKB.
# GO_processGO:0034220ion transmembrane transport; IBA:GO_Central.
# GO_processGO:0071288cellular response to mercury ion; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:2000144positive regulation of DNA-templated transcription, initiation; IDA:EcoCyc.
# GO_processGO:2001023regulation of response to drug; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000716transcription-coupled nucleotide-excision repair, DNA damage recognition; IDA:EcoCyc.
# GO_processGO:0006281DNA repair; IMP:EcoliWiki.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoliWiki.
# GO_processGO:0006974cellular response to DNA damage stimulus; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0009163nucleoside biosynthetic process; IEA:InterPro.
# GO_processGO:0009236cobalamin biosynthetic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006529asparagine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0070981L-asparagine biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0042545cell wall modification; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006817phosphate ion transport; IEA:UniProtKB-KW.
# GO_processGO:2000142regulation of DNA-templated transcription, initiation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015797mannitol transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IEA:InterPro.
# GO_processGO:0019854L-ascorbic acid catabolic process; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0045471response to ethanol; IEP:EcoliWiki.
# GO_processGO:0046187acetaldehyde catabolic process; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0032359provirus excision; IMP:EcoCyc.
# GO_processGO:0046718viral entry into host cell; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoliWiki.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0007234osmosensory signaling via phosphorelay pathway; IDA:EcoCyc.
# GO_processGO:0009593detection of chemical stimulus; IDA:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015853adenine transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006152purine nucleoside catabolic process; IBA:GO_Central.
# GO_processGO:0006206pyrimidine nucleobase metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0042454ribonucleoside catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0010447response to acidic pH; IMP:EcoCyc.
# GO_processGO:0044092negative regulation of molecular function; IMP:EcoCyc.
# GO_processGO:0070298negative regulation of phosphorelay signal transduction system; IDA:UniProtKB.
# GO_processGO:0071286cellular response to magnesium ion; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0043709cell adhesion involved in single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015757galactose transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009447putrescine catabolic process; IMP:EcoCyc.
# GO_processGO:0009448gamma-aminobutyric acid metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoCyc.
# GO_processGO:0042177negative regulation of protein catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0022904respiratory electron transport chain; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0000028ribosomal small subunit assembly; IMP:EcoCyc.
# GO_processGO:0030490maturation of SSU-rRNA; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0015851nucleobase transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006772thiamine metabolic process; IEA:InterPro.
# GO_processGO:0009229thiamine diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006014D-ribose metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0043164Gram-negative-bacterium-type cell wall biogenesis; IMP:EcoCyc.
# GO_processGO:0044036cell wall macromolecule metabolic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006636unsaturated fatty acid biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0042413carnitine catabolic process; EXP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0008033tRNA processing; IEA:UniProtKB-HAMAP.
# GO_processGO:0009451RNA modification; IEA:InterPro.
# GO_processGO:0016226iron-sulfur cluster assembly; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0034775glutathione transmembrane transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0010795regulation of ubiquinone biosynthetic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006631fatty acid metabolic process; IEA:InterPro.
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006004fucose metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IMP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009432SOS response; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0043708cell adhesion involved in biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006094gluconeogenesis; IBA:GO_Central.
# GO_processGO:0006096glycolytic process; IBA:GO_Central.
# GO_processGO:0043456regulation of pentose-phosphate shunt; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006083acetate metabolic process; IMP:CACAO.
# GO_processGO:0019413acetate biosynthetic process; IMP:EcoCyc.
# GO_processGO:0019427acetyl-CoA biosynthetic process from acetate; IMP:EcoCyc.
# GO_processGO:0045733acetate catabolic process; IMP:EcoCyc.
# GO_processGO:0070689L-threonine catabolic process to propionate; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0043213bacteriocin transport; IEA:UniProtKB-KW.
# GO_processGO:0050821protein stabilization; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006226dUMP biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006229dUTP biosynthetic process; IEA:InterPro.
# GO_processGO:0009220pyrimidine ribonucleotide biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0005985sucrose metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoCyc.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009249protein lipoylation; IEA:InterPro.
# GO_processGO:0042158lipoprotein biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0022904respiratory electron transport chain; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009438methylglyoxal metabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0016485protein processing; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0019294keto-3-deoxy-D-manno-octulosonic acid biosynthetic process; IDA:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019288isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway; IMP:EcoCyc.
# GO_processGO:0051484isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway involved in terpenoid biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006457protein folding; IEA:UniProtKB-HAMAP.
# GO_processGO:0051604protein maturation; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IGI:EcoliWiki.
# GO_processGO:0009060aerobic respiration; IGI:EcoliWiki.
# GO_processGO:0009061anaerobic respiration; IBA:GO_Central.
# GO_processGO:0022900electron transport chain; IEA:InterPro.
# GO_processGO:0055114oxidation-reduction process; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006164purine nucleotide biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IDA:EcoliWiki.
# GO_processGO:0044208'de novo' AMP biosynthetic process; IBA:GO_Central.
# GO_processGO:0046040IMP metabolic process; IBA:GO_Central.
# GO_processGO:0046086adenosine biosynthetic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; TAS:EcoCyc.
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IBA:GO_Central.
# GO_processGO:0009245lipid A biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000272polysaccharide catabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006032chitin catabolic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0071286cellular response to magnesium ion; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IBA:GO_Central.
# GO_processGO:0006104succinyl-CoA metabolic process; IBA:GO_Central.
# GO_processGO:0006105succinate metabolic process; IBA:GO_Central.
# GO_processGO:0009142nucleoside triphosphate biosynthetic process; IBA:GO_Central.
# GO_processGO:0046777protein autophosphorylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0008615pyridoxine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0042823pyridoxal phosphate biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006308DNA catabolic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009443pyridoxal 5'-phosphate salvage; IMP:EcoliWiki.
# GO_processGO:0042817pyridoxal metabolic process; IMP:EcoliWiki.
# GO_processGO:0042819vitamin B6 biosynthetic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009423chorismate biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0032506cytokinetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITYdTDP-alpha-D-glucose = dTDP-4-dehydro-6-deoxy- alpha-D-glucose + H(2)O. {ECO:0000250|UniProtKBP27830}.
# COFACTORRMLB1_ECOLIName=NAD(+); Xref=ChEBI CHEBI 57540; Evidence={ECO 0000250|UniProtKB P27830}; Note=Binds 1 NAD(+) per subunit. {ECO 0000250|UniProtKB P27830};
# FUNCTIONRMLB1_ECOLICatalyzes the dehydration of dTDP-D-glucose to form dTDP-6-deoxy-D-xylo-4-hexulose via a three-step process involving oxidation, dehydration and reduction. {ECO 0000250|UniProtKB P27830}.
# GO_processGO:0009103lipopolysaccharide biosynthetic process; ISS:UniProtKB.
# GO_processGO:0009226nucleotide-sugar biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009243O antigen biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0019305dTDP-rhamnose biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0045226extracellular polysaccharide biosynthetic process; ISS:UniProtKB.
# RecNamedTDP-glucose 4,6-dehydratase 1 {ECO:0000250|UniProtKBP27830}
# SUBUNITHomodimer. {ECO:0000250|UniProtKBP27830}.
EC_numberEC: {ECO:0000250|UniProtKB:P27830} {ECO:0000250|UniProtKB:P27830}
ENZYME4.2.1.46 {ECO:0000250|UniProtKB:P27830} {ECO:0000250|UniProtKB:P27830}
IntEnz4.2.1.46 {ECO:0000250|UniProtKB:P27830} {ECO:0000250|UniProtKB:P27830}
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006556S-adenosylmethionine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006730one-carbon metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0033353S-adenosylmethionine cycle; IMP:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0031365N-terminal protein amino acid modification; IDA:EcoliWiki.
# GO_processGO:0043686co-translational protein modification; IPI:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0008610lipid biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009102biotin biosynthetic process; IMP:UniProtKB.
# GO_processGO:0030497fatty acid elongation; IDA:UniProtKB.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
# GO_processGO:0051289protein homotetramerization; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006824cobalt ion transport; IMP:EcoliWiki.
# GO_processGO:0006826iron ion transport; IMP:EcoliWiki.
# GO_processGO:0006828manganese ion transport; IMP:EcoCyc.
# GO_processGO:0015684ferrous iron transport; IMP:EcoliWiki.
# GO_processGO:0015691cadmium ion transport; IDA:EcoliWiki.
# GO_processGO:0030001metal ion transport; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
# GO_processGO:0097171ADP-L-glycero-beta-D-manno-heptose biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0009605response to external stimulus; IEA:InterPro.
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0030162regulation of proteolysis; IMP:EcoCyc.
# GO_processGO:0043066negative regulation of apoptotic process; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoCyc.
# GO_processGO:0009266response to temperature stimulus; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000162tryptophan biosynthetic process; IBA:GO_Central.
# GO_processGO:0006541glutamine metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046654tetrahydrofolate biosynthetic process; IMP:UniProtKB.
# GO_processGO:0046656folic acid biosynthetic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IGI:EcoliWiki.
# GO_processGO:0046942carboxylic acid transport; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006465signal peptide processing; IDA:EcoCyc.
# GO_processGO:0006508proteolysis; IDA:EcoliWiki.
# GO_processGO:0016485protein processing; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0015031protein transport; IEA:UniProtKB-HAMAP.
# GO_processGO:0043335protein unfolding; IDA:EcoCyc.
# GO_processGO:0051083'de novo' cotranslational protein folding; IDA:EcoCyc.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0061077chaperone-mediated protein folding; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006950response to stress; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006399tRNA metabolic process; IMP:EcoliWiki.
# GO_processGO:0008033tRNA processing; IMP:EcoliWiki.
# GO_processGO:0009451RNA modification; IMP:EcoliWiki.
# GO_processGO:0031119tRNA pseudouridine synthesis; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0009423chorismate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0019632shikimate metabolic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0036460cellular response to cell envelope stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0007059chromosome segregation; IMP:EcoliWiki.
# GO_processGO:0015758glucose transport; IDA:EcoliWiki.
# GO_processGO:0015767lactose transport; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0090540bacterial cellulose biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IDA:EcoCyc.
# GO_processGO:0019645anaerobic electron transport chain; IDA:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006857oligopeptide transport; IDA:EcoliWiki.
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0035442dipeptide transmembrane transport; IDA:EcoCyc.
# GO_processGO:0035443tripeptide transmembrane transport; IMP:EcoCyc.
# GO_processGO:0042891antibiotic transport; IMP:EcoCyc.
# GO_processGO:1902600hydrogen ion transmembrane transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0051301cell division; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0045947negative regulation of translational initiation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006221pyrimidine nucleotide biosynthetic process; IBA:GO_Central.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- fructose(Side 1) = [protein]-L-histidine + D-fructose 1- phosphate(Side 2). {ECO:0000250|UniProtKBP20966}.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; ISA:EcoCyc.
EC_numberEC: {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
ENZYME2.7.1.202 {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
IntEnz2.7.1.202 {ECO:0000250|UniProtKB:P20966} {ECO:0000250|UniProtKB:P20966}
DataBaseIDURL or Descriptions
# GO_processGO:0006001fructose catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006635fatty acid beta-oxidation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006096glycolytic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IMP:EcoCyc.
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0017148negative regulation of translation; IDA:EcoCyc.
# GO_processGO:0044238primary metabolic process; IEA:InterPro.
# GO_processGO:0045900negative regulation of translational elongation; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006535cysteine biosynthetic process from serine; IDA:EcoCyc.
# GO_processGO:0008652cellular amino acid biosynthetic process; IDA:EcoliWiki.
# SUBUNITCYSK_ECOLIHomodimer (Ref.6). Forms a cysteine synthase complex with 1 copy of CysE (By similarity). Interacts with CdiA-CT from strain 536 / UPEC, this is blocked upon preincubation with O-acetyl-L- serine. CysK forms a complex with CdiA-CT/CdiI (PubMed 22333533). {ECO 0000250|UniProtKB P0A1E3, ECO 0000269|PubMed 22333533, ECO 0000269|Ref.6}.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
# GO_processGO:0019568arabinose catabolic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0000270peptidoglycan metabolic process; IDA:EcoCyc.
# GO_processGO:0000920cell separation after cytokinesis; IGI:EcoliWiki.
# GO_processGO:0001896autolysis; IGI:EcoliWiki.
# GO_processGO:0045227capsule polysaccharide biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0006817phosphate ion transport; IEA:UniProtKB-KW.
# GO_processGO:0016036cellular response to phosphate starvation; IEP:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0055114oxidation-reduction process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006979response to oxidative stress; IMP:EcoliWiki.
# GO_processGO:0009416response to light stimulus; IMP:EcoliWiki.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0044780bacterial-type flagellum assembly; IEA:InterPro.
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:00526533',5'-cyclic diguanylic acid metabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006950response to stress; IEA:InterPro.
# GO_processGO:0018117protein adenylylation; IDA:EcoliWiki.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoliWiki.
# GO_processGO:2000145regulation of cell motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0002128tRNA nucleoside ribose methylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0030261chromosome condensation; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000105histidine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0006541glutamine metabolic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0009052pentose-phosphate shunt, non-oxidative branch; IBA:GO_Central.
# GO_processGO:0019316D-allose catabolic process; IMP:EcoCyc.
# GO_processGO:0019323pentose catabolic process; IBA:GO_Central.
# GO_processGO:0044262cellular carbohydrate metabolic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0002136wobble base lysidine biosynthesis; IMP:EcoCyc.
# GO_processGO:0006400tRNA modification; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0042953lipoprotein transport; IDA:EcoCyc.
# GO_processGO:0044874lipoprotein localization to outer membrane; IDA:CACAO.
# GO_processGO:0072323chaperone-mediated protein transport across periplasmic space; IDA:CACAO.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019324L-lyxose metabolic process; IMP:EcoCyc.
# GO_processGO:0019569L-arabinose catabolic process to xylulose 5-phosphate; IEP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0046113nucleobase catabolic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IEA:UniProtKB-HAMAP.
# GO_processGO:0007059chromosome segregation; IMP:EcoliWiki.
# GO_processGO:0007062sister chromatid cohesion; IMP:EcoliWiki.
# GO_processGO:0030261chromosome condensation; IDA:EcoCyc.
# GO_processGO:0051301cell division; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006817phosphate ion transport; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IDA:EcoCyc.
# GO_processGO:0055085transmembrane transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0000050urea cycle; IBA:GO_Central.
# GO_processGO:0006526arginine biosynthetic process; IBA:GO_Central.
# GO_processGO:0008652cellular amino acid biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0019856pyrimidine nucleobase biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0044011single-species biofilm formation on inanimate substrate; IMP:EcoCyc.
# GO_processGO:0070301cellular response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0071468cellular response to acidic pH; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:00193803-phenylpropionate catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:00196223-(3-hydroxy)phenylpropionate catabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
# GO_processGO:0046271phenylpropanoid catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019294keto-3-deoxy-D-manno-octulosonic acid biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0030091protein repair; IMP:EcoCyc.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0046654tetrahydrofolate biosynthetic process; IMP:EcoCyc.
# GO_processGO:0046656folic acid biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0045990carbon catabolite regulation of transcription; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITYAdenosylcobalamin 5'-phosphate + H(2)O = coenzyme B12 + phosphate. {ECO:0000250|UniProtKBP39701}.
# CATALYTIC ACTIVITYAlpha-ribazole 5'-phosphate + H(2)O = alpha- ribazole + phosphate. {ECO:0000250|UniProtKBP39701}.
# FUNCTIONCOBC_ECOLICatalyzes the conversion of adenosylcobalamin 5'- phosphate to adenosylcobalamin (vitamin B12); involved in the assembly of the nucleotide loop of cobalamin. Also catalyzes the hydrolysis of the phospho group from alpha-ribazole 5'-phosphate to form alpha-ribazole. {ECO 0000250|UniProtKB P39701}.
# GO_processGO:0009236cobalamin biosynthetic process; IEA:UniProtKB-KW.
EC_numberEC: {ECO:0000250|UniProtKB:P39701} {ECO:0000250|UniProtKB:P39701}
ENZYME3.1.3.73 {ECO:0000250|UniProtKB:P39701} {ECO:0000250|UniProtKB:P39701}
IntEnz3.1.3.73 {ECO:0000250|UniProtKB:P39701} {ECO:0000250|UniProtKB:P39701}
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0042493response to drug; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
# GO_processGO:0019299rhamnose metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0040033negative regulation of translation, ncRNA-mediated; IEP:EcoliWiki.
# GO_processGO:0045975positive regulation of translation, ncRNA-mediated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006612protein targeting to membrane; IMP:EcoliWiki.
# GO_processGO:0006614SRP-dependent cotranslational protein targeting to membrane; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
# GO_processGO:0015871choline transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0008653lipopolysaccharide metabolic process; IPI:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:1902201negative regulation of bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0034599cellular response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0045454cell redox homeostasis; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0019629propionate catabolic process, 2-methylcitrate cycle; IEA:InterPro.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0019584galactonate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006164purine nucleotide biosynthetic process; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-HAMAP.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015823phenylalanine transport; IDA:EcoCyc.
# GO_processGO:0015827tryptophan transport; IDA:EcoCyc.
# GO_processGO:0015828tyrosine transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoliWiki.
# GO_processGO:0030163protein catabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0008654phospholipid biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0046342CDP-diacylglycerol catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0030641regulation of cellular pH; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0035429gluconate transmembrane transport; IDA:EcoCyc.
# GO_processGO:0046177D-gluconate catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006777Mo-molybdopterin cofactor biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0032324molybdopterin cofactor biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009228thiamine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009229thiamine diphosphate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0016310phosphorylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006308DNA catabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0016310phosphorylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
# GO_processGO:0016226iron-sulfur cluster assembly; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0000724double-strand break repair via homologous recombination; IEA:UniProtKB-HAMAP.
# GO_processGO:0006302double-strand break repair; IDA:EcoCyc.
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0044355clearance of foreign intracellular DNA; IMP:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0002098tRNA wobble uridine modification; IDA:EcoCyc.
# GO_processGO:0006805xenobiotic metabolic process; IMP:EcoCyc.
# GO_processGO:0009268response to pH; IMP:EcoCyc.
# GO_processGO:0030488tRNA methylation; IMP:EcoCyc.
# GO_processGO:0061077chaperone-mediated protein folding; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019698D-galacturonate catabolic process; IMP:EcoCyc.
# GO_processGO:0042840D-glucuronate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006011UDP-glucose metabolic process; IMP:EcoCyc.
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009242colanic acid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0033499galactose catabolic process via UDP-galactose; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000105histidine biosynthetic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0030643cellular phosphate ion homeostasis; IBA:GO_Central.
# GO_processGO:0035435phosphate ion transmembrane transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0002949tRNA threonylcarbamoyladenosine modification; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0015889cobalamin transport; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006166purine ribonucleoside salvage; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009246enterobacterial common antigen biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006096glycolytic process; IDA:EcoliWiki.
# GO_processGO:0006099tricarboxylic acid cycle; IDA:EcoliWiki.
# GO_processGO:0006108malate metabolic process; IDA:EcoliWiki.
# GO_processGO:0006113fermentation; IDA:EcoliWiki.
# GO_processGO:0009061anaerobic respiration; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0046944protein carbamoylation; IDA:EcoCyc.
# GO_processGO:0051604protein maturation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0071229cellular response to acid chemical; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0042968homoserine transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IEA:UniProtKB-UniPathway.
# GO_processGO:0019629propionate catabolic process, 2-methylcitrate cycle; IEA:InterPro.
# GO_processGO:0019679propionate metabolic process, methylcitrate cycle; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0009636response to toxic substance; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006805xenobiotic metabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000162tryptophan biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0015740C4-dicarboxylate transport; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IEA:UniProtKB-KW.
# GO_processGO:0015992proton transport; IEA:UniProtKB-KW.
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IMP:EcoliWiki.
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0018339peptidyl-L-beta-methylthioaspartic acid biosynthetic process from peptidyl-aspartic acid; IDA:EcoCyc.
# GO_processGO:0035600tRNA methylthiolation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0051302regulation of cell division; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0032506cytokinetic process; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# GO_processGO:0046325negative regulation of glucose import; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0002098tRNA wobble uridine modification; IMP:EcoCyc.
# GO_processGO:0070329tRNA seleno-modification; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0046718viral entry into host cell; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0010447response to acidic pH; IEA:InterPro.
# GO_processGO:1902476chloride transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IBA:GO_Central.
# GO_processGO:0006457protein folding; IBA:GO_Central.
# GO_processGO:0006662glycerol ether metabolic process; IEA:InterPro.
# GO_processGO:0034599cellular response to oxidative stress; IBA:GO_Central.
# GO_processGO:0045454cell redox homeostasis; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0015751arabinose transport; IDA:EcoliWiki.
# GO_processGO:0015757galactose transport; IDA:EcoliWiki.
# GO_processGO:0046323glucose import; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006772thiamine metabolic process; EXP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; TAS:EcoliWiki.
# GO_processGO:0009423chorismate biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006655phosphatidylglycerol biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009395phospholipid catabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046474glycerophospholipid biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0046121deoxyribonucleoside catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0010045response to nickel cation; IMP:EcoCyc.
# GO_processGO:0032025response to cobalt ion; IMP:EcoCyc.
# GO_processGO:1901652response to peptide; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:1900190regulation of single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009089lysine biosynthetic process via diaminopimelate; IEA:UniProtKB-HAMAP.
# GO_processGO:0019877diaminopimelate biosynthetic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0009246enterobacterial common antigen biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015846polyamine transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015820leucine transport; IMP:EcoCyc.
# GO_processGO:0015821methionine transport; IMP:EcoCyc.
# GO_processGO:0071230cellular response to amino acid stimulus; IEP:EcoCyc.
# GO_processGO:1903714isoleucine transmembrane transport; IMP:EcoCyc.
# GO_processGO:1903785L-valine transmembrane transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:UniProtKB-KW.
# GO_processGO:0006282regulation of DNA repair; IEA:UniProtKB-HAMAP.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoCyc.
# GO_processGO:0009432SOS response; IEP:EcoCyc.
# GO_processGO:0043086negative regulation of catalytic activity; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006490oligosaccharide-lipid intermediate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009250glucan biosynthetic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0000478endonucleolytic cleavage involved in rRNA processing; IMP:EcoCyc.
# GO_processGO:0006364rRNA processing; IMP:UniProtKB.
# GO_processGO:0006412translation; IMP:EcoCyc.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0030490maturation of SSU-rRNA; IMP:EcoCyc.
# GO_processGO:0031564transcription antitermination; IMP:EcoCyc.
# GO_processGO:0042254ribosome biogenesis; IMP:UniProtKB.
# GO_processGO:0042274ribosomal small subunit biogenesis; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006757ATP generation from ADP; IDA:EcoCyc.
# GO_processGO:0006799polyphosphate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009447putrescine catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006779porphyrin-containing compound biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009236cobalamin biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0000032cell wall mannoprotein biosynthetic process; IBA:GO_Central.
# GO_processGO:0006486protein glycosylation; IBA:GO_Central.
# GO_processGO:0009242colanic acid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009298GDP-mannose biosynthetic process; IMP:EcoCyc.
# GO_processGO:0019309mannose catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000453enzyme-directed rRNA 2'-O-methylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0050896response to stimulus; IEA:UniProtKB-KW.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015758glucose transport; IMP:CACAO.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006265DNA topological change; IMP:EcoliWiki.
# GO_processGO:0006268DNA unwinding involved in DNA replication; IBA:GO_Central.
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoliWiki.
# GO_processGO:0007059chromosome segregation; IBA:GO_Central.
# GO_processGO:0042493response to drug; IDA:EcoliWiki.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0008643carbohydrate transport; IEA:UniProtKB-KW.
# GO_processGO:0015712hexose phosphate transport; IMP:EcoCyc.
# GO_processGO:0015760glucose-6-phosphate transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0097264self proteolysis; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0018106peptidyl-histidine phosphorylation; IDA:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IMP:EcoCyc.
# GO_processGO:0010226response to lithium ion; IGI:EcoliWiki.
# GO_processGO:0015992proton transport; IMP:EcoCyc.
# GO_processGO:0051452intracellular pH reduction; IMP:EcoCyc.
# GO_processGO:0098656anion transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0008152metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0016114terpenoid biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0019288isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway; IMP:EcoCyc.
# GO_processGO:0050992dimethylallyl diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019285glycine betaine biosynthetic process from choline; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
# GO_processGO:0043711pilus organization; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0042126nitrate metabolic process; IMP:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006820anion transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0031167rRNA methylation; IDA:UniProtKB.
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0060567negative regulation of DNA-templated transcription, termination; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0034194D-galactonate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0044781bacterial-type flagellum organization; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:1902208regulation of bacterial-type flagellum assembly; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006567threonine catabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IBA:GO_Central.
# GO_processGO:0006457protein folding; IBA:GO_Central.
# GO_processGO:0006662glycerol ether metabolic process; IEA:InterPro.
# GO_processGO:0016032viral process; IEA:UniProtKB-KW.
# GO_processGO:0034599cellular response to oxidative stress; IBA:GO_Central.
# GO_processGO:0045454cell redox homeostasis; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009097isoleucine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009099valine biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006014D-ribose metabolic process; IMP:EcoCyc.
# GO_processGO:0009052pentose-phosphate shunt, non-oxidative branch; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0015774polysaccharide transport; IEA:UniProtKB-KW.
# GO_processGO:0052778diacetylchitobiose metabolic process; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IEA:UniProtKB-HAMAP.
# GO_processGO:0030091protein repair; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019430removal of superoxide radicals; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0015944formate oxidation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015891siderophore transport; IMP:EcoliWiki.
# GO_processGO:0042884microcin transport; IMP:EcoliWiki.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0012501programmed cell death; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0009409response to cold; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0044283small molecule biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0009432SOS response; IEA:UniProtKB-HAMAP.
# GO_processGO:0032466negative regulation of cytokinesis; IMP:CACAO.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0051782negative regulation of cell division; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
# GO_processGO:0015990electron transport coupled proton transport; IMP:EcoCyc.
# GO_processGO:0042773ATP synthesis coupled electron transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0015757galactose transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0031167rRNA methylation; IDA:UniProtKB.
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0017038protein import; IMP:EcoliWiki.
# GO_processGO:0043213bacteriocin transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0090540bacterial cellulose biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# AltNameEIICB-Mtl {ECO:0000250|UniProtKBP28008}
# AltNamePTS system mannitol-specific EIIB component {ECO:0000250|UniProtKBP28008}
# AltNamePTS system mannitol-specific EIIC component {ECO:0000250|UniProtKBP28008}
# AltNamePTS system mannitol-specific EIIC component {ECO:0000250|UniProtKBP28008}
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- mannitol(Side 1) = [protein]-L-histidine + D-mannitol 1- phosphate(Side 2). {ECO:0000250|UniProtKBP00550}.
# FUNCTIONPTMCB_ECOLIThe phosphoenolpyruvate-dependent sugar phosphotransferase system (sugar PTS), a major carbohydrate active transport system, catalyzes the phosphorylation of incoming sugar substrates concomitantly with their translocation across the cell membrane. The enzyme II CmtAB PTS system is involved in D-mannitol transport. {ECO 0000250|UniProtKB P28008}.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; ISA:EcoCyc.
# RecNameMannitol permease IIC component {ECO:0000250|UniProtKBP28008}
# RecNameMannitol-specific phosphotransferase enzyme IIB component {ECO:0000250|UniProtKBP28008}
EC_numberEC: {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008} {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}
ENZYME2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008} {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}
IntEnz2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008} {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015986ATP synthesis coupled proton transport; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
# GO_processGO:0006401RNA catabolic process; IGI:EcoCyc.
# GO_processGO:0010501RNA secondary structure unwinding; IBA:GO_Central.
# GO_processGO:0045727positive regulation of translation; IMP:EcoCyc.
# GO_processGO:0048255mRNA stabilization; IMP:CACAO.
# GO_processGO:0070417cellular response to cold; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0018307enzyme active site formation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005992trehalose biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006970response to osmotic stress; IEP:EcoCyc.
# GO_processGO:0070415trehalose metabolism in response to cold stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000738DNA catabolic process, exonucleolytic; IDA:EcoCyc.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0090501RNA phosphodiester bond hydrolysis; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0008643carbohydrate transport; IDA:EcoCyc.
# GO_processGO:0015726L-idonate transport; IDA:EcoCyc.
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046183L-idonate catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0015698inorganic anion transport; IMP:EcoCyc.
# GO_processGO:1903424fluoride transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IGI:EcoCyc.
DataBaseIDURL or Descriptions
# AltNamePutative D-hexose-6-phosphate mutarotase {ECO:0000250|UniProtKBQ03161}
# CATALYTIC ACTIVITYAlpha-D-glucose 6-phosphate = beta-D-glucose 6-phosphate. {ECO:0000250|UniProtKBQ03161}.
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# RecNamePutative glucose-6-phosphate 1-epimerase {ECO:0000250|UniProtKBQ03161}
EC_numberEC: {ECO:0000250|UniProtKB:Q03161} {ECO:0000250|UniProtKB:Q03161}
ENZYME5.1.3.15 {ECO:0000250|UniProtKB:Q03161} {ECO:0000250|UniProtKB:Q03161}
IntEnz5.1.3.15 {ECO:0000250|UniProtKB:Q03161} {ECO:0000250|UniProtKB:Q03161}
DataBaseIDURL or Descriptions
# GO_processGO:0009636response to toxic substance; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015820leucine transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
# GO_processGO:0031460glycine betaine transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000012single strand break repair; IMP:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009432SOS response; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0045819positive regulation of glycogen catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0006352DNA-templated transcription, initiation; IMP:EcoliWiki.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoliWiki.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0015689molybdate ion transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0019563glycerol catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0046168glycerol-3-phosphate catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
# GO_processGO:0043711pilus organization; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006396RNA processing; IEA:InterPro.
# GO_processGO:0006402mRNA catabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0002098tRNA wobble uridine modification; IMP:EcoCyc.
# GO_processGO:0032259methylation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:1902765L-arginine import into cell; ISO:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006464cellular protein modification process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0015757galactose transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IEA:UniProtKB-KW.
# GO_processGO:0050920regulation of chemotaxis; IEA:InterPro.
# GO_processGO:0071977bacterial-type flagellum-dependent swimming motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009236cobalamin biosynthetic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009231riboflavin biosynthetic process; IDA:EcoCyc.
# GO_processGO:0022611dormancy process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009086methionine biosynthetic process; IBA:GO_Central.
# GO_processGO:0009088threonine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009092homoserine metabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
# GO_processGO:0010501RNA secondary structure unwinding; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0018378cytochrome c-heme linkage via heme-L-cysteine; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0001407glycerophosphodiester transport; IDA:EcoCyc.
# GO_processGO:0015794glycerol-3-phosphate transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009436glyoxylate catabolic process; IMP:EcoCyc.
# GO_processGO:0009442allantoin assimilation pathway; IEP:EcoCyc.
# GO_processGO:0046296glycolate catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0031564transcription antitermination; IEA:UniProtKB-KW.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0060567negative regulation of DNA-templated transcription, termination; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0051205protein insertion into membrane; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0071555cell wall organization; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006633fatty acid biosynthetic process; IGI:EcoliWiki.
# GO_processGO:0018070peptidyl-serine phosphopantetheinylation; NAS:EcoliWiki.
# GO_processGO:0019878lysine biosynthetic process via aminoadipic acid; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006203dGTP catabolic process; IBA:GO_Central.
# GO_processGO:0009267cellular response to starvation; IMP:EcoCyc.
# GO_processGO:0046047TTP catabolic process; IBA:GO_Central.
# GO_processGO:0046052UTP catabolic process; IBA:GO_Central.
# GO_processGO:0046061dATP catabolic process; IBA:GO_Central.
# GO_processGO:0046076dTTP catabolic process; IBA:GO_Central.
# GO_processGO:0046081dUTP catabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006108malate metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0043471regulation of cellular carbohydrate catabolic process; IGI:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0070301cellular response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0071454cellular response to anoxia; IMP:EcoCyc.
# GO_processGO:1900190regulation of single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006813potassium ion transport; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0000455enzyme-directed rRNA pseudouridine synthesis; IBA:GO_Central.
# GO_processGO:0009408response to heat; IEP:EcoliWiki.
# GO_processGO:0034605cellular response to heat; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0042354L-fucose metabolic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006259DNA metabolic process; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006629lipid metabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0015889cobalamin transport; IMP:EcoCyc.
# GO_processGO:0015891siderophore transport; TAS:EcoCyc.
# GO_processGO:0042914colicin transport; TAS:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IMP:EcoCyc.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0006417regulation of translation; IEA:UniProtKB-KW.
# GO_processGO:0043488regulation of mRNA stability; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0030420establishment of competence for transformation; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0008643carbohydrate transport; IMP:CACAO.
# GO_processGO:0015767lactose transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:1902765L-arginine import into cell; ISO:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009268response to pH; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006046N-acetylglucosamine catabolic process; IBA:GO_Central.
# GO_processGO:0006048UDP-N-acetylglucosamine biosynthetic process; IBA:GO_Central.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006430lysyl-tRNA aminoacylation; IEA:InterPro.
# GO_processGO:0071915protein-lysine lysylation; IDA:EcoCyc.
# GO_processGO:0072581protein-N6-(L-lysyl)-L-lysine modification to protein-N6-(beta-lysyl)-L-lysine; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006432phenylalanyl-tRNA aminoacylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0015074DNA integration; IEA:UniProtKB-KW.
# RecNameSerine recombinase PinE {ECO:0000250|UniProtKBP03015}
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006402mRNA catabolic process; IDA:EcoCyc.
# GO_processGO:0006415translational termination; IDA:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006113fermentation; IEP:EcoCyc.
# GO_processGO:0006810transport; IEA:InterPro.
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0022904respiratory electron transport chain; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009234menaquinone biosynthetic process; IMP:CACAO.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:1900190regulation of single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019594mannitol metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006635fatty acid beta-oxidation; IBA:GO_Central.
# GO_processGO:00712711-butanol biosynthetic process; IMP:CACAO.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0033611oxalate catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0071468cellular response to acidic pH; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019076viral release from host cell; IEA:UniProtKB-KW.
# GO_processGO:0019835cytolysis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009097isoleucine biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009099valine biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0002143tRNA wobble position uridine thiolation; IMP:EcoCyc.
# GO_processGO:0006777Mo-molybdopterin cofactor biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
# GO_processGO:2001061D-glycero-D-manno-heptose 7-phosphate biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IBA:GO_Central.
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
# GO_processGO:0009061anaerobic respiration; IMP:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
# GO_processGO:0051604protein maturation; IDA:EcoCyc.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0019571D-arabinose catabolic process; IMP:EcoCyc.
# GO_processGO:0042355L-fucose catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IMP:EcoliWiki.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0043093FtsZ-dependent cytokinesis; IEA:UniProtKB-HAMAP.
# GO_processGO:0051301cell division; IMP:EcoliWiki.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0045226extracellular polysaccharide biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009266response to temperature stimulus; IEP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0016579protein deubiquitination; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0051224negative regulation of protein transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0090347regulation of cellular organohalogen metabolic process; IEP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0033543fatty acid beta-oxidation, unsaturated, even number, reductase/isomerase pathway; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
# GO_processGO:0043711pilus organization; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006465signal peptide processing; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009637response to blue light; IDA:EcoCyc.
# GO_processGO:0018298protein-chromophore linkage; IEA:UniProtKB-KW.
# GO_processGO:0043433negative regulation of sequence-specific DNA binding transcription factor activity; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000918barrier septum site selection; IDA:EcoCyc.
# GO_processGO:0032955regulation of barrier septum assembly; IGI:EcoliWiki.
# GO_processGO:0051302regulation of cell division; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006464cellular protein modification process; IDA:EcoliWiki.
# GO_processGO:0006474N-terminal protein amino acid acetylation; IDA:EcoliWiki.
# GO_processGO:0017198N-terminal peptidyl-serine acetylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006002fructose 6-phosphate metabolic process; IBA:GO_Central.
# GO_processGO:0006048UDP-N-acetylglucosamine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006541glutamine metabolic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006779porphyrin-containing compound biosynthetic process; ISS:UniProtKB.
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006457protein folding; IMP:EcoCyc.
# GO_processGO:0015031protein transport; IEA:InterPro.
# GO_processGO:0043165Gram-negative-bacterium-type cell outer membrane assembly; IMP:EcoliWiki.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0050821protein stabilization; IMP:CACAO.
# GO_processGO:0051085chaperone mediated protein folding requiring cofactor; IMP:EcoCyc.
# GO_processGO:0060274maintenance of stationary phase; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015716organic phosphonate transport; IEA:InterPro.
# GO_processGO:0019700organic phosphonate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006069ethanol oxidation; IEA:InterPro.
# GO_processGO:0046294formaldehyde catabolic process; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0046292formaldehyde metabolic process; IMP:EcoCyc.
# GO_processGO:0046294formaldehyde catabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006808regulation of nitrogen utilization; IEA:InterPro.
# GO_processGO:0009399nitrogen fixation; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006826iron ion transport; IEA:InterPro.
# GO_processGO:0006880intracellular sequestering of iron ion; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009254peptidoglycan turnover; IEA:UniProtKB-HAMAP.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006631fatty acid metabolic process; IGI:EcoliWiki.
# GO_processGO:0008654phospholipid biosynthetic process; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IMP:EcoliWiki.
# GO_processGO:0006270DNA replication initiation; IBA:GO_Central.
# GO_processGO:0006275regulation of DNA replication; IMP:EcoliWiki.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0008156negative regulation of DNA replication; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IDA:UniProtKB.
# GO_processGO:0006396RNA processing; IDA:UniProtKB.
# GO_processGO:0006974cellular response to DNA damage stimulus; IDA:UniProtKB.
# GO_processGO:0042245RNA repair; TAS:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IEA:UniProtKB-KW.
# GO_processGO:0006276plasmid maintenance; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0016094polyprenol biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009242colanic acid biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0042351'de novo' GDP-L-fucose biosynthetic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IBA:GO_Central.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:UniProtKB.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0030153bacteriocin immunity; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IMP:EcoliWiki.
# GO_processGO:0006810transport; IDA:EcoliWiki.
# GO_processGO:0006811ion transport; IDA:EcoliWiki.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009597detection of virus; IMP:EcoliWiki.
# GO_processGO:0034220ion transmembrane transport; IDA:EcoCyc.
# GO_processGO:0046718viral entry into host cell; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006071glycerol metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IMP:EcoCyc.
# GO_processGO:0006289nucleotide-excision repair; IEA:UniProtKB-HAMAP.
# GO_processGO:0009432SOS response; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015906sulfathiazole transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0022610biological adhesion; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0071806protein transmembrane transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009234menaquinone biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006400tRNA modification; IMP:EcoCyc.
# GO_processGO:0034605cellular response to heat; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015074DNA integration; IEA:UniProtKB-KW.
# RecNameSerine recombinase PinQ {ECO:0000250|UniProtKBP03015}
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IPI:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006402mRNA catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000920cell separation after cytokinesis; IMP:EcoliWiki.
# GO_processGO:0001896autolysis; IGI:EcoliWiki.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0009273peptidoglycan-based cell wall biogenesis; IMP:EcoCyc.
# GO_processGO:0042493response to drug; IMP:EcoCyc.
# GO_processGO:0051345positive regulation of hydrolase activity; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009117nucleotide metabolic process; IEA:InterPro.
# GO_processGO:0043094cellular metabolic compound salvage; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:2000144positive regulation of DNA-templated transcription, initiation; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0017004cytochrome complex assembly; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006396RNA processing; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0042938dipeptide transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006261DNA-dependent DNA replication; IMP:EcoCyc.
# GO_processGO:0006269DNA replication, synthesis of RNA primer; IEA:UniProtKB-KW.
# GO_processGO:0006270DNA replication initiation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009440cyanate catabolic process; IMP:EcoCyc.
# GO_processGO:0015976carbon utilization; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006208pyrimidine nucleobase catabolic process; IMP:EcoCyc.
# GO_processGO:0006210thymine catabolic process; IDA:CACAO.
# GO_processGO:0006212uracil catabolic process; IDA:UniProtKB.
# GO_processGO:0019740nitrogen utilization; IDA:UniProtKB.
# GO_processGO:0046306alkanesulfonate catabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006970response to osmotic stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:00193803-phenylpropionate catabolic process; IMP:EcoCyc.
# GO_processGO:0019439aromatic compound catabolic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0044010single-species biofilm formation; IGI:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IBA:GO_Central.
# GO_processGO:0042254ribosome biogenesis; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0032074negative regulation of nuclease activity; IDA:EcoCyc.
# GO_processGO:0042278purine nucleoside metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0060701negative regulation of ribonuclease activity; IEA:UniProtKB-HAMAP.
# GO_processGO:1900231regulation of single-species biofilm formation on inanimate substrate; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015761mannose transport; IDA:EcoCyc.
# GO_processGO:0061490glucose import into cell; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0002047phenazine biosynthetic process; IBA:GO_Central.
# GO_processGO:0009239enterobactin biosynthetic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006730one-carbon metabolic process; IBA:GO_Central.
# GO_processGO:0009086methionine biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0035999tetrahydrofolate interconversion; IEA:UniProtKB-UniPathway.
# GO_processGO:0046654tetrahydrofolate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015829valine transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015758glucose transport; IDA:EcoliWiki.
# GO_processGO:0015767lactose transport; IDA:EcoliWiki.
# GO_processGO:0036448cellular response to glucose-phosphate stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# COFACTORTRPE_ECOLIName=Mg(2+); Xref=ChEBI CHEBI 18420; Evidence={ECO 0000250|UniProtKB P00897}; Note=Binds 1 Mg(2+) ion per subunit. {ECO 0000250|UniProtKB P00897};
# GO_processGO:0000162tryptophan biosynthetic process; IDA:EcoCyc.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0055114oxidation-reduction process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006749glutathione metabolic process; IBA:GO_Central.
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0042953lipoprotein transport; IDA:EcoCyc.
# GO_processGO:0044874lipoprotein localization to outer membrane; IMP:CACAO.
# GO_processGO:0089705protein localization to outer membrane; IDA:CACAO.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0046688response to copper ion; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0019242methylglyoxal biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009306protein secretion; IEA:InterPro.
# GO_processGO:0044780bacterial-type flagellum assembly; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009253peptidoglycan catabolic process; IEA:InterPro.
# GO_processGO:0016998cell wall macromolecule catabolic process; IEA:InterPro.
# GO_processGO:0042742defense response to bacterium; IEA:UniProtKB-KW.
# GO_processGO:0044659cytolysis by virus of host cell; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006434seryl-tRNA aminoacylation; IDA:UniProtKB.
# GO_processGO:0016260selenocysteine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0097056selenocysteinyl-tRNA(Sec) biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006012galactose metabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0015836lipid-linked peptidoglycan transport; IDA:EcoCyc.
# GO_processGO:0034203glycolipid translocation; IMP:CACAO.
# GO_processGO:0034204lipid translocation; IDA:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IEA:UniProtKB-HAMAP.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0007059chromosome segregation; IEA:UniProtKB-HAMAP.
# GO_processGO:0030261chromosome condensation; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009267cellular response to starvation; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0044011single-species biofilm formation on inanimate substrate; IMP:EcoCyc.
# GO_processGO:0070301cellular response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0071276cellular response to cadmium ion; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0043953protein transport by the Tat complex; IDA:EcoCyc.
# GO_processGO:0065002intracellular protein transmembrane transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0034219carbohydrate transmembrane transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:1902021regulation of bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0070482response to oxygen levels; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0001680tRNA 3'-terminal CCA addition; IDA:EcoCyc.
# GO_processGO:0042245RNA repair; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009440cyanate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0048473D-methionine transport; IMP:CACAO.
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IBA:GO_Central.
# GO_processGO:0006412translation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006820anion transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
# GO_processGO:0071249cellular response to nitrate; IEP:EcoCyc.
# GO_processGO:0071250cellular response to nitrite; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006730one-carbon metabolic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006146adenine catabolic process; IBA:GO_Central.
# GO_processGO:0046101hypoxanthine biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0045454cell redox homeostasis; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0018012N-terminal peptidyl-alanine trimethylation; IMP:EcoCyc.
# GO_processGO:0018023peptidyl-lysine trimethylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0022904respiratory electron transport chain; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0032264IMP salvage; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0051604protein maturation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006414translational elongation; IBA:GO_Central.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0009437carnitine metabolic process; EXP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006820anion transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015986ATP synthesis coupled proton transport; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0008152metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0008616queuosine biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006798polyphosphate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0001407glycerophosphodiester transport; IDA:EcoCyc.
# GO_processGO:0015794glycerol-3-phosphate transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0016036cellular response to phosphate starvation; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0033317pantothenate biosynthetic process from valine; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0015937coenzyme A biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006364rRNA processing; IMP:EcoliWiki.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IMP:EcoCyc.
# GO_processGO:0006098pentose-phosphate shunt; IMP:EcoCyc.
# GO_processGO:0009372quorum sensing; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0005993trehalose catabolic process; IMP:EcoCyc.
# GO_processGO:0071474cellular hyperosmotic response; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0032259methylation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0015628protein secretion by the type II secretion system; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0042773ATP synthesis coupled electron transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0048870cell motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006886intracellular protein transport; IDA:EcoliWiki.
# GO_processGO:0009306protein secretion; IEA:InterPro.
# GO_processGO:0043952protein transport by the Sec complex; IDA:EcoCyc.
# GO_processGO:0065002intracellular protein transmembrane transport; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0071805potassium ion transmembrane transport; ISS:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0030308negative regulation of cell growth; IMP:EcoCyc.
# GO_processGO:0043488regulation of mRNA stability; IDA:UniProtKB.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
# GO_processGO:0009103lipopolysaccharide biosynthetic process; ISS:UniProtKB.
# GO_processGO:0009243O antigen biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0019305dTDP-rhamnose biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0045226extracellular polysaccharide biosynthetic process; ISS:UniProtKB.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015882L-ascorbic acid transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-HAMAP.
# GO_processGO:0051302regulation of cell division; IGI:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IEA:UniProtKB-HAMAP.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0030163protein catabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009970cellular response to sulfate starvation; IDA:EcoliWiki.
# GO_processGO:0033194response to hydroperoxide; IMP:EcoCyc.
# GO_processGO:0033195response to alkyl hydroperoxide; IMP:EcoCyc.
# GO_processGO:0033214iron assimilation by chelation and transport; IMP:CACAO.
# GO_processGO:0045454cell redox homeostasis; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IBA:GO_Central.
# GO_processGO:0006662glycerol ether metabolic process; IEA:InterPro.
# GO_processGO:0034599cellular response to oxidative stress; IBA:GO_Central.
# GO_processGO:0045454cell redox homeostasis; IBA:GO_Central.
# GO_processGO:0061077chaperone-mediated protein folding; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006053N-acetylmannosamine catabolic process; IMP:EcoCyc.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0009086methionine biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0043433negative regulation of sequence-specific DNA binding transcription factor activity; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0010033response to organic substance; IEA:InterPro.
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoliWiki.
# GO_processGO:0043165Gram-negative-bacterium-type cell outer membrane assembly; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IMP:EcoCyc.
# GO_processGO:0043171peptide catabolic process; IGI:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0019394glucarate catabolic process; IDA:EcoliWiki.
# GO_processGO:0042838D-glucarate catabolic process; IDA:EcoCyc.
# GO_processGO:0046392galactarate catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006189'de novo' IMP biosynthetic process; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0042493response to drug; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000731DNA synthesis involved in DNA repair; IMP:EcoliWiki.
# GO_processGO:0006260DNA replication; IEA:UniProtKB-HAMAP.
# GO_processGO:0006302double-strand break repair; IBA:GO_Central.
# GO_processGO:0009411response to UV; IMP:EcoliWiki.
# GO_processGO:0009432SOS response; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0042128nitrate assimilation; IDA:UniProtKB.
# GO_processGO:0051131chaperone-mediated protein complex assembly; IDA:UniProtKB.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006269DNA replication, synthesis of RNA primer; IMP:CACAO.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0022900electron transport chain; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009052pentose-phosphate shunt, non-oxidative branch; IBA:GO_Central.
# GO_processGO:0019323pentose catabolic process; IBA:GO_Central.
# GO_processGO:0044262cellular carbohydrate metabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0034775glutathione transmembrane transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0005980glycogen catabolic process; IMP:EcoCyc.
# GO_processGO:0016052carbohydrate catabolic process; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# AltNameFlavin transferase {ECO:0000250|UniProtKBA5F5Y3}
# CATALYTIC ACTIVITYFAD + [protein]-L-threonine = [protein]-FMN-L- threonine + AMP. {ECO:0000250|UniProtKBA5F5Y3}.
# COFACTORAPBE_ECOLIName=Mg(2+); Xref=ChEBI CHEBI 18420; Evidence={ECO 0000250|UniProtKB A5F5Y3};
# FUNCTIONAPBE_ECOLIFlavin transferase that catalyzes the transfer of the FMN moiety of FAD and its covalent binding to the hydroxyl group of a threonine residue in a target flavoprotein such as NqrB and NqrC, two subunits of the NQR complex. {ECO 0000250|UniProtKB A5F5Y3}.
# GO_processGO:0017013protein flavinylation; IEA:InterPro.
# RecNameFAD:protein FMN transferase {ECO0000250|UniProtKB:A5F5Y3}
# SUBCELLULAR LOCATIONAPBE_ECOLICell inner membrane {ECO 0000250|UniProtKB P41780, ECO 0000255|PROSITE- ProRule PRU00303}; Lipid-anchor {ECO 0000250|UniProtKB P41780, ECO 0000255|PROSITE-ProRule PRU00303}; Periplasmic side {ECO 0000250|UniProtKB P41780}.
EC_numberEC: {ECO:0000250|UniProtKB:A5F5Y3} {ECO:0000250|UniProtKB:A5F5Y3}
ENZYME2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3} {ECO:0000250|UniProtKB:A5F5Y3}
IntEnz2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3} {ECO:0000250|UniProtKB:A5F5Y3}
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009245lipid A biosynthetic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0042953lipoprotein transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009228thiamine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009229thiamine diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0043093FtsZ-dependent cytokinesis; IEA:UniProtKB-HAMAP.
# GO_processGO:0051258protein polymerization; IDA:EcoliWiki.
# GO_processGO:0051301cell division; IGI:CACAO.
# GO_processGO:0090529cell septum assembly; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006537glutamate biosynthetic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0015747urate transport; IMP:EcoCyc.
# GO_processGO:0015992proton transport; IEA:UniProtKB-KW.
# GO_processGO:0042906xanthine transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006468protein phosphorylation; IDA:EcoliWiki.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoliWiki.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoliWiki.
# GO_processGO:0071310cellular response to organic substance; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0008152metabolic process; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006208pyrimidine nucleobase catabolic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0003333amino acid transmembrane transport; IDA:EcoCyc.
# GO_processGO:0051454intracellular pH elevation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009094L-phenylalanine biosynthetic process; IGI:EcoliWiki.
# GO_processGO:0033585L-phenylalanine biosynthetic process from chorismate via phenylpyruvate; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IBA:GO_Central.
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0010106cellular response to iron ion starvation; IMP:EcoCyc.
# GO_processGO:0015976carbon utilization; IMP:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoliWiki.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:1902210positive regulation of bacterial-type flagellum assembly; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006769nicotinamide metabolic process; IBA:GO_Central.
# GO_processGO:0019363pyridine nucleotide biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0019674NAD metabolic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0033194response to hydroperoxide; IEP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006749glutathione metabolic process; IBA:GO_Central.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0051301cell division; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0032263GMP salvage; IMP:EcoCyc.
# GO_processGO:0032264IMP salvage; IDA:EcoCyc.
# GO_processGO:0032265XMP salvage; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006523alanine biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
# GO_processGO:0019272L-alanine biosynthetic process from pyruvate; IMP:EcoCyc.
# GO_processGO:0030632D-alanine biosynthetic process; IMP:UniProtKB.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0016226iron-sulfur cluster assembly; IMP:EcoCyc.
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0034219carbohydrate transmembrane transport; IBA:GO_Central.
# GO_processGO:0045912negative regulation of carbohydrate metabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006554lysine catabolic process; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006655phosphatidylglycerol biosynthetic process; IBA:GO_Central.
# GO_processGO:0016024CDP-diacylglycerol biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IBA:GO_Central.
# GO_processGO:0034219carbohydrate transmembrane transport; IBA:GO_Central.
# GO_processGO:0043610regulation of carbohydrate utilization; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0015741fumarate transport; IDA:EcoliWiki.
# GO_processGO:0070778L-aspartate transport; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006569tryptophan catabolic process; IMP:EcoCyc.
# GO_processGO:0031556transcriptional attenuation by ribosome; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006605protein targeting; IEA:UniProtKB-HAMAP.
# GO_processGO:0015031protein transport; IBA:GO_Central.
# GO_processGO:0043952protein transport by the Sec complex; IEA:UniProtKB-HAMAP.
# GO_processGO:0065002intracellular protein transmembrane transport; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0033345asparagine catabolic process via L-aspartate; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0045228slime layer polysaccharide biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006457protein folding; IEA:InterPro.
# GO_processGO:0009408response to heat; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
# GO_processGO:0006412translation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0000105histidine biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006119oxidative phosphorylation; IEA:UniProtKB-UniPathway.
# GO_processGO:0019646aerobic electron transport chain; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0019324L-lyxose metabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0031167rRNA methylation; IDA:UniProtKB.
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0008360regulation of cell shape; IMP:EcoliWiki.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0071555cell wall organization; IMP:EcoliWiki.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006145purine nucleobase catabolic process; IBA:GO_Central.
# GO_processGO:0009442allantoin assimilation pathway; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006869lipid transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006400tRNA modification; IBA:GO_Central.
# GO_processGO:0006419alanyl-tRNA aminoacylation; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006474N-terminal protein amino acid acetylation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0061077chaperone-mediated protein folding; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006150hypoxanthine oxidation; IMP:EcoliWiki.
# GO_processGO:0006166purine ribonucleoside salvage; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IBA:GO_Central.
# GO_processGO:0033499galactose catabolic process via UDP-galactose; IBA:GO_Central.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000302response to reactive oxygen species; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006813potassium ion transport; IDA:EcoliWiki.
# GO_processGO:0006885regulation of pH; IDA:EcoliWiki.
# GO_processGO:0009636response to toxic substance; IMP:EcoCyc.
# GO_processGO:0051595response to methylglyoxal; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0043164Gram-negative-bacterium-type cell wall biogenesis; IMP:EcoCyc.
# GO_processGO:0044036cell wall macromolecule metabolic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0002143tRNA wobble position uridine thiolation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0046294formaldehyde catabolic process; IMP:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006835dicarboxylic acid transport; IMP:EcoCyc.
# GO_processGO:0015810aspartate transport; IEA:InterPro.
# GO_processGO:0015813L-glutamate transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0006270DNA replication initiation; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009107lipoate biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0009249protein lipoylation; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006418tRNA aminoacylation for protein translation; IDA:EcoCyc.
# GO_processGO:0006421asparaginyl-tRNA aminoacylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0015682ferric iron transport; IMP:EcoCyc.
# GO_processGO:0015891siderophore transport; IEA:InterPro.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0000738DNA catabolic process, exonucleolytic; IDA:UniProtKB.
# GO_processGO:0006281DNA repair; IEA:UniProtKB-KW.
# GO_processGO:0006308DNA catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0046296glycolate catabolic process; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0002128tRNA nucleoside ribose methylation; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IMP:EcoliWiki.
# GO_processGO:0006261DNA-dependent DNA replication; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0019076viral release from host cell; IEA:InterPro.
# GO_processGO:0019835cytolysis; IEA:UniProtKB-KW.
# GO_processGO:0042742defense response to bacterium; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0046685response to arsenic-containing substance; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IEA:UniProtKB-HAMAP.
# GO_processGO:0006790sulfur compound metabolic process; IMP:EcoliWiki.
# GO_processGO:0070814hydrogen sulfide biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0015833peptide transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IBA:GO_Central.
# GO_processGO:0009245lipid A biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015882L-ascorbic acid transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006829zinc II ion transport; IMP:CACAO.
# GO_processGO:0070574cadmium ion transmembrane transport; IDA:EcoCyc.
# GO_processGO:0071577zinc II ion transmembrane transport; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0019323pentose catabolic process; IBA:GO_Central.
# GO_processGO:0019852L-ascorbic acid metabolic process; IEP:EcoCyc.
# GO_processGO:0019854L-ascorbic acid catabolic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:InterPro.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0046618drug export; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006208pyrimidine nucleobase catabolic process; IMP:EcoCyc.
# GO_processGO:0006212uracil catabolic process; IDA:UniProtKB.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019740nitrogen utilization; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0033539fatty acid beta-oxidation using acyl-CoA dehydrogenase; IBA:GO_Central.
# GO_processGO:0055088lipid homeostasis; IBA:GO_Central.
DataBaseIDURL or Descriptions
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006051N-acetylmannosamine metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0051604protein maturation; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:UniProtKB-KW.
# GO_processGO:0010810regulation of cell-substrate adhesion; IMP:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IEA:UniProtKB-HAMAP.
DataBaseIDURL or Descriptions
# GO_processGO:0006535cysteine biosynthetic process from serine; IDA:EcoCyc.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006532aspartate biosynthetic process; IGI:EcoliWiki.
# GO_processGO:0009097isoleucine biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009098leucine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009099valine biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoliWiki.
# GO_processGO:0006470protein dephosphorylation; IDA:EcoliWiki.
# GO_processGO:0016310phosphorylation; IDA:EcoliWiki.
# GO_processGO:0046777protein autophosphorylation; IMP:CACAO.
# GO_processGO:0047484regulation of response to osmotic stress; IMP:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0002184cytoplasmic translational termination; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006002fructose 6-phosphate metabolic process; IEA:InterPro.
# GO_processGO:0006007glucose catabolic process; IMP:EcoliWiki.
# GO_processGO:0006096glycolytic process; IDA:EcoliWiki.
# GO_processGO:0044275cellular carbohydrate catabolic process; IMP:EcoliWiki.
# GO_processGO:0051289protein homotetramerization; IPI:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IDA:EcoCyc.
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0030541plasmid partitioning; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0009253peptidoglycan catabolic process; IDA:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006414translational elongation; IBA:GO_Central.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IEA:UniProtKB-HAMAP.
# GO_processGO:0016310phosphorylation; IMP:EcoCyc.
# GO_processGO:0070814hydrogen sulfide biosynthetic process; IEA:UniProtKB-UniPathway.
DataBaseIDURL or Descriptions
# GO_processGO:0006276plasmid maintenance; IMP:EcoliWiki.
# GO_processGO:0006313transposition, DNA-mediated; IEA:UniProtKB-HAMAP.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0007059chromosome segregation; IEA:UniProtKB-HAMAP.
# GO_processGO:0042150plasmid recombination; IMP:EcoliWiki.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0071139resolution of recombination intermediates; IDA:EcoliWiki.
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006046N-acetylglucosamine catabolic process; IDA:UniProtKB.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IMP:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:UniProtKB.
DataBaseIDURL or Descriptions
# GO_processGO:0006986response to unfolded protein; IDA:EcoCyc.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0016485protein processing; IEA:InterPro.
DataBaseIDURL or Descriptions
# GO_processGO:0009097isoleucine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009099valine biosynthetic process; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0015906sulfathiazole transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
# GO_processGO:0015074DNA integration; IEA:InterPro.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0044349DNA excision; IMP:EcoCyc.
# GO_processGO:2000143negative regulation of DNA-templated transcription, initiation; IDA:EcoCyc.
DataBaseIDURL or Descriptions
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoCyc.
DataBaseIDURL or Descriptions
# GO_processGO:0022611dormancy process; IDA:UniProtKB.