DataBaseIDURL or Descriptions
UniProtKBREM_ECOLIhttp://www.uniprot.org/uniprot/REM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0042939tripeptide transport; IMP:EcoliWiki.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0042939http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042939
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBMPPA_ECOLIhttp://www.uniprot.org/uniprot/MPPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBTRPR_ECOLIhttp://www.uniprot.org/uniprot/TRPR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006265DNA topological change; IDA:EcoliWiki.
# GO_processGO:0006268DNA unwinding involved in DNA replication; IBA:GO_Central.
# GO_processGO:0007059chromosome segregation; IDA:EcoliWiki.
# GO_processGO:0007062sister chromatid cohesion; IMP:EcoliWiki.
# GO_processGO:0030541plasmid partitioning; IDA:EcoliWiki.
GO_processGO:0006265http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006265
GO_processGO:0006268http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006268
GO_processGO:0007059http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007059
GO_processGO:0007062http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007062
GO_processGO:0030541http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030541
UniProtKBPARC_ECOLIhttp://www.uniprot.org/uniprot/PARC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015846polyamine transport; IMP:EcoCyc.
GO_processGO:0015846http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015846
UniProtKBPOTC_ECOLIhttp://www.uniprot.org/uniprot/POTC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# GO_processGO:1902815N,N'-diacetylchitobiose import; IDA:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:1902815http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902815
UniProtKBPTQC_ECOLIhttp://www.uniprot.org/uniprot/PTQC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAJD_ECOLIhttp://www.uniprot.org/uniprot/YAJD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBRLPA_ECOLIhttp://www.uniprot.org/uniprot/RLPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000162tryptophan biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IMP:EcoliWiki.
GO_processGO:0000162http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000162
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
GO_processGO:0009073http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009073
UniProtKBTRPA_ECOLIhttp://www.uniprot.org/uniprot/TRPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002143tRNA wobble position uridine thiolation; IMP:EcoCyc.
GO_processGO:0002143http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002143
UniProtKBTUSE_ECOLIhttp://www.uniprot.org/uniprot/TUSE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006813potassium ion transport; IDA:EcoCyc.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
GO_processGO:0006813http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006813
GO_processGO:0044550http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044550
UniProtKBTRKA_ECOLIhttp://www.uniprot.org/uniprot/TRKA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046183L-idonate catabolic process; IEP:EcoCyc.
GO_processGO:0019521http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019521
GO_processGO:0046183http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046183
UniProtKBIDNO_ECOLIhttp://www.uniprot.org/uniprot/IDNO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006520cellular amino acid metabolic process; IEA:InterPro.
# GO_processGO:0009252peptidoglycan biosynthetic process; IBA:GO_Central.
GO_processGO:0006520http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006520
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
UniProtKBYGEA_ECOLIhttp://www.uniprot.org/uniprot/YGEA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0010447response to acidic pH; IMP:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0010447http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010447
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
UniProtKBEVGS_ECOLIhttp://www.uniprot.org/uniprot/EVGS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015724formate transport; IBA:GO_Central.
GO_processGO:0015724http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015724
UniProtKBFOCB_ECOLIhttp://www.uniprot.org/uniprot/FOCB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBMQSA_ECOLIhttp://www.uniprot.org/uniprot/MQSA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006779porphyrin-containing compound biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006783heme biosynthetic process; IMP:EcoCyc.
GO_processGO:0006779http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006779
GO_processGO:0006782http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006782
GO_processGO:0006783http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006783
UniProtKBHEMG_ECOLIhttp://www.uniprot.org/uniprot/HEMG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBNIKD_ECOLIhttp://www.uniprot.org/uniprot/NIKD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBDCRB_ECOLIhttp://www.uniprot.org/uniprot/DCRB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBARGK_ECOLIhttp://www.uniprot.org/uniprot/ARGK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006152purine nucleoside catabolic process; IBA:GO_Central.
# GO_processGO:0006206pyrimidine nucleobase metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IEA:InterPro.
# GO_processGO:0046133pyrimidine ribonucleoside catabolic process; IMP:EcoCyc.
GO_processGO:0006152http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006152
GO_processGO:0006206http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006206
GO_processGO:0015949http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015949
GO_processGO:0046133http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046133
UniProtKBRIHA_ECOLIhttp://www.uniprot.org/uniprot/RIHA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:UniProtKB-KW.
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
UniProtKBHTRL_ECOLIhttp://www.uniprot.org/uniprot/HTRL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYFHH_ECOLIhttp://www.uniprot.org/uniprot/YFHH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042838D-glucarate catabolic process; IDA:UniProtKB.
GO_processGO:0042838http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042838
UniProtKBGUDD_ECOLIhttp://www.uniprot.org/uniprot/GUDD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044781bacterial-type flagellum organization; IEA:UniProtKB-KW.
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
GO_processGO:0044781http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044781
GO_processGO:0071978http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071978
UniProtKBFLGD_ECOLIhttp://www.uniprot.org/uniprot/FLGD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0001887selenium compound metabolic process; IGI:EcoCyc.
# GO_processGO:0006534cysteine metabolic process; IEA:InterPro.
# GO_processGO:0006790sulfur compound metabolic process; IDA:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
# GO_processGO:0031162sulfur incorporation into metallo-sulfur cluster; IDA:EcoCyc.
GO_processGO:0001887http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0001887
GO_processGO:0006534http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006534
GO_processGO:0006790http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006790
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
GO_processGO:0031162http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031162
UniProtKBSUFS_ECOLIhttp://www.uniprot.org/uniprot/SUFS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBMALI_ECOLIhttp://www.uniprot.org/uniprot/MALI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBOMPW_ECOLIhttp://www.uniprot.org/uniprot/OMPW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019303D-ribose catabolic process; IMP:EcoCyc.
GO_processGO:0019303http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019303
UniProtKBRBSD_ECOLIhttp://www.uniprot.org/uniprot/RBSD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
UniProtKBPGAA_ECOLIhttp://www.uniprot.org/uniprot/PGAA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCBJ_ECOLIhttp://www.uniprot.org/uniprot/YCBJ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBNFSA_ECOLIhttp://www.uniprot.org/uniprot/NFSA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019563glycerol catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0046168glycerol-3-phosphate catabolic process; IMP:EcoCyc.
GO_processGO:0019563http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019563
GO_processGO:0046168http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046168
UniProtKBGLPD_ECOLIhttp://www.uniprot.org/uniprot/GLPD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYLIE_ECOLIhttp://www.uniprot.org/uniprot/YLIE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IMP:EcoCyc.
# GO_processGO:0007165signal transduction; IMP:EcoCyc.
GO_processGO:0006935http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006935
GO_processGO:0007165http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007165
UniProtKBMCP3_ECOLIhttp://www.uniprot.org/uniprot/MCP3_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019324L-lyxose metabolic process; IMP:EcoCyc.
GO_processGO:0019324http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019324
UniProtKBLYXK_ECOLIhttp://www.uniprot.org/uniprot/LYXK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1901575organic substance catabolic process; IBA:GO_Central.
GO_processGO:1901575http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1901575
UniProtKBYCIK_ECOLIhttp://www.uniprot.org/uniprot/YCIK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015803branched-chain amino acid transport; IMP:EcoCyc.
GO_processGO:0015803http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015803
UniProtKBLIVH_ECOLIhttp://www.uniprot.org/uniprot/LIVH_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAGB_ECOLIhttp://www.uniprot.org/uniprot/YAGB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006605protein targeting; IEA:InterPro.
# GO_processGO:0044780bacterial-type flagellum assembly; IEA:InterPro.
GO_processGO:0006605http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006605
GO_processGO:0044780http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044780
UniProtKBFLIR_ECOLIhttp://www.uniprot.org/uniprot/FLIR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:00060155-phosphoribose 1-diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009264deoxyribonucleotide catabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0043094cellular metabolic compound salvage; IEA:InterPro.
GO_processGO:0006015http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006015
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009264http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009264
GO_processGO:0043094http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043094
UniProtKBDEOB_ECOLIhttp://www.uniprot.org/uniprot/DEOB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCGY_ECOLIhttp://www.uniprot.org/uniprot/YCGY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006777Mo-molybdopterin cofactor biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0032324molybdopterin cofactor biosynthetic process; IMP:EcoCyc.
GO_processGO:0006777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006777
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0032324http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032324
UniProtKBMOAA_ECOLIhttp://www.uniprot.org/uniprot/MOAA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006559L-phenylalanine catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009435NAD biosynthetic process; IDA:EcoliWiki.
# GO_processGO:00461964-nitrophenol catabolic process; IDA:EcoliWiki.
GO_processGO:0006559http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006559
GO_processGO:0009435http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009435
GO_processGO:0046196http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046196
UniProtKBFEAB_ECOLIhttp://www.uniprot.org/uniprot/FEAB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYKFC_ECOLIhttp://www.uniprot.org/uniprot/YKFC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:InterPro.
# GO_processGO:0015685ferric-enterobactin transport; IMP:EcoCyc.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
GO_processGO:0015685http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015685
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
UniProtKBFEPE_ECOLIhttp://www.uniprot.org/uniprot/FEPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009432SOS response; IEP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009432
UniProtKBYDJM_ECOLIhttp://www.uniprot.org/uniprot/YDJM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0033359lysine biosynthetic process via diaminopimelate and N-succinyl-2-amino-6-ketopimelate; IGI:EcoCyc.
# GO_processGO:0042450arginine biosynthetic process via ornithine; IGI:EcoCyc.
GO_processGO:0033359http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033359
GO_processGO:0042450http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042450
UniProtKBARGD_ECOLIhttp://www.uniprot.org/uniprot/ARGD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFBP_ECOLIhttp://www.uniprot.org/uniprot/YFBP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006827high-affinity iron ion transmembrane transport; IBA:GO_Central.
# GO_processGO:0015684ferrous iron transport; IMP:EcoCyc.
GO_processGO:0006827http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006827
GO_processGO:0015684http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015684
UniProtKBEFEU_ECOLIhttp://www.uniprot.org/uniprot/EFEU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:InterPro.
# GO_processGO:0098656anion transmembrane transport; IBA:GO_Central.
GO_processGO:0006814http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006814
GO_processGO:0098656http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0098656
UniProtKBTTDT_ECOLIhttp://www.uniprot.org/uniprot/TTDT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006308DNA catabolic process; IMP:EcoCyc.
GO_processGO:0006308http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006308
UniProtKBEND1_ECOLIhttp://www.uniprot.org/uniprot/END1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYPHF_ECOLIhttp://www.uniprot.org/uniprot/YPHF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
UniProtKBRFAG_ECOLIhttp://www.uniprot.org/uniprot/RFAG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006422aspartyl-tRNA aminoacylation; IDA:EcoCyc.
GO_processGO:0006422http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006422
UniProtKBSYD_ECOLIhttp://www.uniprot.org/uniprot/SYD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBTHIB_ECOLIhttp://www.uniprot.org/uniprot/THIB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006829zinc II ion transport; IDA:EcoCyc.
# GO_processGO:0006876cellular cadmium ion homeostasis; IDA:EcoCyc.
# GO_processGO:0006882cellular zinc ion homeostasis; IDA:EcoCyc.
# GO_processGO:0010043response to zinc ion; IBA:GO_Central.
# GO_processGO:0015684ferrous iron transport; IDA:EcoCyc.
# GO_processGO:0015691cadmium ion transport; IDA:EcoCyc.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
# GO_processGO:0061088regulation of sequestering of zinc ion; IBA:GO_Central.
GO_processGO:0006829http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006829
GO_processGO:0006876http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006876
GO_processGO:0006882http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006882
GO_processGO:0010043http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010043
GO_processGO:0015684http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015684
GO_processGO:0015691http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015691
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
GO_processGO:0061088http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0061088
UniProtKBFIEF_ECOLIhttp://www.uniprot.org/uniprot/FIEF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009447putrescine catabolic process; IMP:EcoCyc.
GO_processGO:0009447http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009447
UniProtKBPUUC_ECOLIhttp://www.uniprot.org/uniprot/PUUC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009250glucan biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0032951regulation of beta-glucan biosynthetic process; IDA:EcoliWiki.
GO_processGO:0009250http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009250
GO_processGO:0032951http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032951
UniProtKBOPGD_ECOLIhttp://www.uniprot.org/uniprot/OPGD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAGN_ECOLIhttp://www.uniprot.org/uniprot/YAGN_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFJY_ECOLIhttp://www.uniprot.org/uniprot/YFJY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055130D-alanine catabolic process; IMP:EcoCyc.
GO_processGO:0055130http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055130
UniProtKBHINT_ECOLIhttp://www.uniprot.org/uniprot/HINT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019698D-galacturonate catabolic process; IMP:EcoCyc.
GO_processGO:0019698http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019698
UniProtKBUXAA_ECOLIhttp://www.uniprot.org/uniprot/UXAA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
# GO_processGO:0090549response to carbon starvation; IEP:EcoCyc.
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
GO_processGO:0090549http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0090549
UniProtKBCSID_ECOLIhttp://www.uniprot.org/uniprot/CSID_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDCZ_ECOLIhttp://www.uniprot.org/uniprot/YDCZ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0015074DNA integration; IMP:EcoCyc.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
UniProtKBFIMB_ECOLIhttp://www.uniprot.org/uniprot/FIMB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUAE_ECOLIhttp://www.uniprot.org/uniprot/YUAE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBKGUA_ECOLIhttp://www.uniprot.org/uniprot/KGUA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006014D-ribose metabolic process; IEA:InterPro.
GO_processGO:0006014http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006014
UniProtKBYDJH_ECOLIhttp://www.uniprot.org/uniprot/YDJH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1901530response to hypochlorite; IMP:EcoCyc.
GO_processGO:1901530http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1901530
UniProtKBRCLB_ECOLIhttp://www.uniprot.org/uniprot/RCLB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006097glyoxylate cycle; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IBA:GO_Central.
GO_processGO:0006097http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006097
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBICLR_ECOLIhttp://www.uniprot.org/uniprot/ICLR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0042493response to drug; IDA:EcoCyc.
GO_processGO:0006855http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006855
GO_processGO:0042493http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042493
UniProtKBACRD_ECOLIhttp://www.uniprot.org/uniprot/ACRD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0000746http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000746
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBTRAJ1_ECOLIhttp://www.uniprot.org/uniprot/TRAJ1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBMGLC_ECOLIhttp://www.uniprot.org/uniprot/MGLC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006554lysine catabolic process; IMP:EcoliWiki.
GO_processGO:0006554http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006554
UniProtKBLDCI_ECOLIhttp://www.uniprot.org/uniprot/LDCI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006633fatty acid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0008610lipid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009102biotin biosynthetic process; IMP:EcoCyc.
# GO_processGO:0030497fatty acid elongation; IMP:UniProtKB.
GO_processGO:0006633http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006633
GO_processGO:0008610http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008610
GO_processGO:0009102http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009102
GO_processGO:0030497http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030497
UniProtKBFABG_ECOLIhttp://www.uniprot.org/uniprot/FABG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEDM_ECOLIhttp://www.uniprot.org/uniprot/YEDM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0010468regulation of gene expression; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0010468http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010468
UniProtKBHHA_ECOLIhttp://www.uniprot.org/uniprot/HHA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGDI_ECOLIhttp://www.uniprot.org/uniprot/YGDI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0090529cell septum assembly; IEA:UniProtKB-HAMAP.
GO_processGO:0090529http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0090529
UniProtKBYCIB_ECOLIhttp://www.uniprot.org/uniprot/YCIB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IBA:GO_Central.
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0046336http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046336
UniProtKBEUTK_ECOLIhttp://www.uniprot.org/uniprot/EUTK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IMP:UniProtKB.
# GO_processGO:0009253peptidoglycan catabolic process; IMP:UniProtKB.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009253http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009253
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBAMPH_ECOLIhttp://www.uniprot.org/uniprot/AMPH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046618drug export; IMP:EcoCyc.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
GO_processGO:0046618http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046618
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBSUGE_ECOLIhttp://www.uniprot.org/uniprot/SUGE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0046677response to antibiotic; IMP:EcoliWiki.
# GO_processGO:0051301cell division; IMP:EcoliWiki.
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
UniProtKBFTSE_ECOLIhttp://www.uniprot.org/uniprot/FTSE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006879cellular iron ion homeostasis; IBA:GO_Central.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
# GO_processGO:0044571[2Fe-2S] cluster assembly; IBA:GO_Central.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IBA:GO_Central.
GO_processGO:0006879http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006879
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
GO_processGO:0044571http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044571
GO_processGO:0097428http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0097428
UniProtKBISCU_ECOLIhttp://www.uniprot.org/uniprot/ISCU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0034219carbohydrate transmembrane transport; IDA:EcoCyc.
GO_processGO:0034219http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034219
UniProtKBYIAN_ECOLIhttp://www.uniprot.org/uniprot/YIAN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0000746http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000746
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBTRAM1_ECOLIhttp://www.uniprot.org/uniprot/TRAM1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006833water transport; IMP:CACAO.
# GO_processGO:0006970response to osmotic stress; IMP:EcoCyc.
# GO_processGO:0009992cellular water homeostasis; IMP:EcoCyc.
# GO_processGO:0034220ion transmembrane transport; IBA:GO_Central.
GO_processGO:0006833http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006833
GO_processGO:0006970http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006970
GO_processGO:0009992http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009992
GO_processGO:0034220http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034220
UniProtKBAQPZ_ECOLIhttp://www.uniprot.org/uniprot/AQPZ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009245lipid A biosynthetic process; IDA:UniProtKB.
GO_processGO:0009245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009245
UniProtKBPAGP_ECOLIhttp://www.uniprot.org/uniprot/PAGP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019301rhamnose catabolic process; IMP:EcoCyc.
# GO_processGO:0042355L-fucose catabolic process; IEP:EcoCyc.
GO_processGO:0019301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019301
GO_processGO:0042355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042355
UniProtKBALDA_ECOLIhttp://www.uniprot.org/uniprot/ALDA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYPHD_ECOLIhttp://www.uniprot.org/uniprot/YPHD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009405pathogenesis; IBA:GO_Central.
# GO_processGO:0030260entry into host cell; IBA:GO_Central.
GO_processGO:0009405http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009405
GO_processGO:0030260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030260
UniProtKBYCHO_ECOLIhttp://www.uniprot.org/uniprot/YCHO_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCCE_ECOLIhttp://www.uniprot.org/uniprot/YCCE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYBBA_ECOLIhttp://www.uniprot.org/uniprot/YBBA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEEX_ECOLIhttp://www.uniprot.org/uniprot/YEEX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009082branched-chain amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009098leucine biosynthetic process; IDA:EcoCyc.
GO_processGO:0009082http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009082
GO_processGO:0009098http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009098
UniProtKBLEUC_ECOLIhttp://www.uniprot.org/uniprot/LEUC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009245lipid A biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:00361084-amino-4-deoxy-alpha-L-arabinopyranosyl undecaprenyl phosphate biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
GO_processGO:0009245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009245
GO_processGO:0036108http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0036108
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBARNC_ECOLIhttp://www.uniprot.org/uniprot/ARNC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYRDB_ECOLIhttp://www.uniprot.org/uniprot/YRDB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJIN_ECOLIhttp://www.uniprot.org/uniprot/YJIN_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDFA_ECOLIhttp://www.uniprot.org/uniprot/YDFA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006424glutamyl-tRNA aminoacylation; IMP:EcoCyc.
GO_processGO:0006424http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006424
UniProtKBSYE_ECOLIhttp://www.uniprot.org/uniprot/SYE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
UniProtKBRFAZ_ECOLIhttp://www.uniprot.org/uniprot/RFAZ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0015944formate oxidation; IDA:EcoCyc.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0015944http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015944
UniProtKBFDNG_ECOLIhttp://www.uniprot.org/uniprot/FDNG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFIB_ECOLIhttp://www.uniprot.org/uniprot/YFIB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009164nucleoside catabolic process; IEA:InterPro.
# GO_processGO:0019284L-methionine biosynthetic process from S-adenosylmethionine; IDA:EcoCyc.
# GO_processGO:0019509L-methionine biosynthetic process from methylthioadenosine; IEA:UniProtKB-UniPathway.
GO_processGO:0009164http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009164
GO_processGO:0019284http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019284
GO_processGO:0019509http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019509
UniProtKBMTNN_ECOLIhttp://www.uniprot.org/uniprot/MTNN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
GO_processGO:0010124http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010124
UniProtKBPAAB_ECOLIhttp://www.uniprot.org/uniprot/PAAB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0034355NAD salvage; IMP:EcoCyc.
# GO_processGO:0034628'de novo' NAD biosynthetic process from aspartate; IMP:EcoCyc.
GO_processGO:0034355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034355
GO_processGO:0034628http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034628
UniProtKBNADD_ECOLIhttp://www.uniprot.org/uniprot/NADD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBZRAP_ECOLIhttp://www.uniprot.org/uniprot/ZRAP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0014070response to organic cyclic compound; IMP:EcoliWiki.
# GO_processGO:0042930enterobactin transport; IGI:EcoliWiki.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0014070http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0014070
GO_processGO:0042930http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042930
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBTOLC_ECOLIhttp://www.uniprot.org/uniprot/TOLC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYBBY_ECOLIhttp://www.uniprot.org/uniprot/YBBY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IBA:GO_Central.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
UniProtKBTORY_ECOLIhttp://www.uniprot.org/uniprot/TORY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; EXP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBRELB_ECOLIhttp://www.uniprot.org/uniprot/RELB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0043137DNA replication, removal of RNA primer; IMP:EcoCyc.
GO_processGO:0043137http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043137
UniProtKBRNH_ECOLIhttp://www.uniprot.org/uniprot/RNH_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCFT_ECOLIhttp://www.uniprot.org/uniprot/YCFT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
UniProtKBAZOR_ECOLIhttp://www.uniprot.org/uniprot/AZOR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
UniProtKBPTPD_ECOLIhttp://www.uniprot.org/uniprot/PTPD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009132nucleoside diphosphate metabolic process; IEA:InterPro.
GO_processGO:0009132http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009132
UniProtKBNUDL_ECOLIhttp://www.uniprot.org/uniprot/NUDL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006807nitrogen compound metabolic process; IDA:EcoCyc.
# GO_processGO:0042542response to hydrogen peroxide; IEP:EcoliWiki.
# GO_processGO:0055114oxidation-reduction process; IMP:EcoliWiki.
GO_processGO:0006807http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006807
GO_processGO:0042542http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042542
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBHCP_ECOLIhttp://www.uniprot.org/uniprot/HCP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0043709cell adhesion involved in single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0043709http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043709
UniProtKBYADK_ECOLIhttp://www.uniprot.org/uniprot/YADK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044283small molecule biosynthetic process; IBA:GO_Central.
# GO_processGO:0051479mannosylglycerate biosynthetic process; IEA:InterPro.
GO_processGO:0044283http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044283
GO_processGO:0051479http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051479
UniProtKBMPGP_ECOLIhttp://www.uniprot.org/uniprot/MPGP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBYOHC_ECOLIhttp://www.uniprot.org/uniprot/YOHC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDJX_ECOLIhttp://www.uniprot.org/uniprot/YDJX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IDA:UniProtKB.
GO_processGO:0006782http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006782
UniProtKBHEMN_ECOLIhttp://www.uniprot.org/uniprot/HEMN_ECOLI
DataBaseIDURL or Descriptions
UniProtKBAPAG_ECOLIhttp://www.uniprot.org/uniprot/APAG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IMP:EcoCyc.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBSFMF_ECOLIhttp://www.uniprot.org/uniprot/SFMF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0031669cellular response to nutrient levels; IEP:EcoCyc.
# GO_processGO:0034220ion transmembrane transport; IBA:GO_Central.
GO_processGO:0031669http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031669
GO_processGO:0034220http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034220
UniProtKBYHJX_ECOLIhttp://www.uniprot.org/uniprot/YHJX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0034224cellular response to zinc ion starvation; IMP:EcoCyc.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
GO_processGO:0034224http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034224
UniProtKBRL31B_ECOLIhttp://www.uniprot.org/uniprot/RL31B_ECOLI
DataBaseIDURL or Descriptions
UniProtKBEXOD_ECOLIhttp://www.uniprot.org/uniprot/EXOD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJBR_ECOLIhttp://www.uniprot.org/uniprot/YJBR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBFLAW_ECOLIhttp://www.uniprot.org/uniprot/FLAW_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGGU_ECOLIhttp://www.uniprot.org/uniprot/YGGU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0012501programmed cell death; IMP:EcoCyc.
GO_processGO:0012501http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0012501
UniProtKBIBSE_ECOLIhttp://www.uniprot.org/uniprot/IBSE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IEP:EcoliWiki.
# GO_processGO:0051603proteolysis involved in cellular protein catabolic process; IMP:EcoCyc.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0051603http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051603
UniProtKBHSLV_ECOLIhttp://www.uniprot.org/uniprot/HSLV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0043711pilus organization; IEA:InterPro.
# GO_processGO:0061077chaperone-mediated protein folding; IEA:InterPro.
# GO_processGO:0071555cell wall organization; IEA:InterPro.
GO_processGO:0043711http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043711
GO_processGO:0061077http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0061077
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBYADV_ECOLIhttp://www.uniprot.org/uniprot/YADV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009063cellular amino acid catabolic process; IEA:InterPro.
GO_processGO:0009063http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009063
UniProtKBRHMD_ECOLIhttp://www.uniprot.org/uniprot/RHMD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006629lipid metabolic process; IBA:GO_Central.
GO_processGO:0006629http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006629
UniProtKBYNBC_ECOLIhttp://www.uniprot.org/uniprot/YNBC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
UniProtKBTTDB_ECOLIhttp://www.uniprot.org/uniprot/TTDB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBSAPB_ECOLIhttp://www.uniprot.org/uniprot/SAPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006096glycolytic process; IEA:UniProtKB-KW.
# GO_processGO:0006099tricarboxylic acid cycle; IBA:GO_Central.
GO_processGO:0006096http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006096
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
UniProtKBODO1_ECOLIhttp://www.uniprot.org/uniprot/ODO1_ECOLI
DataBaseIDURL or Descriptions
# AltNameFructose-like phosphotransferase enzyme IIB component 1 {ECO:0000250|UniProtKBP20966}
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- fructose(Side 1) = [protein]-L-histidine + D-fructose 1- phosphate(Side 2). {ECO:0000250|UniProtKBP20966}.
# FUNCTIONPTFB1_ECOLIThe phosphoenolpyruvate-dependent sugar phosphotransferase system (sugar PTS), a major carbohydrate active transport system, catalyzes the phosphorylation of incoming sugar substrates concomitantly with their translocation across the cell membrane. The enzyme II FryABC PTS system is involved in fructose transport. {ECO 0000250|UniProtKB P20966}.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# RecNamePTS system fructose-like EIIB component 1 {ECO:0000250|UniProtKBP20966}
EC_numberEC:2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://www.genome.jp/dbget-bin/www_bget?EC:2.7.1.202 {ECO:0000250|UniProtKB:P20966}
ENZYME2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://enzyme.expasy.org/EC/2.7.1.202 {ECO:0000250|UniProtKB:P20966}
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
IntEnz2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=2.7.1.202 {ECO:0000250|UniProtKB:P20966}
UniProtKBPTFB1_ECOLIhttp://www.uniprot.org/uniprot/PTFB1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0043433negative regulation of sequence-specific DNA binding transcription factor activity; IDA:EcoCyc.
# GO_processGO:1902201negative regulation of bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
# GO_processGO:2000678negative regulation of transcription regulatory region DNA binding; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0043433http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043433
GO_processGO:1902201http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902201
GO_processGO:2000678http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2000678
UniProtKBYDIV_ECOLIhttp://www.uniprot.org/uniprot/YDIV_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDFJ_ECOLIhttp://www.uniprot.org/uniprot/YDFJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006807nitrogen compound metabolic process; IEA:InterPro.
# GO_processGO:0042158lipoprotein biosynthetic process; IDA:EcoCyc.
GO_processGO:0006807http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006807
GO_processGO:0042158http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042158
UniProtKBLNT_ECOLIhttp://www.uniprot.org/uniprot/LNT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009245lipid A biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0036104Kdo2-lipid A biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
GO_processGO:0009245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009245
GO_processGO:0036104http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0036104
UniProtKBKDTA_ECOLIhttp://www.uniprot.org/uniprot/KDTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBYBGO_ECOLIhttp://www.uniprot.org/uniprot/YBGO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
GO_processGO:0032196http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032196
UniProtKBIND11_ECOLIhttp://www.uniprot.org/uniprot/IND11_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IDA:EcoCyc.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
UniProtKBNUDG_ECOLIhttp://www.uniprot.org/uniprot/NUDG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
UniProtKBSUFD_ECOLIhttp://www.uniprot.org/uniprot/SUFD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006878cellular copper ion homeostasis; IMP:EcoCyc.
# GO_processGO:0010272response to silver ion; IMP:EcoCyc.
# GO_processGO:0010273detoxification of copper ion; IMP:EcoCyc.
# GO_processGO:0015679plasma membrane copper ion transport; IGI:EcoCyc.
# GO_processGO:0046688response to copper ion; IMP:EcoliWiki.
# GO_processGO:0060003copper ion export; IGI:EcoCyc.
GO_processGO:0006878http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006878
GO_processGO:0010272http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010272
GO_processGO:0010273http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010273
GO_processGO:0015679http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015679
GO_processGO:0046688http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046688
GO_processGO:0060003http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0060003
UniProtKBCUSB_ECOLIhttp://www.uniprot.org/uniprot/CUSB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHGA_ECOLIhttp://www.uniprot.org/uniprot/YHGA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFDP_ECOLIhttp://www.uniprot.org/uniprot/YFDP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015847putrescine transport; IMP:EcoCyc.
# GO_processGO:0048870cell motility; IMP:EcoCyc.
GO_processGO:0015847http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015847
GO_processGO:0048870http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0048870
UniProtKBPLAP_ECOLIhttp://www.uniprot.org/uniprot/PLAP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006474N-terminal protein amino acid acetylation; IBA:GO_Central.
GO_processGO:0006474http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006474
UniProtKBMNAT_ECOLIhttp://www.uniprot.org/uniprot/MNAT_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBJJ_ECOLIhttp://www.uniprot.org/uniprot/YBJJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006536glutamate metabolic process; IEA:InterPro.
# GO_processGO:0051454intracellular pH elevation; IMP:EcoCyc.
GO_processGO:0006536http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006536
GO_processGO:0051454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051454
UniProtKBDCEB_ECOLIhttp://www.uniprot.org/uniprot/DCEB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEIS_ECOLIhttp://www.uniprot.org/uniprot/YEIS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IGI:EcoCyc.
# GO_processGO:0009252peptidoglycan biosynthetic process; IGI:EcoCyc.
# GO_processGO:0046677response to antibiotic; IGI:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBPBPB_ECOLIhttp://www.uniprot.org/uniprot/PBPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071705nitrogen compound transport; IBA:GO_Central.
GO_processGO:0071705http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071705
UniProtKBYEAV_ECOLIhttp://www.uniprot.org/uniprot/YEAV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0015833peptide transport; IEA:UniProtKB-KW.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0015833http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015833
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBDPPB_ECOLIhttp://www.uniprot.org/uniprot/DPPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-HAMAP.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBSGRR_ECOLIhttp://www.uniprot.org/uniprot/SGRR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGAU_ECOLIhttp://www.uniprot.org/uniprot/YGAU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBYQCA_ECOLIhttp://www.uniprot.org/uniprot/YQCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009267cellular response to starvation; IEA:InterPro.
# GO_processGO:0031669cellular response to nutrient levels; IEP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009267http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009267
GO_processGO:0031669http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031669
UniProtKBYJIY_ECOLIhttp://www.uniprot.org/uniprot/YJIY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015823phenylalanine transport; IGI:EcoliWiki.
GO_processGO:0015823http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015823
UniProtKBPHEP_ECOLIhttp://www.uniprot.org/uniprot/PHEP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006950response to stress; IEA:UniProtKB-HAMAP.
# GO_processGO:0030091protein repair; IDA:EcoCyc.
GO_processGO:0006950http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006950
GO_processGO:0030091http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030091
UniProtKBYTFE_ECOLIhttp://www.uniprot.org/uniprot/YTFE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006855http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006855
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBMDTG_ECOLIhttp://www.uniprot.org/uniprot/MDTG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006824cobalt ion transport; IMP:EcoCyc.
# GO_processGO:0006829zinc II ion transport; IMP:EcoliWiki.
# GO_processGO:0010312detoxification of zinc ion; IMP:EcoliWiki.
# GO_processGO:0015692lead ion transport; IMP:EcoCyc.
# GO_processGO:0046686response to cadmium ion; IMP:EcoliWiki.
GO_processGO:0006824http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006824
GO_processGO:0006829http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006829
GO_processGO:0010312http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010312
GO_processGO:0015692http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015692
GO_processGO:0046686http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046686
UniProtKBATZN_ECOLIhttp://www.uniprot.org/uniprot/ATZN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYHJB_ECOLIhttp://www.uniprot.org/uniprot/YHJB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009063cellular amino acid catabolic process; IEA:InterPro.
# GO_processGO:0009254peptidoglycan turnover; IEA:UniProtKB-UniPathway.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0009063http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009063
GO_processGO:0009254http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009254
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBAEEP_ECOLIhttp://www.uniprot.org/uniprot/AEEP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000725recombinational repair; IMP:EcoCyc.
GO_processGO:0000725http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000725
UniProtKBRUVC_ECOLIhttp://www.uniprot.org/uniprot/RUVC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGGS_ECOLIhttp://www.uniprot.org/uniprot/YGGS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009249protein lipoylation; IMP:EcoCyc.
# GO_processGO:0018055peptidyl-lysine lipoylation; IEA:UniProtKB-HAMAP.
GO_processGO:0009249http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009249
GO_processGO:0018055http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018055
UniProtKBLPLA_ECOLIhttp://www.uniprot.org/uniprot/LPLA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006265DNA topological change; IMP:EcoliWiki.
# GO_processGO:0006268DNA unwinding involved in DNA replication; IBA:GO_Central.
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoliWiki.
# GO_processGO:0007059chromosome segregation; IBA:GO_Central.
# GO_processGO:0042493response to drug; IMP:EcoliWiki.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006265http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006265
GO_processGO:0006268http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006268
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0007059http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007059
GO_processGO:0042493http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042493
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBGYRA_ECOLIhttp://www.uniprot.org/uniprot/GYRA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBTRBG_ECOLIhttp://www.uniprot.org/uniprot/TRBG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006564L-serine biosynthetic process; IDA:EcoliWiki.
# GO_processGO:0008652cellular amino acid biosynthetic process; IDA:EcoliWiki.
GO_processGO:0006564http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006564
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
UniProtKBSERB_ECOLIhttp://www.uniprot.org/uniprot/SERB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIFB_ECOLIhttp://www.uniprot.org/uniprot/YIFB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBOMPC_ECOLIhttp://www.uniprot.org/uniprot/OMPC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBABGR_ECOLIhttp://www.uniprot.org/uniprot/ABGR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCAQ_ECOLIhttp://www.uniprot.org/uniprot/YCAQ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDCL_ECOLIhttp://www.uniprot.org/uniprot/YDCL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
UniProtKBCHBF_ECOLIhttp://www.uniprot.org/uniprot/CHBF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBYBJX_ECOLIhttp://www.uniprot.org/uniprot/YBJX_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJIG_ECOLIhttp://www.uniprot.org/uniprot/YJIG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015889cobalamin transport; IMP:EcoliWiki.
GO_processGO:0015889http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015889
UniProtKBBTUF_ECOLIhttp://www.uniprot.org/uniprot/BTUF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAAW_ECOLIhttp://www.uniprot.org/uniprot/YAAW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBYKGN_ECOLIhttp://www.uniprot.org/uniprot/YKGN_ECOLI
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITYPhosphoenolpyruvate + protein L-histidine = pyruvate + protein N(pi)-phospho-L-histidine. {ECO:0000250|UniProtKBP08839}.
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- fructose(Side 1) = [protein]-L-histidine + D-fructose 1- phosphate(Side 2). {ECO:0000250|UniProtKBP20966}.
# COFACTORPTFX1_ECOLIName=Mg(2+); Xref=ChEBI CHEBI 18420; Evidence={ECO 0000250|UniProtKB P08839};
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
EC_numberEC:2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://www.genome.jp/dbget-bin/www_bget?EC:2.7.1.202 {ECO:0000250|UniProtKB:P20966}
EC_numberEC:2.7.3.9 {ECO:0000250|UniProtKB:P08839}http://www.genome.jp/dbget-bin/www_bget?EC:2.7.3.9 {ECO:0000250|UniProtKB:P08839}
ENZYME2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://enzyme.expasy.org/EC/2.7.1.202 {ECO:0000250|UniProtKB:P20966}
ENZYME2.7.3.9 {ECO:0000250|UniProtKB:P08839}http://enzyme.expasy.org/EC/2.7.3.9 {ECO:0000250|UniProtKB:P08839}
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
IntEnz2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=2.7.1.202 {ECO:0000250|UniProtKB:P20966}
IntEnz2.7.3.9 {ECO:0000250|UniProtKB:P08839}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=2.7.3.9 {ECO:0000250|UniProtKB:P08839}
UniProtKBPTFX1_ECOLIhttp://www.uniprot.org/uniprot/PTFX1_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEAP_ECOLIhttp://www.uniprot.org/uniprot/YEAP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYMFL_ECOLIhttp://www.uniprot.org/uniprot/YMFL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYAHA_ECOLIhttp://www.uniprot.org/uniprot/YAHA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IEA:InterPro.
GO_processGO:0071973http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071973
UniProtKBFLGL_ECOLIhttp://www.uniprot.org/uniprot/FLGL_ECOLI
DataBaseIDURL or Descriptions
UniProtKBGLNP_ECOLIhttp://www.uniprot.org/uniprot/GLNP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006526arginine biosynthetic process; IDA:EcoCyc.
GO_processGO:0006526http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006526
UniProtKBARGA_ECOLIhttp://www.uniprot.org/uniprot/ARGA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006633fatty acid biosynthetic process; IDA:EcoCyc.
GO_processGO:0006633http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006633
UniProtKBACPH_ECOLIhttp://www.uniprot.org/uniprot/ACPH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006527arginine catabolic process; IMP:EcoliWiki.
# GO_processGO:0019544arginine catabolic process to glutamate; IEA:UniProtKB-HAMAP.
# GO_processGO:0019545arginine catabolic process to succinate; IEA:UniProtKB-UniPathway.
GO_processGO:0006527http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006527
GO_processGO:0019544http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019544
GO_processGO:0019545http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019545
UniProtKBASTB_ECOLIhttp://www.uniprot.org/uniprot/ASTB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBPSPE_ECOLIhttp://www.uniprot.org/uniprot/PSPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015739sialic acid transport; IDA:EcoCyc.
GO_processGO:0015739http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015739
UniProtKBNANT_ECOLIhttp://www.uniprot.org/uniprot/NANT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYEHT_ECOLIhttp://www.uniprot.org/uniprot/YEHT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006465signal peptide processing; IDA:EcoCyc.
GO_processGO:0006465http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006465
UniProtKBLSPA_ECOLIhttp://www.uniprot.org/uniprot/LSPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IEA:UniProtKB-KW.
GO_processGO:0000746http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000746
UniProtKBTRAH1_ECOLIhttp://www.uniprot.org/uniprot/TRAH1_ECOLI
DataBaseIDURL or Descriptions
UniProtKBMOKB_ECOLIhttp://www.uniprot.org/uniprot/MOKB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQIK_ECOLIhttp://www.uniprot.org/uniprot/YQIK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDIJ_ECOLIhttp://www.uniprot.org/uniprot/YDIJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000917barrier septum assembly; IMP:EcoliWiki.
# GO_processGO:0043093FtsZ-dependent cytokinesis; IEA:UniProtKB-HAMAP.
GO_processGO:0000917http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000917
GO_processGO:0043093http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043093
UniProtKBZIPA_ECOLIhttp://www.uniprot.org/uniprot/ZIPA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQIB_ECOLIhttp://www.uniprot.org/uniprot/YQIB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:19027776-sulfoquinovose(1-) catabolic process; IMP:EcoCyc.
GO_processGO:1902777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902777
UniProtKBSQUT_ECOLIhttp://www.uniprot.org/uniprot/SQUT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015847putrescine transport; IMP:EcoCyc.
GO_processGO:0015847http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015847
UniProtKBPOTI_ECOLIhttp://www.uniprot.org/uniprot/POTI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBPHNB_ECOLIhttp://www.uniprot.org/uniprot/PHNB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006793phosphorus metabolic process; IMP:EcoCyc.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IMP:EcoCyc.
# GO_processGO:0015970guanosine tetraphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0015974guanosine pentaphosphate catabolic process; IEA:InterPro.
# GO_processGO:0042594response to starvation; IMP:EcoCyc.
GO_processGO:0006793http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006793
GO_processGO:0015949http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015949
GO_processGO:0015970http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015970
GO_processGO:0015974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015974
GO_processGO:0042594http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042594
UniProtKBGPPA_ECOLIhttp://www.uniprot.org/uniprot/GPPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IEA:InterPro.
# GO_processGO:0006520cellular amino acid metabolic process; IEA:InterPro.
# GO_processGO:0009220pyrimidine ribonucleotide biosynthetic process; IBA:GO_Central.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006207http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006207
GO_processGO:0006520http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006520
GO_processGO:0009220http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009220
GO_processGO:0044205http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044205
UniProtKBPYRB_ECOLIhttp://www.uniprot.org/uniprot/PYRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBOGRK_ECOLIhttp://www.uniprot.org/uniprot/OGRK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEHP_ECOLIhttp://www.uniprot.org/uniprot/YEHP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006457protein folding; IEA:UniProtKB-HAMAP.
# GO_processGO:0044781bacterial-type flagellum organization; IEA:UniProtKB-KW.
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
# GO_processGO:1902209negative regulation of bacterial-type flagellum assembly; IEA:UniProtKB-HAMAP.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006457http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006457
GO_processGO:0044781http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044781
GO_processGO:0071973http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071973
GO_processGO:1902209http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902209
UniProtKBFLIT_ECOLIhttp://www.uniprot.org/uniprot/FLIT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0046336http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046336
UniProtKBEUTE_ECOLIhttp://www.uniprot.org/uniprot/EUTE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IEP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0042542http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042542
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
UniProtKBBSMA_ECOLIhttp://www.uniprot.org/uniprot/BSMA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBHTGA_ECOLIhttp://www.uniprot.org/uniprot/HTGA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IGI:EcoCyc.
# GO_processGO:0009108coenzyme biosynthetic process; IGI:EcoCyc.
GO_processGO:0006744http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006744
GO_processGO:0009108http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009108
UniProtKBUBIX_ECOLIhttp://www.uniprot.org/uniprot/UBIX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006817phosphate ion transport; IDA:EcoCyc.
GO_processGO:0006817http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006817
UniProtKBPSTC_ECOLIhttp://www.uniprot.org/uniprot/PSTC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009992cellular water homeostasis; IBA:GO_Central.
# GO_processGO:0015793glycerol transport; IDA:UniProtKB.
# GO_processGO:0034220ion transmembrane transport; IBA:GO_Central.
# GO_processGO:0071288cellular response to mercury ion; IDA:UniProtKB.
GO_processGO:0009992http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009992
GO_processGO:0015793http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015793
GO_processGO:0034220http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034220
GO_processGO:0071288http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071288
UniProtKBGLPF_ECOLIhttp://www.uniprot.org/uniprot/GLPF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:2000144positive regulation of DNA-templated transcription, initiation; IDA:EcoCyc.
# GO_processGO:2001023regulation of response to drug; IMP:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
GO_processGO:2000144http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2000144
GO_processGO:2001023http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2001023
UniProtKBBAER_ECOLIhttp://www.uniprot.org/uniprot/BAER_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000716transcription-coupled nucleotide-excision repair, DNA damage recognition; IDA:EcoCyc.
# GO_processGO:0006281DNA repair; IMP:EcoliWiki.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoliWiki.
# GO_processGO:0006974cellular response to DNA damage stimulus; IDA:EcoliWiki.
GO_processGO:0000716http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000716
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBMFD_ECOLIhttp://www.uniprot.org/uniprot/MFD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009163nucleoside biosynthetic process; IEA:InterPro.
# GO_processGO:0009236cobalamin biosynthetic process; IMP:EcoliWiki.
GO_processGO:0009163http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009163
GO_processGO:0009236http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009236
UniProtKBCOBT_ECOLIhttp://www.uniprot.org/uniprot/COBT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006529asparagine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0070981L-asparagine biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006529http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006529
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0070981http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070981
UniProtKBASNA_ECOLIhttp://www.uniprot.org/uniprot/ASNA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHBU_ECOLIhttp://www.uniprot.org/uniprot/YHBU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
GO_processGO:0032196http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032196
UniProtKBINSD7_ECOLIhttp://www.uniprot.org/uniprot/INSD7_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFJQ_ECOLIhttp://www.uniprot.org/uniprot/YFJQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042545cell wall modification; IEA:InterPro.
GO_processGO:0042545http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042545
UniProtKBYBHC_ECOLIhttp://www.uniprot.org/uniprot/YBHC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJIS_ECOLIhttp://www.uniprot.org/uniprot/YJIS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006817phosphate ion transport; IEA:UniProtKB-KW.
# GO_processGO:2000142regulation of DNA-templated transcription, initiation; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006817http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006817
GO_processGO:2000142http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2000142
UniProtKBPHOB_ECOLIhttp://www.uniprot.org/uniprot/PHOB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015797mannitol transport; IDA:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0015797http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015797
UniProtKBPTM3C_ECOLIhttp://www.uniprot.org/uniprot/PTM3C_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IEA:InterPro.
# GO_processGO:0019854L-ascorbic acid catabolic process; IEP:EcoCyc.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006207http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006207
GO_processGO:0019854http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019854
UniProtKBULAD_ECOLIhttp://www.uniprot.org/uniprot/ULAD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0045471response to ethanol; IEP:EcoliWiki.
# GO_processGO:0046187acetaldehyde catabolic process; IDA:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0045471http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045471
GO_processGO:0046187http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046187
UniProtKBADHP_ECOLIhttp://www.uniprot.org/uniprot/ADHP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0032359provirus excision; IMP:EcoCyc.
# GO_processGO:0046718viral entry into host cell; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0032359http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032359
GO_processGO:0046718http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046718
UniProtKBINTA_ECOLIhttp://www.uniprot.org/uniprot/INTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBSRLR_ECOLIhttp://www.uniprot.org/uniprot/SRLR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYMCE_ECOLIhttp://www.uniprot.org/uniprot/YMCE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IEP:EcoliWiki.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
UniProtKBHSLJ_ECOLIhttp://www.uniprot.org/uniprot/HSLJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
UniProtKBYGHO_ECOLIhttp://www.uniprot.org/uniprot/YGHO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoliWiki.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoliWiki.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBOMPR_ECOLIhttp://www.uniprot.org/uniprot/OMPR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007234osmosensory signaling via phosphorelay pathway; IDA:EcoCyc.
# GO_processGO:0009593detection of chemical stimulus; IDA:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
GO_processGO:0007234http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007234
GO_processGO:0009593http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009593
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
UniProtKBKDPD_ECOLIhttp://www.uniprot.org/uniprot/KDPD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015853adenine transport; IDA:EcoCyc.
GO_processGO:0015853http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015853
UniProtKBADEP_ECOLIhttp://www.uniprot.org/uniprot/ADEP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006152purine nucleoside catabolic process; IBA:GO_Central.
# GO_processGO:0006206pyrimidine nucleobase metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0042454ribonucleoside catabolic process; IDA:EcoCyc.
GO_processGO:0006144http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006144
GO_processGO:0006152http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006152
GO_processGO:0006206http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006206
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0042454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042454
UniProtKBRIHC_ECOLIhttp://www.uniprot.org/uniprot/RIHC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGHS_ECOLIhttp://www.uniprot.org/uniprot/YGHS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IBA:GO_Central.
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBYDGJ_ECOLIhttp://www.uniprot.org/uniprot/YDGJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-HAMAP.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
UniProtKBGNGF_ECOLIhttp://www.uniprot.org/uniprot/GNGF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0010447response to acidic pH; IMP:EcoCyc.
# GO_processGO:0044092negative regulation of molecular function; IMP:EcoCyc.
# GO_processGO:0070298negative regulation of phosphorelay signal transduction system; IDA:UniProtKB.
# GO_processGO:0071286cellular response to magnesium ion; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0010447http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010447
GO_processGO:0044092http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044092
GO_processGO:0070298http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070298
GO_processGO:0071286http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071286
UniProtKBMGRB_ECOLIhttp://www.uniprot.org/uniprot/MGRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
UniProtKBFECC_ECOLIhttp://www.uniprot.org/uniprot/FECC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEDN_ECOLIhttp://www.uniprot.org/uniprot/YEDN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
UniProtKBRFAL_ECOLIhttp://www.uniprot.org/uniprot/RFAL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0043709cell adhesion involved in single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0043709http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043709
UniProtKBELFA_ECOLIhttp://www.uniprot.org/uniprot/ELFA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGGP_ECOLIhttp://www.uniprot.org/uniprot/YGGP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAFX_ECOLIhttp://www.uniprot.org/uniprot/YAFX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015757galactose transport; IDA:EcoCyc.
GO_processGO:0015757http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015757
UniProtKBYTFQ_ECOLIhttp://www.uniprot.org/uniprot/YTFQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009447putrescine catabolic process; IMP:EcoCyc.
# GO_processGO:0009448gamma-aminobutyric acid metabolic process; IEA:InterPro.
GO_processGO:0009447http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009447
GO_processGO:0009448http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009448
UniProtKBPUUE_ECOLIhttp://www.uniprot.org/uniprot/PUUE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBHYDN_ECOLIhttp://www.uniprot.org/uniprot/HYDN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoCyc.
# GO_processGO:0042177negative regulation of protein catabolic process; IDA:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0042177http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042177
UniProtKBIRAD_ECOLIhttp://www.uniprot.org/uniprot/IRAD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBSFSA_ECOLIhttp://www.uniprot.org/uniprot/SFSA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0022904respiratory electron transport chain; IEA:InterPro.
GO_processGO:0022904http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022904
UniProtKBC561_ECOLIhttp://www.uniprot.org/uniprot/C561_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000028ribosomal small subunit assembly; IMP:EcoCyc.
# GO_processGO:0030490maturation of SSU-rRNA; IMP:EcoliWiki.
GO_processGO:0000028http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000028
GO_processGO:0030490http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030490
UniProtKBRIMM_ECOLIhttp://www.uniprot.org/uniprot/RIMM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0015851nucleobase transport; IBA:GO_Central.
GO_processGO:0006144http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006144
GO_processGO:0015851http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015851
UniProtKBALLP_ECOLIhttp://www.uniprot.org/uniprot/ALLP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006772thiamine metabolic process; IEA:InterPro.
# GO_processGO:0009229thiamine diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006772http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006772
GO_processGO:0009229http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009229
UniProtKBTHIK_ECOLIhttp://www.uniprot.org/uniprot/THIK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBCINAL_ECOLIhttp://www.uniprot.org/uniprot/CINAL_ECOLI
DataBaseIDURL or Descriptions
UniProtKBPPDA_ECOLIhttp://www.uniprot.org/uniprot/PPDA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006014D-ribose metabolic process; IEA:InterPro.
GO_processGO:0006014http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006014
UniProtKBYEGV_ECOLIhttp://www.uniprot.org/uniprot/YEGV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0043164Gram-negative-bacterium-type cell wall biogenesis; IMP:EcoCyc.
# GO_processGO:0044036cell wall macromolecule metabolic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0043164http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043164
GO_processGO:0044036http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044036
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBYCBB_ECOLIhttp://www.uniprot.org/uniprot/YCBB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006636unsaturated fatty acid biosynthetic process; IMP:EcoCyc.
GO_processGO:0006636http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006636
UniProtKBGNSB_ECOLIhttp://www.uniprot.org/uniprot/GNSB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042413carnitine catabolic process; EXP:EcoliWiki.
GO_processGO:0042413http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042413
UniProtKBCAIB_ECOLIhttp://www.uniprot.org/uniprot/CAIB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
GO_processGO:0010124http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010124
UniProtKBPAAC_ECOLIhttp://www.uniprot.org/uniprot/PAAC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008033tRNA processing; IEA:UniProtKB-HAMAP.
# GO_processGO:0009451RNA modification; IEA:InterPro.
# GO_processGO:0016226iron-sulfur cluster assembly; IBA:GO_Central.
GO_processGO:0008033http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008033
GO_processGO:0009451http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009451
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
UniProtKBYGFZ_ECOLIhttp://www.uniprot.org/uniprot/YGFZ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYZGL_ECOLIhttp://www.uniprot.org/uniprot/YZGL_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHEU_ECOLIhttp://www.uniprot.org/uniprot/YHEU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBYHCF_ECOLIhttp://www.uniprot.org/uniprot/YHCF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBDJLA_ECOLIhttp://www.uniprot.org/uniprot/DJLA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYHHS_ECOLIhttp://www.uniprot.org/uniprot/YHHS_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFIP_ECOLIhttp://www.uniprot.org/uniprot/YFIP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
GO_processGO:0032196http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032196
UniProtKBINSF7_ECOLIhttp://www.uniprot.org/uniprot/INSF7_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0034775glutathione transmembrane transport; IDA:EcoCyc.
GO_processGO:0034775http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034775
UniProtKBGSID_ECOLIhttp://www.uniprot.org/uniprot/GSID_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0010795regulation of ubiquinone biosynthetic process; IEA:UniProtKB-HAMAP.
GO_processGO:0006744http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006744
GO_processGO:0010795http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010795
UniProtKBUBIB_ECOLIhttp://www.uniprot.org/uniprot/UBIB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006631fatty acid metabolic process; IEA:InterPro.
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
GO_processGO:0006631http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006631
GO_processGO:0010124http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010124
UniProtKBPAAH_ECOLIhttp://www.uniprot.org/uniprot/PAAH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006004fucose metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006004http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006004
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBFUCR_ECOLIhttp://www.uniprot.org/uniprot/FUCR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCHN_ECOLIhttp://www.uniprot.org/uniprot/YCHN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IMP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009432SOS response; IMP:EcoCyc.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009432
UniProtKBUMUD_ECOLIhttp://www.uniprot.org/uniprot/UMUD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0043708cell adhesion involved in biofilm formation; IMP:EcoCyc.
GO_processGO:0043708http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043708
UniProtKBPGAD_ECOLIhttp://www.uniprot.org/uniprot/PGAD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006094gluconeogenesis; IBA:GO_Central.
# GO_processGO:0006096glycolytic process; IBA:GO_Central.
# GO_processGO:0043456regulation of pentose-phosphate shunt; IBA:GO_Central.
GO_processGO:0006094http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006094
GO_processGO:0006096http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006096
GO_processGO:0043456http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043456
UniProtKBGPMA_ECOLIhttp://www.uniprot.org/uniprot/GPMA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
GO_processGO:0009297http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009297
UniProtKBYHCD_ECOLIhttp://www.uniprot.org/uniprot/YHCD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006083acetate metabolic process; IMP:CACAO.
# GO_processGO:0019413acetate biosynthetic process; IMP:EcoCyc.
# GO_processGO:0019427acetyl-CoA biosynthetic process from acetate; IMP:EcoCyc.
# GO_processGO:0045733acetate catabolic process; IMP:EcoCyc.
# GO_processGO:0070689L-threonine catabolic process to propionate; IMP:EcoCyc.
GO_processGO:0006083http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006083
GO_processGO:0019413http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019413
GO_processGO:0019427http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019427
GO_processGO:0045733http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045733
GO_processGO:0070689http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070689
UniProtKBPTA_ECOLIhttp://www.uniprot.org/uniprot/PTA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBEPMB_ECOLIhttp://www.uniprot.org/uniprot/EPMB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYNID_ECOLIhttp://www.uniprot.org/uniprot/YNID_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQAE_ECOLIhttp://www.uniprot.org/uniprot/YQAE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0043213bacteriocin transport; IEA:UniProtKB-KW.
# GO_processGO:0050821protein stabilization; IMP:EcoCyc.
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0043213http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043213
GO_processGO:0050821http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0050821
UniProtKBEXBD_ECOLIhttp://www.uniprot.org/uniprot/EXBD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006226dUMP biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006229dUTP biosynthetic process; IEA:InterPro.
# GO_processGO:0009220pyrimidine ribonucleotide biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IMP:EcoCyc.
GO_processGO:0006226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006226
GO_processGO:0006229http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006229
GO_processGO:0009220http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009220
GO_processGO:0015949http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015949
UniProtKBDCD_ECOLIhttp://www.uniprot.org/uniprot/DCD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQIA_ECOLIhttp://www.uniprot.org/uniprot/YQIA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBMOLR_ECOLIhttp://www.uniprot.org/uniprot/MOLR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBBCSG_ECOLIhttp://www.uniprot.org/uniprot/BCSG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005985sucrose metabolic process; IEA:InterPro.
GO_processGO:0005985http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005985
UniProtKBSUCP_ECOLIhttp://www.uniprot.org/uniprot/SUCP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYECN_ECOLIhttp://www.uniprot.org/uniprot/YECN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoCyc.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0015920http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015920
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBLPTG_ECOLIhttp://www.uniprot.org/uniprot/LPTG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009249protein lipoylation; IEA:InterPro.
# GO_processGO:0042158lipoprotein biosynthetic process; IDA:EcoCyc.
GO_processGO:0009249http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009249
GO_processGO:0042158http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042158
UniProtKBLGT_ECOLIhttp://www.uniprot.org/uniprot/LGT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0022904respiratory electron transport chain; IEA:InterPro.
GO_processGO:0022904http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022904
UniProtKBPHSC_ECOLIhttp://www.uniprot.org/uniprot/PHSC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDCO_ECOLIhttp://www.uniprot.org/uniprot/YDCO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009438methylglyoxal metabolic process; IDA:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009438http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009438
UniProtKBGPR_ECOLIhttp://www.uniprot.org/uniprot/GPR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0016485protein processing; IBA:GO_Central.
GO_processGO:0016485http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016485
UniProtKBHYCI_ECOLIhttp://www.uniprot.org/uniprot/HYCI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019294keto-3-deoxy-D-manno-octulosonic acid biosynthetic process; IDA:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
GO_processGO:0019294http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019294
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
UniProtKBKDSA_ECOLIhttp://www.uniprot.org/uniprot/KDSA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBCHAB_ECOLIhttp://www.uniprot.org/uniprot/CHAB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYPHE_ECOLIhttp://www.uniprot.org/uniprot/YPHE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYEEY_ECOLIhttp://www.uniprot.org/uniprot/YEEY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019288isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway; IMP:EcoCyc.
# GO_processGO:0051484isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway involved in terpenoid biosynthetic process; IBA:GO_Central.
GO_processGO:0019288http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019288
GO_processGO:0051484http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051484
UniProtKBDXR_ECOLIhttp://www.uniprot.org/uniprot/DXR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006457protein folding; IEA:UniProtKB-HAMAP.
# GO_processGO:0051604protein maturation; IEP:EcoliWiki.
GO_processGO:0006457http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006457
GO_processGO:0051604http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051604
UniProtKBTORD_ECOLIhttp://www.uniprot.org/uniprot/TORD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IGI:EcoliWiki.
# GO_processGO:0009060aerobic respiration; IGI:EcoliWiki.
# GO_processGO:0009061anaerobic respiration; IBA:GO_Central.
# GO_processGO:0022900electron transport chain; IEA:InterPro.
# GO_processGO:0055114oxidation-reduction process; IGI:EcoliWiki.
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
GO_processGO:0009060http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009060
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0022900http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022900
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBSDHA_ECOLIhttp://www.uniprot.org/uniprot/SDHA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006164purine nucleotide biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IDA:EcoliWiki.
# GO_processGO:0044208'de novo' AMP biosynthetic process; IBA:GO_Central.
# GO_processGO:0046040IMP metabolic process; IBA:GO_Central.
# GO_processGO:0046086adenosine biosynthetic process; IMP:EcoliWiki.
GO_processGO:0006164http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006164
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0015949http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015949
GO_processGO:0044208http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044208
GO_processGO:0046040http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046040
GO_processGO:0046086http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046086
UniProtKBPURA_ECOLIhttp://www.uniprot.org/uniprot/PURA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; TAS:EcoCyc.
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IBA:GO_Central.
# GO_processGO:0009245lipid A biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
GO_processGO:0009245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009245
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBEPTA_ECOLIhttp://www.uniprot.org/uniprot/EPTA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFEA_ECOLIhttp://www.uniprot.org/uniprot/YFEA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000272polysaccharide catabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006032chitin catabolic process; IEA:UniProtKB-KW.
GO_processGO:0000272http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000272
GO_processGO:0006032http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006032
UniProtKBCHIA_ECOLIhttp://www.uniprot.org/uniprot/CHIA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071286cellular response to magnesium ion; IEP:EcoCyc.
GO_processGO:0071286http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071286
UniProtKBBORD_ECOLIhttp://www.uniprot.org/uniprot/BORD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IBA:GO_Central.
# GO_processGO:0006104succinyl-CoA metabolic process; IBA:GO_Central.
# GO_processGO:0006105succinate metabolic process; IBA:GO_Central.
# GO_processGO:0009142nucleoside triphosphate biosynthetic process; IBA:GO_Central.
# GO_processGO:0046777protein autophosphorylation; IMP:EcoCyc.
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
GO_processGO:0006104http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006104
GO_processGO:0006105http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006105
GO_processGO:0009142http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009142
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
UniProtKBSUCD_ECOLIhttp://www.uniprot.org/uniprot/SUCD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008615pyridoxine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0042823pyridoxal phosphate biosynthetic process; IMP:EcoCyc.
GO_processGO:0008615http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008615
GO_processGO:0042823http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042823
UniProtKBPDXA_ECOLIhttp://www.uniprot.org/uniprot/PDXA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFFN_ECOLIhttp://www.uniprot.org/uniprot/YFFN_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEGJ_ECOLIhttp://www.uniprot.org/uniprot/YEGJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006308DNA catabolic process; IEA:UniProtKB-HAMAP.
GO_processGO:0006308http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006308
UniProtKBEX7L_ECOLIhttp://www.uniprot.org/uniprot/EX7L_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDHF_ECOLIhttp://www.uniprot.org/uniprot/YDHF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009443pyridoxal 5'-phosphate salvage; IMP:EcoliWiki.
# GO_processGO:0042817pyridoxal metabolic process; IMP:EcoliWiki.
# GO_processGO:0042819vitamin B6 biosynthetic process; IMP:EcoliWiki.
GO_processGO:0009443http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009443
GO_processGO:0042817http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042817
GO_processGO:0042819http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042819
UniProtKBPDXY_ECOLIhttp://www.uniprot.org/uniprot/PDXY_ECOLI
DataBaseIDURL or Descriptions
UniProtKBGFCC_ECOLIhttp://www.uniprot.org/uniprot/GFCC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009423chorismate biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
GO_processGO:0009073http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009073
GO_processGO:0009423http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009423
UniProtKBAROF_ECOLIhttp://www.uniprot.org/uniprot/AROF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0032506cytokinetic process; IMP:EcoCyc.
GO_processGO:0032506http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032506
UniProtKBDEDD_ECOLIhttp://www.uniprot.org/uniprot/DEDD_ECOLI
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITYdTDP-alpha-D-glucose = dTDP-4-dehydro-6-deoxy- alpha-D-glucose + H(2)O. {ECO:0000250|UniProtKBP27830}.
# COFACTORRMLB1_ECOLIName=NAD(+); Xref=ChEBI CHEBI 57540; Evidence={ECO 0000250|UniProtKB P27830}; Note=Binds 1 NAD(+) per subunit. {ECO 0000250|UniProtKB P27830};
# FUNCTIONRMLB1_ECOLICatalyzes the dehydration of dTDP-D-glucose to form dTDP-6-deoxy-D-xylo-4-hexulose via a three-step process involving oxidation, dehydration and reduction. {ECO 0000250|UniProtKB P27830}.
# GO_processGO:0009103lipopolysaccharide biosynthetic process; ISS:UniProtKB.
# GO_processGO:0009226nucleotide-sugar biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009243O antigen biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0019305dTDP-rhamnose biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0045226extracellular polysaccharide biosynthetic process; ISS:UniProtKB.
# RecNamedTDP-glucose 4,6-dehydratase 1 {ECO:0000250|UniProtKBP27830}
# SUBUNITHomodimer. {ECO:0000250|UniProtKBP27830}.
EC_numberEC:4.2.1.46 {ECO:0000250|UniProtKB:P27830}http://www.genome.jp/dbget-bin/www_bget?EC:4.2.1.46 {ECO:0000250|UniProtKB:P27830}
ENZYME4.2.1.46 {ECO:0000250|UniProtKB:P27830}http://enzyme.expasy.org/EC/4.2.1.46 {ECO:0000250|UniProtKB:P27830}
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
GO_processGO:0009226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009226
GO_processGO:0009243http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009243
GO_processGO:0019305http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019305
GO_processGO:0045226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045226
IntEnz4.2.1.46 {ECO:0000250|UniProtKB:P27830}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=4.2.1.46 {ECO:0000250|UniProtKB:P27830}
UniProtKBRMLB1_ECOLIhttp://www.uniprot.org/uniprot/RMLB1_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJFK_ECOLIhttp://www.uniprot.org/uniprot/YJFK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IBA:GO_Central.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRS14_ECOLIhttp://www.uniprot.org/uniprot/RS14_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAHG_ECOLIhttp://www.uniprot.org/uniprot/YAHG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006556S-adenosylmethionine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006730one-carbon metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0033353S-adenosylmethionine cycle; IMP:GO_Central.
GO_processGO:0006556http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006556
GO_processGO:0006730http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006730
GO_processGO:0033353http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033353
UniProtKBMETK_ECOLIhttp://www.uniprot.org/uniprot/METK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBHYFF_ECOLIhttp://www.uniprot.org/uniprot/HYFF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBCSGC_ECOLIhttp://www.uniprot.org/uniprot/CSGC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
UniProtKBYOAB_ECOLIhttp://www.uniprot.org/uniprot/YOAB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFEC_ECOLIhttp://www.uniprot.org/uniprot/YFEC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0031365N-terminal protein amino acid modification; IDA:EcoliWiki.
# GO_processGO:0043686co-translational protein modification; IPI:EcoCyc.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
GO_processGO:0031365http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031365
GO_processGO:0043686http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043686
UniProtKBDEF_ECOLIhttp://www.uniprot.org/uniprot/DEF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IMP:EcoCyc.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYEDA_ECOLIhttp://www.uniprot.org/uniprot/YEDA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008610lipid biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009102biotin biosynthetic process; IMP:UniProtKB.
# GO_processGO:0030497fatty acid elongation; IDA:UniProtKB.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
# GO_processGO:0051289protein homotetramerization; IDA:UniProtKB.
GO_processGO:0008610http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008610
GO_processGO:0009102http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009102
GO_processGO:0030497http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030497
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
UniProtKBFABI_ECOLIhttp://www.uniprot.org/uniprot/FABI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006824cobalt ion transport; IMP:EcoliWiki.
# GO_processGO:0006826iron ion transport; IMP:EcoliWiki.
# GO_processGO:0006828manganese ion transport; IMP:EcoCyc.
# GO_processGO:0015684ferrous iron transport; IMP:EcoliWiki.
# GO_processGO:0015691cadmium ion transport; IDA:EcoliWiki.
# GO_processGO:0030001metal ion transport; IMP:EcoliWiki.
GO_processGO:0006824http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006824
GO_processGO:0006826http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006826
GO_processGO:0006828http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006828
GO_processGO:0015684http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015684
GO_processGO:0015691http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015691
GO_processGO:0030001http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030001
UniProtKBMNTH_ECOLIhttp://www.uniprot.org/uniprot/MNTH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IDA:EcoCyc.
GO_processGO:0006782http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006782
UniProtKBHEM4_ECOLIhttp://www.uniprot.org/uniprot/HEM4_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
# GO_processGO:0097171ADP-L-glycero-beta-D-manno-heptose biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
GO_processGO:0097171http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0097171
UniProtKBGMHBB_ECOLIhttp://www.uniprot.org/uniprot/GMHBB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009605response to external stimulus; IEA:InterPro.
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009605http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009605
GO_processGO:0046336http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046336
UniProtKBEUTL_ECOLIhttp://www.uniprot.org/uniprot/EUTL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0030162regulation of proteolysis; IMP:EcoCyc.
# GO_processGO:0043066negative regulation of apoptotic process; IEA:InterPro.
GO_processGO:0030162http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030162
GO_processGO:0043066http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043066
UniProtKBYCCA_ECOLIhttp://www.uniprot.org/uniprot/YCCA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBFADL_ECOLIhttp://www.uniprot.org/uniprot/FADL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoCyc.
# GO_processGO:0009266response to temperature stimulus; IEP:EcoCyc.
GO_processGO:0006508http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006508
GO_processGO:0009266http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009266
UniProtKBHTPX_ECOLIhttp://www.uniprot.org/uniprot/HTPX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000162tryptophan biosynthetic process; IBA:GO_Central.
# GO_processGO:0006541glutamine metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046654tetrahydrofolate biosynthetic process; IMP:UniProtKB.
# GO_processGO:0046656folic acid biosynthetic process; IEA:UniProtKB-KW.
GO_processGO:0000162http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000162
GO_processGO:0006541http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006541
GO_processGO:0046654http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046654
GO_processGO:0046656http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046656
UniProtKBPABA_ECOLIhttp://www.uniprot.org/uniprot/PABA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IGI:EcoliWiki.
# GO_processGO:0046942carboxylic acid transport; IGI:EcoliWiki.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
GO_processGO:0046942http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046942
UniProtKBAAEA_ECOLIhttp://www.uniprot.org/uniprot/AAEA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDHL_ECOLIhttp://www.uniprot.org/uniprot/YDHL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006465signal peptide processing; IDA:EcoCyc.
# GO_processGO:0006508proteolysis; IDA:EcoliWiki.
# GO_processGO:0016485protein processing; IMP:EcoliWiki.
GO_processGO:0006465http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006465
GO_processGO:0006508http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006508
GO_processGO:0016485http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016485
UniProtKBLEP_ECOLIhttp://www.uniprot.org/uniprot/LEP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRL18_ECOLIhttp://www.uniprot.org/uniprot/RL18_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0015031protein transport; IEA:UniProtKB-HAMAP.
# GO_processGO:0043335protein unfolding; IDA:EcoCyc.
# GO_processGO:0051083'de novo' cotranslational protein folding; IDA:EcoCyc.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0061077chaperone-mediated protein folding; IDA:EcoCyc.
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0043335http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043335
GO_processGO:0051083http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051083
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0061077http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0061077
UniProtKBTIG_ECOLIhttp://www.uniprot.org/uniprot/TIG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006950response to stress; IEA:InterPro.
GO_processGO:0006950http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006950
UniProtKBYGEG_ECOLIhttp://www.uniprot.org/uniprot/YGEG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006399tRNA metabolic process; IMP:EcoliWiki.
# GO_processGO:0008033tRNA processing; IMP:EcoliWiki.
# GO_processGO:0009451RNA modification; IMP:EcoliWiki.
# GO_processGO:0031119tRNA pseudouridine synthesis; IMP:EcoCyc.
GO_processGO:0006399http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006399
GO_processGO:0008033http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008033
GO_processGO:0009451http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009451
GO_processGO:0031119http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031119
UniProtKBTRUC_ECOLIhttp://www.uniprot.org/uniprot/TRUC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0009423chorismate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0019632shikimate metabolic process; IDA:UniProtKB.
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
GO_processGO:0009073http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009073
GO_processGO:0009423http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009423
GO_processGO:0019632http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019632
UniProtKBAROE_ECOLIhttp://www.uniprot.org/uniprot/AROE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0036460cellular response to cell envelope stress; IMP:EcoCyc.
GO_processGO:0036460http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0036460
UniProtKBYQCG_ECOLIhttp://www.uniprot.org/uniprot/YQCG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007059chromosome segregation; IMP:EcoliWiki.
# GO_processGO:0015758glucose transport; IDA:EcoliWiki.
# GO_processGO:0015767lactose transport; IDA:EcoliWiki.
GO_processGO:0007059http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007059
GO_processGO:0015758http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015758
GO_processGO:0015767http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015767
UniProtKBSETB_ECOLIhttp://www.uniprot.org/uniprot/SETB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0090540bacterial cellulose biosynthetic process; IMP:EcoCyc.
GO_processGO:0090540http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0090540
UniProtKBYHJR_ECOLIhttp://www.uniprot.org/uniprot/YHJR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IDA:EcoCyc.
# GO_processGO:0019645anaerobic electron transport chain; IDA:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0019645http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019645
GO_processGO:0042128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042128
UniProtKBNARV_ECOLIhttp://www.uniprot.org/uniprot/NARV_ECOLI
DataBaseIDURL or Descriptions
UniProtKBLSRD_ECOLIhttp://www.uniprot.org/uniprot/LSRD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYICR_ECOLIhttp://www.uniprot.org/uniprot/YICR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBIBSB_ECOLIhttp://www.uniprot.org/uniprot/IBSB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006857oligopeptide transport; IDA:EcoliWiki.
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0035442dipeptide transmembrane transport; IDA:EcoCyc.
# GO_processGO:0035443tripeptide transmembrane transport; IMP:EcoCyc.
# GO_processGO:0042891antibiotic transport; IMP:EcoCyc.
# GO_processGO:1902600hydrogen ion transmembrane transport; IMP:EcoCyc.
GO_processGO:0006857http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006857
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0035442http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0035442
GO_processGO:0035443http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0035443
GO_processGO:0042891http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042891
GO_processGO:1902600http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902600
UniProtKBDTPA_ECOLIhttp://www.uniprot.org/uniprot/DTPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051301cell division; IDA:EcoCyc.
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
UniProtKBPAL_ECOLIhttp://www.uniprot.org/uniprot/PAL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0045947negative regulation of translational initiation; IMP:EcoCyc.
GO_processGO:0045947http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045947
UniProtKBRATA_ECOLIhttp://www.uniprot.org/uniprot/RATA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006221pyrimidine nucleotide biosynthetic process; IBA:GO_Central.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006207http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006207
GO_processGO:0006221http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006221
GO_processGO:0044205http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044205
UniProtKBPYRC_ECOLIhttp://www.uniprot.org/uniprot/PYRC_ECOLI
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- fructose(Side 1) = [protein]-L-histidine + D-fructose 1- phosphate(Side 2). {ECO:0000250|UniProtKBP20966}.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; ISA:EcoCyc.
EC_numberEC:2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://www.genome.jp/dbget-bin/www_bget?EC:2.7.1.202 {ECO:0000250|UniProtKB:P20966}
ENZYME2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://enzyme.expasy.org/EC/2.7.1.202 {ECO:0000250|UniProtKB:P20966}
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
IntEnz2.7.1.202 {ECO:0000250|UniProtKB:P20966}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=2.7.1.202 {ECO:0000250|UniProtKB:P20966}
UniProtKBPTFLB_ECOLIhttp://www.uniprot.org/uniprot/PTFLB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006001fructose catabolic process; IMP:EcoCyc.
GO_processGO:0006001http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006001
UniProtKBK1PF_ECOLIhttp://www.uniprot.org/uniprot/K1PF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006635fatty acid beta-oxidation; IMP:EcoCyc.
GO_processGO:0006635http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006635
UniProtKBFADA_ECOLIhttp://www.uniprot.org/uniprot/FADA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006096glycolytic process; IEA:UniProtKB-KW.
GO_processGO:0006096http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006096
UniProtKBODP1_ECOLIhttp://www.uniprot.org/uniprot/ODP1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IMP:EcoCyc.
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoCyc.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
GO_processGO:0015920http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015920
UniProtKBYHJD_ECOLIhttp://www.uniprot.org/uniprot/YHJD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0017148negative regulation of translation; IDA:EcoCyc.
# GO_processGO:0044238primary metabolic process; IEA:InterPro.
# GO_processGO:0045900negative regulation of translational elongation; IBA:GO_Central.
GO_processGO:0017148http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0017148
GO_processGO:0044238http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044238
GO_processGO:0045900http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045900
UniProtKBHPF_ECOLIhttp://www.uniprot.org/uniprot/HPF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBAAEX_ECOLIhttp://www.uniprot.org/uniprot/AAEX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006535cysteine biosynthetic process from serine; IDA:EcoCyc.
# GO_processGO:0008652cellular amino acid biosynthetic process; IDA:EcoliWiki.
# SUBUNITCYSK_ECOLIHomodimer (Ref.6). Forms a cysteine synthase complex with 1 copy of CysE (By similarity). Interacts with CdiA-CT from strain 536 / UPEC, this is blocked upon preincubation with O-acetyl-L- serine. CysK forms a complex with CdiA-CT/CdiI (PubMed 22333533). {ECO 0000250|UniProtKB P0A1E3, ECO 0000269|PubMed 22333533, ECO 0000269|Ref.6}.
GO_processGO:0006535http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006535
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
UniProtKBCYSK_ECOLIhttp://www.uniprot.org/uniprot/CYSK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
# GO_processGO:0019568arabinose catabolic process; IMP:EcoliWiki.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0019568http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019568
UniProtKBARAC_ECOLIhttp://www.uniprot.org/uniprot/ARAC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000270peptidoglycan metabolic process; IDA:EcoCyc.
# GO_processGO:0000920cell separation after cytokinesis; IGI:EcoliWiki.
# GO_processGO:0001896autolysis; IGI:EcoliWiki.
# GO_processGO:0045227capsule polysaccharide biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0000270http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000270
GO_processGO:0000920http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000920
GO_processGO:0001896http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0001896
GO_processGO:0045227http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045227
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBMEPM_ECOLIhttp://www.uniprot.org/uniprot/MEPM_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIIS_ECOLIhttp://www.uniprot.org/uniprot/YIIS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0006817phosphate ion transport; IEA:UniProtKB-KW.
# GO_processGO:0016036cellular response to phosphate starvation; IEP:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006817http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006817
GO_processGO:0016036http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016036
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
UniProtKBPHOR_ECOLIhttp://www.uniprot.org/uniprot/PHOR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0055114oxidation-reduction process; IBA:GO_Central.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBYDIQ_ECOLIhttp://www.uniprot.org/uniprot/YDIQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006979response to oxidative stress; IMP:EcoliWiki.
# GO_processGO:0009416response to light stimulus; IMP:EcoliWiki.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
GO_processGO:0006744http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006744
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
GO_processGO:0009416http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009416
GO_processGO:0044550http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044550
UniProtKBUBIH_ECOLIhttp://www.uniprot.org/uniprot/UBIH_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGHA_ECOLIhttp://www.uniprot.org/uniprot/YGHA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYPFG_ECOLIhttp://www.uniprot.org/uniprot/YPFG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYMFD_ECOLIhttp://www.uniprot.org/uniprot/YMFD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044780bacterial-type flagellum assembly; IEA:InterPro.
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
GO_processGO:0044780http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044780
GO_processGO:0071973http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071973
UniProtKBFLIS_ECOLIhttp://www.uniprot.org/uniprot/FLIS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
UniProtKBYFCA_ECOLIhttp://www.uniprot.org/uniprot/YFCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:00526533',5'-cyclic diguanylic acid metabolic process; IMP:EcoCyc.
GO_processGO:0052653http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0052653
UniProtKBYHJK_ECOLIhttp://www.uniprot.org/uniprot/YHJK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYJIE_ECOLIhttp://www.uniprot.org/uniprot/YJIE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDJG_ECOLIhttp://www.uniprot.org/uniprot/YDJG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJBM_ECOLIhttp://www.uniprot.org/uniprot/YJBM_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDGU_ECOLIhttp://www.uniprot.org/uniprot/YDGU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006950response to stress; IEA:InterPro.
# GO_processGO:0018117protein adenylylation; IDA:EcoliWiki.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoliWiki.
# GO_processGO:2000145regulation of cell motility; IMP:EcoCyc.
GO_processGO:0006950http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006950
GO_processGO:0018117http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018117
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
GO_processGO:2000145http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2000145
UniProtKBUSPG_ECOLIhttp://www.uniprot.org/uniprot/USPG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002128tRNA nucleoside ribose methylation; IMP:EcoCyc.
GO_processGO:0002128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002128
UniProtKBTRMJ_ECOLIhttp://www.uniprot.org/uniprot/TRMJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0030261chromosome condensation; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0030261http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030261
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBDBHA_ECOLIhttp://www.uniprot.org/uniprot/DBHA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIFK_ECOLIhttp://www.uniprot.org/uniprot/YIFK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBYFGI_ECOLIhttp://www.uniprot.org/uniprot/YFGI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000105histidine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0006541glutamine metabolic process; IEA:UniProtKB-HAMAP.
GO_processGO:0000105http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000105
GO_processGO:0006541http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006541
UniProtKBHIS5_ECOLIhttp://www.uniprot.org/uniprot/HIS5_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009052pentose-phosphate shunt, non-oxidative branch; IBA:GO_Central.
# GO_processGO:0019316D-allose catabolic process; IMP:EcoCyc.
# GO_processGO:0019323pentose catabolic process; IBA:GO_Central.
# GO_processGO:0044262cellular carbohydrate metabolic process; IDA:UniProtKB.
GO_processGO:0009052http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009052
GO_processGO:0019316http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019316
GO_processGO:0019323http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019323
GO_processGO:0044262http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044262
UniProtKBALSE_ECOLIhttp://www.uniprot.org/uniprot/ALSE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002136wobble base lysidine biosynthesis; IMP:EcoCyc.
# GO_processGO:0006400tRNA modification; IDA:EcoliWiki.
GO_processGO:0002136http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002136
GO_processGO:0006400http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006400
UniProtKBTILS_ECOLIhttp://www.uniprot.org/uniprot/TILS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042953lipoprotein transport; IDA:EcoCyc.
# GO_processGO:0044874lipoprotein localization to outer membrane; IDA:CACAO.
# GO_processGO:0072323chaperone-mediated protein transport across periplasmic space; IDA:CACAO.
GO_processGO:0042953http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042953
GO_processGO:0044874http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044874
GO_processGO:0072323http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0072323
UniProtKBLOLA_ECOLIhttp://www.uniprot.org/uniprot/LOLA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBGADE_ECOLIhttp://www.uniprot.org/uniprot/GADE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019324L-lyxose metabolic process; IMP:EcoCyc.
# GO_processGO:0019569L-arabinose catabolic process to xylulose 5-phosphate; IEP:EcoCyc.
GO_processGO:0019324http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019324
GO_processGO:0019569http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019569
UniProtKBARAD_ECOLIhttp://www.uniprot.org/uniprot/ARAD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHHH_ECOLIhttp://www.uniprot.org/uniprot/YHHH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046113nucleobase catabolic process; IEA:UniProtKB-HAMAP.
GO_processGO:0046113http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046113
UniProtKBPSUG_ECOLIhttp://www.uniprot.org/uniprot/PSUG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBIU_ECOLIhttp://www.uniprot.org/uniprot/YBIU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
UniProtKBYIDH_ECOLIhttp://www.uniprot.org/uniprot/YIDH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IEA:UniProtKB-HAMAP.
# GO_processGO:0007059chromosome segregation; IMP:EcoliWiki.
# GO_processGO:0007062sister chromatid cohesion; IMP:EcoliWiki.
# GO_processGO:0030261chromosome condensation; IDA:EcoCyc.
# GO_processGO:0051301cell division; IMP:EcoCyc.
GO_processGO:0006260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006260
GO_processGO:0007059http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007059
GO_processGO:0007062http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007062
GO_processGO:0030261http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030261
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
UniProtKBMUKB_ECOLIhttp://www.uniprot.org/uniprot/MUKB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006817phosphate ion transport; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006817http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006817
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBPSTA_ECOLIhttp://www.uniprot.org/uniprot/PSTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBNANR_ECOLIhttp://www.uniprot.org/uniprot/NANR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IDA:EcoCyc.
# GO_processGO:0055085transmembrane transport; IDA:EcoCyc.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYAJR_ECOLIhttp://www.uniprot.org/uniprot/YAJR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYBHD_ECOLIhttp://www.uniprot.org/uniprot/YBHD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000050urea cycle; IBA:GO_Central.
# GO_processGO:0006526arginine biosynthetic process; IBA:GO_Central.
# GO_processGO:0008652cellular amino acid biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0019856pyrimidine nucleobase biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0000050http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000050
GO_processGO:0006526http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006526
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
GO_processGO:0019856http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019856
GO_processGO:0044205http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044205
UniProtKBCARB_ECOLIhttp://www.uniprot.org/uniprot/CARB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUBA_ECOLIhttp://www.uniprot.org/uniprot/YUBA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044011single-species biofilm formation on inanimate substrate; IMP:EcoCyc.
# GO_processGO:0070301cellular response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0071468cellular response to acidic pH; IMP:EcoCyc.
GO_processGO:0044011http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044011
GO_processGO:0070301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070301
GO_processGO:0071468http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071468
UniProtKBYJAA_ECOLIhttp://www.uniprot.org/uniprot/YJAA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDDJ_ECOLIhttp://www.uniprot.org/uniprot/YDDJ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBALSC_ECOLIhttp://www.uniprot.org/uniprot/ALSC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IMP:EcoCyc.
GO_processGO:0006935http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006935
UniProtKBMCP4_ECOLIhttp://www.uniprot.org/uniprot/MCP4_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-KW.
GO_processGO:0006144http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006144
UniProtKBALLE_ECOLIhttp://www.uniprot.org/uniprot/ALLE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:00193803-phenylpropionate catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:00196223-(3-hydroxy)phenylpropionate catabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
# GO_processGO:0046271phenylpropanoid catabolic process; IMP:EcoCyc.
GO_processGO:0019380http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019380
GO_processGO:0019622http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019622
GO_processGO:0044550http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044550
GO_processGO:0046271http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046271
UniProtKBMHPA_ECOLIhttp://www.uniprot.org/uniprot/MHPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBYQJI_ECOLIhttp://www.uniprot.org/uniprot/YQJI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019294keto-3-deoxy-D-manno-octulosonic acid biosynthetic process; IDA:EcoCyc.
GO_processGO:0019294http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019294
UniProtKBKDSD_ECOLIhttp://www.uniprot.org/uniprot/KDSD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDBC_ECOLIhttp://www.uniprot.org/uniprot/YDBC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0030091protein repair; IMP:EcoCyc.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
GO_processGO:0030091http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030091
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
UniProtKBFRE_ECOLIhttp://www.uniprot.org/uniprot/FRE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046654tetrahydrofolate biosynthetic process; IMP:EcoCyc.
# GO_processGO:0046656folic acid biosynthetic process; IMP:EcoCyc.
GO_processGO:0046654http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046654
GO_processGO:0046656http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046656
UniProtKBNUDB_ECOLIhttp://www.uniprot.org/uniprot/NUDB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0045990carbon catabolite regulation of transcription; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
GO_processGO:0045990http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045990
UniProtKBLLDR_ECOLIhttp://www.uniprot.org/uniprot/LLDR_ECOLI
DataBaseIDURL or Descriptions
# CATALYTIC ACTIVITYAdenosylcobalamin 5'-phosphate + H(2)O = coenzyme B12 + phosphate. {ECO:0000250|UniProtKBP39701}.
# CATALYTIC ACTIVITYAlpha-ribazole 5'-phosphate + H(2)O = alpha- ribazole + phosphate. {ECO:0000250|UniProtKBP39701}.
# FUNCTIONCOBC_ECOLICatalyzes the conversion of adenosylcobalamin 5'- phosphate to adenosylcobalamin (vitamin B12); involved in the assembly of the nucleotide loop of cobalamin. Also catalyzes the hydrolysis of the phospho group from alpha-ribazole 5'-phosphate to form alpha-ribazole. {ECO 0000250|UniProtKB P39701}.
# GO_processGO:0009236cobalamin biosynthetic process; IEA:UniProtKB-KW.
EC_numberEC:3.1.3.73 {ECO:0000250|UniProtKB:P39701}http://www.genome.jp/dbget-bin/www_bget?EC:3.1.3.73 {ECO:0000250|UniProtKB:P39701}
ENZYME3.1.3.73 {ECO:0000250|UniProtKB:P39701}http://enzyme.expasy.org/EC/3.1.3.73 {ECO:0000250|UniProtKB:P39701}
GO_processGO:0009236http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009236
IntEnz3.1.3.73 {ECO:0000250|UniProtKB:P39701}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=3.1.3.73 {ECO:0000250|UniProtKB:P39701}
UniProtKBCOBC_ECOLIhttp://www.uniprot.org/uniprot/COBC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBYGIL_ECOLIhttp://www.uniprot.org/uniprot/YGIL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0042493response to drug; IMP:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0042493http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042493
UniProtKBFIMZ_ECOLIhttp://www.uniprot.org/uniprot/FIMZ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBCYSX_ECOLIhttp://www.uniprot.org/uniprot/CYSX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
# GO_processGO:0019299rhamnose metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0019299http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019299
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBRHAR_ECOLIhttp://www.uniprot.org/uniprot/RHAR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IBA:GO_Central.
GO_processGO:0000027http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000027
UniProtKBYFJP_ECOLIhttp://www.uniprot.org/uniprot/YFJP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGHX_ECOLIhttp://www.uniprot.org/uniprot/YGHX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0040033negative regulation of translation, ncRNA-mediated; IEP:EcoliWiki.
# GO_processGO:0045975positive regulation of translation, ncRNA-mediated; IMP:EcoCyc.
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0040033http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0040033
GO_processGO:0045975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045975
UniProtKBHFQ_ECOLIhttp://www.uniprot.org/uniprot/HFQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IBA:GO_Central.
GO_processGO:0009102http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009102
UniProtKBBIOD2_ECOLIhttp://www.uniprot.org/uniprot/BIOD2_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006612protein targeting to membrane; IMP:EcoliWiki.
# GO_processGO:0006614SRP-dependent cotranslational protein targeting to membrane; IEA:InterPro.
GO_processGO:0006612http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006612
GO_processGO:0006614http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006614
UniProtKBSRP54_ECOLIhttp://www.uniprot.org/uniprot/SRP54_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
# GO_processGO:0015871choline transport; IBA:GO_Central.
GO_processGO:0006865http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006865
GO_processGO:0015871http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015871
UniProtKBPROW_ECOLIhttp://www.uniprot.org/uniprot/PROW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008653lipopolysaccharide metabolic process; IPI:EcoCyc.
GO_processGO:0008653http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008653
UniProtKBLAPA_ECOLIhttp://www.uniprot.org/uniprot/LAPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
GO_processGO:0032196http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032196
UniProtKBINSO2_ECOLIhttp://www.uniprot.org/uniprot/INSO2_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
UniProtKBGFCE_ECOLIhttp://www.uniprot.org/uniprot/GFCE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1902201negative regulation of bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
GO_processGO:1902201http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902201
UniProtKBYEAI_ECOLIhttp://www.uniprot.org/uniprot/YEAI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIJF_ECOLIhttp://www.uniprot.org/uniprot/YIJF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIDF_ECOLIhttp://www.uniprot.org/uniprot/YIDF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBFB_ECOLIhttp://www.uniprot.org/uniprot/YBFB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0034599cellular response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0045454cell redox homeostasis; IEA:UniProtKB-HAMAP.
GO_processGO:0034599http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034599
GO_processGO:0045454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045454
UniProtKBTPX_ECOLIhttp://www.uniprot.org/uniprot/TPX_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCAM_ECOLIhttp://www.uniprot.org/uniprot/YCAM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0019629propionate catabolic process, 2-methylcitrate cycle; IEA:InterPro.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0019629http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019629
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBPRPR_ECOLIhttp://www.uniprot.org/uniprot/PRPR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0019584galactonate catabolic process; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0019584http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019584
UniProtKBLGOR_ECOLIhttp://www.uniprot.org/uniprot/LGOR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUAS_ECOLIhttp://www.uniprot.org/uniprot/YUAS_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBDR_ECOLIhttp://www.uniprot.org/uniprot/YBDR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006164purine nucleotide biosynthetic process; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-HAMAP.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEA:UniProtKB-HAMAP.
GO_processGO:0006164http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006164
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBPURR_ECOLIhttp://www.uniprot.org/uniprot/PURR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJET_ECOLIhttp://www.uniprot.org/uniprot/YJET_ECOLI
DataBaseIDURL or Descriptions
UniProtKBGTRB_ECOLIhttp://www.uniprot.org/uniprot/GTRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015823phenylalanine transport; IDA:EcoCyc.
# GO_processGO:0015827tryptophan transport; IDA:EcoCyc.
# GO_processGO:0015828tyrosine transport; IDA:EcoCyc.
GO_processGO:0015823http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015823
GO_processGO:0015827http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015827
GO_processGO:0015828http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015828
UniProtKBAROP_ECOLIhttp://www.uniprot.org/uniprot/AROP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYTFA_ECOLIhttp://www.uniprot.org/uniprot/YTFA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoliWiki.
# GO_processGO:0030163protein catabolic process; IBA:GO_Central.
GO_processGO:0006508http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006508
GO_processGO:0030163http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030163
UniProtKBFTSH_ECOLIhttp://www.uniprot.org/uniprot/FTSH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008654phospholipid biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0046342CDP-diacylglycerol catabolic process; IMP:EcoCyc.
GO_processGO:0008654http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008654
GO_processGO:0046342http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046342
UniProtKBCDH_ECOLIhttp://www.uniprot.org/uniprot/CDH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0030641regulation of cellular pH; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
GO_processGO:0006855http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006855
GO_processGO:0030641http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030641
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBMDFA_ECOLIhttp://www.uniprot.org/uniprot/MDFA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IMP:EcoCyc.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBFIMH_ECOLIhttp://www.uniprot.org/uniprot/FIMH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0035429gluconate transmembrane transport; IDA:EcoCyc.
# GO_processGO:0046177D-gluconate catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0035429http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0035429
GO_processGO:0046177http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046177
UniProtKBGNTP_ECOLIhttp://www.uniprot.org/uniprot/GNTP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEHE_ECOLIhttp://www.uniprot.org/uniprot/YEHE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006777Mo-molybdopterin cofactor biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0032324molybdopterin cofactor biosynthetic process; IBA:GO_Central.
GO_processGO:0006777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006777
GO_processGO:0032324http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032324
UniProtKBMOAC_ECOLIhttp://www.uniprot.org/uniprot/MOAC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009228thiamine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009229thiamine diphosphate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0016310phosphorylation; IDA:EcoCyc.
GO_processGO:0009228http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009228
GO_processGO:0009229http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009229
GO_processGO:0016310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016310
UniProtKBTHID_ECOLIhttp://www.uniprot.org/uniprot/THID_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBCORC_ECOLIhttp://www.uniprot.org/uniprot/CORC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006308DNA catabolic process; IBA:GO_Central.
GO_processGO:0006308http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006308
UniProtKBYJJV_ECOLIhttp://www.uniprot.org/uniprot/YJJV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBCADC_ECOLIhttp://www.uniprot.org/uniprot/CADC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBIGAA_ECOLIhttp://www.uniprot.org/uniprot/IGAA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0016310phosphorylation; IMP:EcoCyc.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
GO_processGO:0016310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016310
UniProtKBRFAY_ECOLIhttp://www.uniprot.org/uniprot/RFAY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYBHR_ECOLIhttp://www.uniprot.org/uniprot/YBHR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
# GO_processGO:0016226iron-sulfur cluster assembly; IMP:EcoCyc.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
UniProtKBSUFC_ECOLIhttp://www.uniprot.org/uniprot/SUFC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRL3_ECOLIhttp://www.uniprot.org/uniprot/RL3_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000724double-strand break repair via homologous recombination; IEA:UniProtKB-HAMAP.
# GO_processGO:0006302double-strand break repair; IDA:EcoCyc.
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0044355clearance of foreign intracellular DNA; IMP:UniProtKB.
GO_processGO:0000724http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000724
GO_processGO:0006302http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006302
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0044355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044355
UniProtKBRECB_ECOLIhttp://www.uniprot.org/uniprot/RECB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002098tRNA wobble uridine modification; IDA:EcoCyc.
# GO_processGO:0006805xenobiotic metabolic process; IMP:EcoCyc.
# GO_processGO:0009268response to pH; IMP:EcoCyc.
# GO_processGO:0030488tRNA methylation; IMP:EcoCyc.
# GO_processGO:0061077chaperone-mediated protein folding; IDA:EcoCyc.
GO_processGO:0002098http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002098
GO_processGO:0006805http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006805
GO_processGO:0009268http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009268
GO_processGO:0030488http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030488
GO_processGO:0061077http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0061077
UniProtKBMNME_ECOLIhttp://www.uniprot.org/uniprot/MNME_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019698D-galacturonate catabolic process; IMP:EcoCyc.
# GO_processGO:0042840D-glucuronate catabolic process; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0019698http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019698
GO_processGO:0042840http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042840
UniProtKBKDGK_ECOLIhttp://www.uniprot.org/uniprot/KDGK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDCA_ECOLIhttp://www.uniprot.org/uniprot/YDCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006011UDP-glucose metabolic process; IMP:EcoCyc.
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009242colanic acid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0033499galactose catabolic process via UDP-galactose; IMP:EcoCyc.
GO_processGO:0006011http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006011
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
GO_processGO:0009242http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009242
GO_processGO:0033499http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033499
UniProtKBGALU_ECOLIhttp://www.uniprot.org/uniprot/GALU_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDHY_ECOLIhttp://www.uniprot.org/uniprot/YDHY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000105histidine biosynthetic process; IEA:UniProtKB-HAMAP.
GO_processGO:0000105http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000105
UniProtKBHIS7_ECOLIhttp://www.uniprot.org/uniprot/HIS7_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0030643cellular phosphate ion homeostasis; IBA:GO_Central.
# GO_processGO:0035435phosphate ion transmembrane transport; IMP:EcoCyc.
GO_processGO:0030643http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030643
GO_processGO:0035435http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0035435
UniProtKBYJBB_ECOLIhttp://www.uniprot.org/uniprot/YJBB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBGLTK_ECOLIhttp://www.uniprot.org/uniprot/GLTK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002949tRNA threonylcarbamoyladenosine modification; IDA:EcoCyc.
GO_processGO:0002949http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002949
UniProtKBTSAE_ECOLIhttp://www.uniprot.org/uniprot/TSAE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBNRFD_ECOLIhttp://www.uniprot.org/uniprot/NRFD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0015889cobalamin transport; IMP:EcoliWiki.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0015889http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015889
UniProtKBBTUB_ECOLIhttp://www.uniprot.org/uniprot/BTUB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJFM_ECOLIhttp://www.uniprot.org/uniprot/YJFM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006144purine nucleobase metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006166purine ribonucleoside salvage; IEA:UniProtKB-KW.
GO_processGO:0006144http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006144
GO_processGO:0006166http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006166
UniProtKBYAGS_ECOLIhttp://www.uniprot.org/uniprot/YAGS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009246enterobacterial common antigen biosynthetic process; IMP:EcoCyc.
GO_processGO:0009246http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009246
UniProtKBWECB_ECOLIhttp://www.uniprot.org/uniprot/WECB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006096glycolytic process; IDA:EcoliWiki.
# GO_processGO:0006099tricarboxylic acid cycle; IDA:EcoliWiki.
# GO_processGO:0006108malate metabolic process; IDA:EcoliWiki.
# GO_processGO:0006113fermentation; IDA:EcoliWiki.
# GO_processGO:0009061anaerobic respiration; IDA:EcoliWiki.
GO_processGO:0006096http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006096
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
GO_processGO:0006108http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006108
GO_processGO:0006113http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006113
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
UniProtKBMDH_ECOLIhttp://www.uniprot.org/uniprot/MDH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046944protein carbamoylation; IDA:EcoCyc.
# GO_processGO:0051604protein maturation; IDA:EcoCyc.
GO_processGO:0046944http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046944
GO_processGO:0051604http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051604
UniProtKBHYPF_ECOLIhttp://www.uniprot.org/uniprot/HYPF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0071229cellular response to acid chemical; IEA:InterPro.
GO_processGO:0042542http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042542
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
GO_processGO:0071229http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071229
UniProtKBARIR_ECOLIhttp://www.uniprot.org/uniprot/ARIR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBMURI_ECOLIhttp://www.uniprot.org/uniprot/MURI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042968homoserine transport; IMP:EcoCyc.
GO_processGO:0042968http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042968
UniProtKBRHTB_ECOLIhttp://www.uniprot.org/uniprot/RHTB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IEA:UniProtKB-UniPathway.
# GO_processGO:0019629propionate catabolic process, 2-methylcitrate cycle; IEA:InterPro.
# GO_processGO:0019679propionate metabolic process, methylcitrate cycle; IDA:EcoliWiki.
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
GO_processGO:0019629http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019629
GO_processGO:0019679http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019679
UniProtKBPRPD_ECOLIhttp://www.uniprot.org/uniprot/PRPD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009636response to toxic substance; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0009636http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009636
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBEMRB_ECOLIhttp://www.uniprot.org/uniprot/EMRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYHJC_ECOLIhttp://www.uniprot.org/uniprot/YHJC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBMBHT_ECOLIhttp://www.uniprot.org/uniprot/MBHT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006805xenobiotic metabolic process; IMP:EcoCyc.
GO_processGO:0006805http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006805
UniProtKBCHRR_ECOLIhttp://www.uniprot.org/uniprot/CHRR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000162tryptophan biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; IMP:EcoliWiki.
GO_processGO:0000162http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000162
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
GO_processGO:0009073http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009073
UniProtKBTRPB_ECOLIhttp://www.uniprot.org/uniprot/TRPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSB1_ECOLIhttp://www.uniprot.org/uniprot/INSB1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015740C4-dicarboxylate transport; IGI:EcoliWiki.
GO_processGO:0015740http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015740
UniProtKBDCUC_ECOLIhttp://www.uniprot.org/uniprot/DCUC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IEA:UniProtKB-KW.
# GO_processGO:0015992proton transport; IEA:UniProtKB-KW.
# GO_processGO:0071973bacterial-type flagellum-dependent cell motility; IMP:EcoliWiki.
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
GO_processGO:0006935http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006935
GO_processGO:0015992http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015992
GO_processGO:0071973http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071973
GO_processGO:0071978http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071978
UniProtKBMOTA_ECOLIhttp://www.uniprot.org/uniprot/MOTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0018339peptidyl-L-beta-methylthioaspartic acid biosynthetic process from peptidyl-aspartic acid; IDA:EcoCyc.
# GO_processGO:0035600tRNA methylthiolation; IBA:GO_Central.
GO_processGO:0018339http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018339
GO_processGO:0035600http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0035600
UniProtKBRIMO_ECOLIhttp://www.uniprot.org/uniprot/RIMO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0051302regulation of cell division; IMP:EcoliWiki.
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0051302http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051302
UniProtKBDICB_ECOLIhttp://www.uniprot.org/uniprot/DICB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0032506cytokinetic process; IEA:InterPro.
GO_processGO:0032506http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032506
UniProtKBDAMX_ECOLIhttp://www.uniprot.org/uniprot/DAMX_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBHG_ECOLIhttp://www.uniprot.org/uniprot/YBHG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IEA:UniProtKB-KW.
# GO_processGO:0046325negative regulation of glucose import; IMP:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0046325http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046325
UniProtKBSGRT_ECOLIhttp://www.uniprot.org/uniprot/SGRT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
GO_processGO:0009060http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009060
UniProtKBNUOH_ECOLIhttp://www.uniprot.org/uniprot/NUOH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002098tRNA wobble uridine modification; IMP:EcoCyc.
# GO_processGO:0070329tRNA seleno-modification; IEA:InterPro.
GO_processGO:0002098http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002098
GO_processGO:0070329http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070329
UniProtKBSELU_ECOLIhttp://www.uniprot.org/uniprot/SELU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0046718viral entry into host cell; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0046718http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046718
UniProtKBINTD_ECOLIhttp://www.uniprot.org/uniprot/INTD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0010447response to acidic pH; IEA:InterPro.
# GO_processGO:1902476chloride transmembrane transport; IBA:GO_Central.
GO_processGO:0010447http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010447
GO_processGO:1902476http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902476
UniProtKBCLCB_ECOLIhttp://www.uniprot.org/uniprot/CLCB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHAL_ECOLIhttp://www.uniprot.org/uniprot/YHAL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IBA:GO_Central.
# GO_processGO:0006457protein folding; IBA:GO_Central.
# GO_processGO:0006662glycerol ether metabolic process; IEA:InterPro.
# GO_processGO:0034599cellular response to oxidative stress; IBA:GO_Central.
# GO_processGO:0045454cell redox homeostasis; IBA:GO_Central.
GO_processGO:0000103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000103
GO_processGO:0006457http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006457
GO_processGO:0006662http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006662
GO_processGO:0034599http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034599
GO_processGO:0045454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045454
UniProtKBTHIO2_ECOLIhttp://www.uniprot.org/uniprot/THIO2_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0071978http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071978
UniProtKBYCDY_ECOLIhttp://www.uniprot.org/uniprot/YCDY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0015751arabinose transport; IDA:EcoliWiki.
# GO_processGO:0015757galactose transport; IDA:EcoliWiki.
# GO_processGO:0046323glucose import; IDA:EcoliWiki.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0015751http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015751
GO_processGO:0015757http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015757
GO_processGO:0046323http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046323
UniProtKBOMPL_ECOLIhttp://www.uniprot.org/uniprot/OMPL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYEGW_ECOLIhttp://www.uniprot.org/uniprot/YEGW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006772thiamine metabolic process; EXP:EcoliWiki.
GO_processGO:0006772http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006772
UniProtKBYAJO_ECOLIhttp://www.uniprot.org/uniprot/YAJO_ECOLI
DataBaseIDURL or Descriptions
UniProtKBSTFR_ECOLIhttp://www.uniprot.org/uniprot/STFR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009073aromatic amino acid family biosynthetic process; TAS:EcoliWiki.
# GO_processGO:0009423chorismate biosynthetic process; IBA:GO_Central.
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
GO_processGO:0009073http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009073
GO_processGO:0009423http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009423
UniProtKBAROB_ECOLIhttp://www.uniprot.org/uniprot/AROB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:UniProtKB.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
UniProtKBPTHB_ECOLIhttp://www.uniprot.org/uniprot/PTHB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006655phosphatidylglycerol biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009395phospholipid catabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046474glycerophospholipid biosynthetic process; IMP:EcoCyc.
GO_processGO:0006655http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006655
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0009395http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009395
GO_processGO:0046474http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046474
UniProtKBPGPB_ECOLIhttp://www.uniprot.org/uniprot/PGPB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYABP_ECOLIhttp://www.uniprot.org/uniprot/YABP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046121deoxyribonucleoside catabolic process; IMP:EcoCyc.
GO_processGO:0046121http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046121
UniProtKBGNTX_ECOLIhttp://www.uniprot.org/uniprot/GNTX_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYNFB_ECOLIhttp://www.uniprot.org/uniprot/YNFB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0010045response to nickel cation; IMP:EcoCyc.
# GO_processGO:0032025response to cobalt ion; IMP:EcoCyc.
# GO_processGO:1901652response to peptide; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0010045http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010045
GO_processGO:0032025http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032025
GO_processGO:1901652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1901652
UniProtKBRCNB_ECOLIhttp://www.uniprot.org/uniprot/RCNB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1900190regulation of single-species biofilm formation; IMP:EcoCyc.
GO_processGO:1900190http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1900190
UniProtKBYCFJ_ECOLIhttp://www.uniprot.org/uniprot/YCFJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006855http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006855
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBMDTL_ECOLIhttp://www.uniprot.org/uniprot/MDTL_ECOLI
DataBaseIDURL or Descriptions
UniProtKBGSPL_ECOLIhttp://www.uniprot.org/uniprot/GSPL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009089lysine biosynthetic process via diaminopimelate; IEA:UniProtKB-HAMAP.
# GO_processGO:0019877diaminopimelate biosynthetic process; IEA:UniProtKB-HAMAP.
GO_processGO:0009089http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009089
GO_processGO:0019877http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019877
UniProtKBDAPE_ECOLIhttp://www.uniprot.org/uniprot/DAPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009246enterobacterial common antigen biosynthetic process; IMP:EcoCyc.
GO_processGO:0009246http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009246
UniProtKBWZYE_ECOLIhttp://www.uniprot.org/uniprot/WZYE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEAR_ECOLIhttp://www.uniprot.org/uniprot/YEAR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015846polyamine transport; IMP:EcoCyc.
GO_processGO:0015846http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015846
UniProtKBPOTD_ECOLIhttp://www.uniprot.org/uniprot/POTD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015820leucine transport; IMP:EcoCyc.
# GO_processGO:0015821methionine transport; IMP:EcoCyc.
# GO_processGO:0071230cellular response to amino acid stimulus; IEP:EcoCyc.
# GO_processGO:1903714isoleucine transmembrane transport; IMP:EcoCyc.
# GO_processGO:1903785L-valine transmembrane transport; IMP:EcoCyc.
GO_processGO:0015820http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015820
GO_processGO:0015821http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015821
GO_processGO:0071230http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071230
GO_processGO:1903714http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1903714
GO_processGO:1903785http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1903785
UniProtKBYJEH_ECOLIhttp://www.uniprot.org/uniprot/YJEH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
GO_processGO:0006865http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006865
UniProtKBYHDY_ECOLIhttp://www.uniprot.org/uniprot/YHDY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYPDB_ECOLIhttp://www.uniprot.org/uniprot/YPDB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBKDPE_ECOLIhttp://www.uniprot.org/uniprot/KDPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:UniProtKB-KW.
# GO_processGO:0006282regulation of DNA repair; IEA:UniProtKB-HAMAP.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoCyc.
# GO_processGO:0009432SOS response; IEP:EcoCyc.
# GO_processGO:0043086negative regulation of catalytic activity; IDA:EcoCyc.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
GO_processGO:0006282http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006282
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009432
GO_processGO:0043086http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043086
UniProtKBRECX_ECOLIhttp://www.uniprot.org/uniprot/RECX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0019521http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019521
UniProtKBIDNR_ECOLIhttp://www.uniprot.org/uniprot/IDNR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006490oligosaccharide-lipid intermediate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009250glucan biosynthetic process; IEA:UniProtKB-HAMAP.
GO_processGO:0006490http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006490
GO_processGO:0009250http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009250
UniProtKBOPGB_ECOLIhttp://www.uniprot.org/uniprot/OPGB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:UniProtKB.
GO_processGO:0010124http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010124
UniProtKBPAAD_ECOLIhttp://www.uniprot.org/uniprot/PAAD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSL1_ECOLIhttp://www.uniprot.org/uniprot/INSL1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000478endonucleolytic cleavage involved in rRNA processing; IMP:EcoCyc.
# GO_processGO:0006364rRNA processing; IMP:UniProtKB.
# GO_processGO:0006412translation; IMP:EcoCyc.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0030490maturation of SSU-rRNA; IMP:EcoCyc.
# GO_processGO:0031564transcription antitermination; IMP:EcoCyc.
# GO_processGO:0042254ribosome biogenesis; IMP:UniProtKB.
# GO_processGO:0042274ribosomal small subunit biogenesis; IMP:EcoCyc.
GO_processGO:0000478http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000478
GO_processGO:0006364http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006364
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0030490http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030490
GO_processGO:0031564http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031564
GO_processGO:0042254http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042254
GO_processGO:0042274http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042274
UniProtKBYBEY_ECOLIhttp://www.uniprot.org/uniprot/YBEY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006757ATP generation from ADP; IDA:EcoCyc.
# GO_processGO:0006799polyphosphate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
GO_processGO:0006757http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006757
GO_processGO:0006799http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006799
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
UniProtKBPPK_ECOLIhttp://www.uniprot.org/uniprot/PPK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINH14_ECOLIhttp://www.uniprot.org/uniprot/INH14_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCAK_ECOLIhttp://www.uniprot.org/uniprot/YCAK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
UniProtKBPHOE_ECOLIhttp://www.uniprot.org/uniprot/PHOE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009447putrescine catabolic process; IDA:EcoCyc.
GO_processGO:0009447http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009447
UniProtKBPAT_ECOLIhttp://www.uniprot.org/uniprot/PAT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006779porphyrin-containing compound biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009236cobalamin biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006779http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006779
GO_processGO:0009236http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009236
UniProtKBHEMX_ECOLIhttp://www.uniprot.org/uniprot/HEMX_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFDT_ECOLIhttp://www.uniprot.org/uniprot/YFDT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
UniProtKBVXIS_ECOLIhttp://www.uniprot.org/uniprot/VXIS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000032cell wall mannoprotein biosynthetic process; IBA:GO_Central.
# GO_processGO:0006486protein glycosylation; IBA:GO_Central.
# GO_processGO:0009242colanic acid biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009298GDP-mannose biosynthetic process; IMP:EcoCyc.
# GO_processGO:0019309mannose catabolic process; IMP:EcoCyc.
GO_processGO:0000032http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000032
GO_processGO:0006486http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006486
GO_processGO:0009242http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009242
GO_processGO:0009298http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009298
GO_processGO:0019309http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019309
UniProtKBMANA_ECOLIhttp://www.uniprot.org/uniprot/MANA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000453enzyme-directed rRNA 2'-O-methylation; IMP:EcoCyc.
GO_processGO:0000453http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000453
UniProtKBRLMM_ECOLIhttp://www.uniprot.org/uniprot/RLMM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0050896response to stimulus; IEA:UniProtKB-KW.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0050896http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0050896
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
UniProtKBFECR_ECOLIhttp://www.uniprot.org/uniprot/FECR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBFLAV_ECOLIhttp://www.uniprot.org/uniprot/FLAV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015758glucose transport; IMP:CACAO.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0015758http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015758
UniProtKBPTGCB_ECOLIhttp://www.uniprot.org/uniprot/PTGCB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYOAH_ECOLIhttp://www.uniprot.org/uniprot/YOAH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006265DNA topological change; IMP:EcoliWiki.
# GO_processGO:0006268DNA unwinding involved in DNA replication; IBA:GO_Central.
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoliWiki.
# GO_processGO:0007059chromosome segregation; IBA:GO_Central.
# GO_processGO:0042493response to drug; IDA:EcoliWiki.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006265http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006265
GO_processGO:0006268http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006268
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0007059http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007059
GO_processGO:0042493http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042493
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBGYRB_ECOLIhttp://www.uniprot.org/uniprot/GYRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008643carbohydrate transport; IEA:UniProtKB-KW.
# GO_processGO:0015712hexose phosphate transport; IMP:EcoCyc.
# GO_processGO:0015760glucose-6-phosphate transport; IDA:EcoCyc.
GO_processGO:0008643http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008643
GO_processGO:0015712http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015712
GO_processGO:0015760http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015760
UniProtKBUHPT_ECOLIhttp://www.uniprot.org/uniprot/UHPT_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQJF_ECOLIhttp://www.uniprot.org/uniprot/YQJF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:InterPro.
GO_processGO:0006814http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006814
UniProtKBUIDB_ECOLIhttp://www.uniprot.org/uniprot/UIDB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUAM_ECOLIhttp://www.uniprot.org/uniprot/YUAM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
GO_processGO:0070475http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070475
UniProtKBRLMA_ECOLIhttp://www.uniprot.org/uniprot/RLMA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0097264self proteolysis; IEA:InterPro.
GO_processGO:0097264http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0097264
UniProtKBRHSE_ECOLIhttp://www.uniprot.org/uniprot/RHSE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0018106peptidyl-histidine phosphorylation; IDA:EcoCyc.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0018106http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018106
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
UniProtKBRSTB_ECOLIhttp://www.uniprot.org/uniprot/RSTB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IMP:EcoCyc.
# GO_processGO:0010226response to lithium ion; IGI:EcoliWiki.
# GO_processGO:0015992proton transport; IMP:EcoCyc.
# GO_processGO:0051452intracellular pH reduction; IMP:EcoCyc.
# GO_processGO:0098656anion transmembrane transport; IBA:GO_Central.
GO_processGO:0006814http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006814
GO_processGO:0010226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010226
GO_processGO:0015992http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015992
GO_processGO:0051452http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051452
GO_processGO:0098656http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0098656
UniProtKBNHAB_ECOLIhttp://www.uniprot.org/uniprot/NHAB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:UniProtKB-HAMAP.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
UniProtKBNFI_ECOLIhttp://www.uniprot.org/uniprot/NFI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBGADX_ECOLIhttp://www.uniprot.org/uniprot/GADX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0046336http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046336
UniProtKBEUTD_ECOLIhttp://www.uniprot.org/uniprot/EUTD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDJA_ECOLIhttp://www.uniprot.org/uniprot/YDJA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYPJC_ECOLIhttp://www.uniprot.org/uniprot/YPJC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAIS_ECOLIhttp://www.uniprot.org/uniprot/YAIS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008152metabolic process; IEA:InterPro.
GO_processGO:0008152http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008152
UniProtKBYBIB_ECOLIhttp://www.uniprot.org/uniprot/YBIB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGEQ_ECOLIhttp://www.uniprot.org/uniprot/YGEQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0016114terpenoid biosynthetic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0019288isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway; IMP:EcoCyc.
# GO_processGO:0050992dimethylallyl diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0016114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016114
GO_processGO:0019288http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019288
GO_processGO:0050992http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0050992
UniProtKBISPH_ECOLIhttp://www.uniprot.org/uniprot/ISPH_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYECJ_ECOLIhttp://www.uniprot.org/uniprot/YECJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019285glycine betaine biosynthetic process from choline; IEA:UniProtKB-UniPathway.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0019285http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019285
UniProtKBBETT_ECOLIhttp://www.uniprot.org/uniprot/BETT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
# GO_processGO:0043711pilus organization; IMP:EcoCyc.
GO_processGO:0009297http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009297
GO_processGO:0043711http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043711
UniProtKBSFMD_ECOLIhttp://www.uniprot.org/uniprot/SFMD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFGD_ECOLIhttp://www.uniprot.org/uniprot/YFGD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0042126nitrate metabolic process; IMP:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0042126http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042126
GO_processGO:0042128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042128
UniProtKBNARG_ECOLIhttp://www.uniprot.org/uniprot/NARG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006820anion transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
GO_processGO:0006820http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006820
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYIHN_ECOLIhttp://www.uniprot.org/uniprot/YIHN_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBBJ_ECOLIhttp://www.uniprot.org/uniprot/YBBJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
UniProtKBTABA_ECOLIhttp://www.uniprot.org/uniprot/TABA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0031167rRNA methylation; IDA:UniProtKB.
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
GO_processGO:0031167http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031167
GO_processGO:0070475http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070475
UniProtKBRLMKL_ECOLIhttp://www.uniprot.org/uniprot/RLMKL_ECOLI
DataBaseIDURL or Descriptions
UniProtKBTYRP_ECOLIhttp://www.uniprot.org/uniprot/TYRP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0060567negative regulation of DNA-templated transcription, termination; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0060567http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0060567
UniProtKBCSPE_ECOLIhttp://www.uniprot.org/uniprot/CSPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0034194D-galactonate catabolic process; IMP:EcoCyc.
GO_processGO:0034194http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034194
UniProtKBDGOA_ECOLIhttp://www.uniprot.org/uniprot/DGOA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAIO_ECOLIhttp://www.uniprot.org/uniprot/YAIO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0044781bacterial-type flagellum organization; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:1902208regulation of bacterial-type flagellum assembly; IEA:UniProtKB-HAMAP.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0044781http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044781
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
GO_processGO:1902208http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902208
UniProtKBFLHC_ECOLIhttp://www.uniprot.org/uniprot/FLHC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBRAVA_ECOLIhttp://www.uniprot.org/uniprot/RAVA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
GO_processGO:0071978http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071978
UniProtKBFLGC_ECOLIhttp://www.uniprot.org/uniprot/FLGC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006567threonine catabolic process; IBA:GO_Central.
GO_processGO:0006006http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006006
GO_processGO:0006567http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006567
UniProtKBPFLB_ECOLIhttp://www.uniprot.org/uniprot/PFLB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IBA:GO_Central.
# GO_processGO:0006457protein folding; IBA:GO_Central.
# GO_processGO:0006662glycerol ether metabolic process; IEA:InterPro.
# GO_processGO:0016032viral process; IEA:UniProtKB-KW.
# GO_processGO:0034599cellular response to oxidative stress; IBA:GO_Central.
# GO_processGO:0045454cell redox homeostasis; IMP:EcoCyc.
GO_processGO:0000103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000103
GO_processGO:0006457http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006457
GO_processGO:0006662http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006662
GO_processGO:0016032http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016032
GO_processGO:0034599http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034599
GO_processGO:0045454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045454
UniProtKBTHIO_ECOLIhttp://www.uniprot.org/uniprot/THIO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009097isoleucine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009099valine biosynthetic process; IDA:EcoCyc.
GO_processGO:0009097http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009097
GO_processGO:0009099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009099
UniProtKBILVB_ECOLIhttp://www.uniprot.org/uniprot/ILVB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBSOXS_ECOLIhttp://www.uniprot.org/uniprot/SOXS_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJFI_ECOLIhttp://www.uniprot.org/uniprot/YJFI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006014D-ribose metabolic process; IMP:EcoCyc.
# GO_processGO:0009052pentose-phosphate shunt, non-oxidative branch; IEA:UniProtKB-HAMAP.
GO_processGO:0006014http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006014
GO_processGO:0009052http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009052
UniProtKBRPIA_ECOLIhttp://www.uniprot.org/uniprot/RPIA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0015774polysaccharide transport; IEA:UniProtKB-KW.
# GO_processGO:0052778diacetylchitobiose metabolic process; IEP:EcoCyc.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0015774http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015774
GO_processGO:0052778http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0052778
UniProtKBCHIP_ECOLIhttp://www.uniprot.org/uniprot/CHIP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006979response to oxidative stress; IEA:UniProtKB-HAMAP.
# GO_processGO:0030091protein repair; IDA:EcoCyc.
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
GO_processGO:0030091http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030091
UniProtKBMSRB_ECOLIhttp://www.uniprot.org/uniprot/MSRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019430removal of superoxide radicals; IEA:InterPro.
GO_processGO:0019430http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019430
UniProtKBTRXB_ECOLIhttp://www.uniprot.org/uniprot/TRXB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0015944formate oxidation; IDA:EcoCyc.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0015944http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015944
UniProtKBFDNH_ECOLIhttp://www.uniprot.org/uniprot/FDNH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015891siderophore transport; IMP:EcoliWiki.
# GO_processGO:0042884microcin transport; IMP:EcoliWiki.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
GO_processGO:0015891http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015891
GO_processGO:0042884http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042884
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
UniProtKBFIU_ECOLIhttp://www.uniprot.org/uniprot/FIU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0012501programmed cell death; IMP:EcoCyc.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0012501http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0012501
UniProtKBCBTA_ECOLIhttp://www.uniprot.org/uniprot/CBTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0009409response to cold; IMP:EcoCyc.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0009409http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009409
UniProtKBTYPA_ECOLIhttp://www.uniprot.org/uniprot/TYPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044283small molecule biosynthetic process; IBA:GO_Central.
GO_processGO:0044283http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044283
UniProtKBYIDA_ECOLIhttp://www.uniprot.org/uniprot/YIDA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0009432SOS response; IEA:UniProtKB-HAMAP.
# GO_processGO:0032466negative regulation of cytokinesis; IMP:CACAO.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0051782negative regulation of cell division; IMP:EcoliWiki.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0009432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009432
GO_processGO:0032466http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032466
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0051782http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051782
UniProtKBSULA_ECOLIhttp://www.uniprot.org/uniprot/SULA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
# GO_processGO:0015990electron transport coupled proton transport; IMP:EcoCyc.
# GO_processGO:0042773ATP synthesis coupled electron transport; IEA:InterPro.
GO_processGO:0009060http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009060
GO_processGO:0015990http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015990
GO_processGO:0042773http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042773
UniProtKBNUON_ECOLIhttp://www.uniprot.org/uniprot/NUON_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015757galactose transport; IDA:EcoCyc.
GO_processGO:0015757http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015757
UniProtKBGALP_ECOLIhttp://www.uniprot.org/uniprot/GALP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIIR_ECOLIhttp://www.uniprot.org/uniprot/YIIR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0031167rRNA methylation; IDA:UniProtKB.
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
GO_processGO:0031167http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031167
GO_processGO:0070475http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070475
UniProtKBRSMC_ECOLIhttp://www.uniprot.org/uniprot/RSMC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IBA:GO_Central.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYCJP_ECOLIhttp://www.uniprot.org/uniprot/YCJP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
GO_processGO:0006865http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006865
UniProtKBGLTI_ECOLIhttp://www.uniprot.org/uniprot/GLTI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQIC_ECOLIhttp://www.uniprot.org/uniprot/YQIC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBARPB_ECOLIhttp://www.uniprot.org/uniprot/ARPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYDHP_ECOLIhttp://www.uniprot.org/uniprot/YDHP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0017038protein import; IMP:EcoliWiki.
# GO_processGO:0043213bacteriocin transport; IMP:EcoCyc.
GO_processGO:0017038http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0017038
GO_processGO:0043213http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043213
UniProtKBTOLQ_ECOLIhttp://www.uniprot.org/uniprot/TOLQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0090540bacterial cellulose biosynthetic process; IMP:EcoCyc.
GO_processGO:0090540http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0090540
UniProtKBBCSQ_ECOLIhttp://www.uniprot.org/uniprot/BCSQ_ECOLI
DataBaseIDURL or Descriptions
# AltNameEIICB-Mtl {ECO:0000250|UniProtKBP28008}
# AltNamePTS system mannitol-specific EIIB component {ECO:0000250|UniProtKBP28008}
# AltNamePTS system mannitol-specific EIIC component {ECO:0000250|UniProtKBP28008}
# AltNamePTS system mannitol-specific EIIC component {ECO:0000250|UniProtKBP28008}
# CATALYTIC ACTIVITY[Protein]-N(pi)-phospho-L-histidine + D- mannitol(Side 1) = [protein]-L-histidine + D-mannitol 1- phosphate(Side 2). {ECO:0000250|UniProtKBP00550}.
# FUNCTIONPTMCB_ECOLIThe phosphoenolpyruvate-dependent sugar phosphotransferase system (sugar PTS), a major carbohydrate active transport system, catalyzes the phosphorylation of incoming sugar substrates concomitantly with their translocation across the cell membrane. The enzyme II CmtAB PTS system is involved in D-mannitol transport. {ECO 0000250|UniProtKB P28008}.
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; ISA:EcoCyc.
# RecNameMannitol permease IIC component {ECO:0000250|UniProtKBP28008}
# RecNameMannitol-specific phosphotransferase enzyme IIB component {ECO:0000250|UniProtKBP28008}
EC_numberEC:2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}http://www.genome.jp/dbget-bin/www_bget?EC:2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}
ENZYME2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}http://enzyme.expasy.org/EC/2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
IntEnz2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=2.7.1.197 {ECO:0000250|UniProtKB:P00550, ECO:0000250|UniProtKB:P28008}
UniProtKBPTMCB_ECOLIhttp://www.uniprot.org/uniprot/PTMCB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBFRMR_ECOLIhttp://www.uniprot.org/uniprot/FRMR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYNJI_ECOLIhttp://www.uniprot.org/uniprot/YNJI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015986ATP synthesis coupled proton transport; IEA:UniProtKB-HAMAP.
GO_processGO:0015986http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015986
UniProtKBATPF_ECOLIhttp://www.uniprot.org/uniprot/ATPF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAHL_ECOLIhttp://www.uniprot.org/uniprot/YAHL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IBA:GO_Central.
GO_processGO:0000027http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000027
UniProtKBYKFA_ECOLIhttp://www.uniprot.org/uniprot/YKFA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
# GO_processGO:0006401RNA catabolic process; IGI:EcoCyc.
# GO_processGO:0010501RNA secondary structure unwinding; IBA:GO_Central.
# GO_processGO:0045727positive regulation of translation; IMP:EcoCyc.
# GO_processGO:0048255mRNA stabilization; IMP:CACAO.
# GO_processGO:0070417cellular response to cold; IMP:EcoCyc.
GO_processGO:0000027http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000027
GO_processGO:0006401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006401
GO_processGO:0010501http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010501
GO_processGO:0045727http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045727
GO_processGO:0048255http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0048255
GO_processGO:0070417http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070417
UniProtKBDEAD_ECOLIhttp://www.uniprot.org/uniprot/DEAD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAAX_ECOLIhttp://www.uniprot.org/uniprot/YAAX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0018307enzyme active site formation; IDA:EcoCyc.
GO_processGO:0006006http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006006
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0018307http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018307
UniProtKBPFLA_ECOLIhttp://www.uniprot.org/uniprot/PFLA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005992trehalose biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006970response to osmotic stress; IEP:EcoCyc.
# GO_processGO:0070415trehalose metabolism in response to cold stress; IMP:EcoCyc.
GO_processGO:0005992http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005992
GO_processGO:0006970http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006970
GO_processGO:0070415http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070415
UniProtKBOTSB_ECOLIhttp://www.uniprot.org/uniprot/OTSB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000738DNA catabolic process, exonucleolytic; IDA:EcoCyc.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0090501RNA phosphodiester bond hydrolysis; IDA:EcoCyc.
GO_processGO:0000738http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000738
GO_processGO:0042542http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042542
GO_processGO:0090501http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0090501
UniProtKBTATD_ECOLIhttp://www.uniprot.org/uniprot/TATD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJBT_ECOLIhttp://www.uniprot.org/uniprot/YJBT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008643carbohydrate transport; IDA:EcoCyc.
# GO_processGO:0015726L-idonate transport; IDA:EcoCyc.
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0046183L-idonate catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0008643http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008643
GO_processGO:0015726http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015726
GO_processGO:0019521http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019521
GO_processGO:0046183http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046183
UniProtKBIDNT_ECOLIhttp://www.uniprot.org/uniprot/IDNT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015698inorganic anion transport; IMP:EcoCyc.
# GO_processGO:1903424fluoride transmembrane transport; IBA:GO_Central.
GO_processGO:0015698http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015698
GO_processGO:1903424http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1903424
UniProtKBCRCB_ECOLIhttp://www.uniprot.org/uniprot/CRCB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IGI:EcoCyc.
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
UniProtKBYMGF_ECOLIhttp://www.uniprot.org/uniprot/YMGF_ECOLI
DataBaseIDURL or Descriptions
# AltNamePutative D-hexose-6-phosphate mutarotase {ECO:0000250|UniProtKBQ03161}
# CATALYTIC ACTIVITYAlpha-D-glucose 6-phosphate = beta-D-glucose 6-phosphate. {ECO:0000250|UniProtKBQ03161}.
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# RecNamePutative glucose-6-phosphate 1-epimerase {ECO:0000250|UniProtKBQ03161}
EC_numberEC:5.1.3.15 {ECO:0000250|UniProtKB:Q03161}http://www.genome.jp/dbget-bin/www_bget?EC:5.1.3.15 {ECO:0000250|UniProtKB:Q03161}
ENZYME5.1.3.15 {ECO:0000250|UniProtKB:Q03161}http://enzyme.expasy.org/EC/5.1.3.15 {ECO:0000250|UniProtKB:Q03161}
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
IntEnz5.1.3.15 {ECO:0000250|UniProtKB:Q03161}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=5.1.3.15 {ECO:0000250|UniProtKB:Q03161}
UniProtKBYEAD_ECOLIhttp://www.uniprot.org/uniprot/YEAD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009636response to toxic substance; IMP:EcoCyc.
GO_processGO:0009636http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009636
UniProtKBYIIM_ECOLIhttp://www.uniprot.org/uniprot/YIIM_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDAW_ECOLIhttp://www.uniprot.org/uniprot/YDAW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015820leucine transport; IMP:EcoCyc.
GO_processGO:0015820http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015820
UniProtKBLIVK_ECOLIhttp://www.uniprot.org/uniprot/LIVK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGFB_ECOLIhttp://www.uniprot.org/uniprot/YGFB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IEA:UniProtKB-KW.
# GO_processGO:0031460glycine betaine transport; IDA:EcoCyc.
GO_processGO:0006865http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006865
GO_processGO:0031460http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031460
UniProtKBYEHW_ECOLIhttp://www.uniprot.org/uniprot/YEHW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000012single strand break repair; IMP:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009432SOS response; IEA:UniProtKB-KW.
GO_processGO:0000012http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000012
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009432
UniProtKBUMUC_ECOLIhttp://www.uniprot.org/uniprot/UMUC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAGK_ECOLIhttp://www.uniprot.org/uniprot/YAGK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFGG_ECOLIhttp://www.uniprot.org/uniprot/YFGG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0045819positive regulation of glycogen catabolic process; IDA:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0045819http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045819
UniProtKBPTHP_ECOLIhttp://www.uniprot.org/uniprot/PTHP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRS20_ECOLIhttp://www.uniprot.org/uniprot/RS20_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYMGG_ECOLIhttp://www.uniprot.org/uniprot/YMGG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015949nucleobase-containing small molecule interconversion; IMP:EcoliWiki.
GO_processGO:0015949http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015949
UniProtKBAPAH_ECOLIhttp://www.uniprot.org/uniprot/APAH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0006352DNA-templated transcription, initiation; IMP:EcoliWiki.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoliWiki.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006352http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006352
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBAAER_ECOLIhttp://www.uniprot.org/uniprot/AAER_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0015689molybdate ion transport; IEA:InterPro.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0015689http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015689
UniProtKBMODE_ECOLIhttp://www.uniprot.org/uniprot/MODE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0019563glycerol catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0046168glycerol-3-phosphate catabolic process; IDA:EcoCyc.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0019563http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019563
GO_processGO:0046168http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046168
UniProtKBGLPA_ECOLIhttp://www.uniprot.org/uniprot/GLPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
# GO_processGO:0043711pilus organization; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009297http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009297
GO_processGO:0043711http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043711
UniProtKBYRAJ_ECOLIhttp://www.uniprot.org/uniprot/YRAJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IEA:InterPro.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
UniProtKBYBAV_ECOLIhttp://www.uniprot.org/uniprot/YBAV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006396RNA processing; IEA:InterPro.
# GO_processGO:0006402mRNA catabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
GO_processGO:0006396http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006396
GO_processGO:0006402http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006402
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
UniProtKBPNP_ECOLIhttp://www.uniprot.org/uniprot/PNP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002098tRNA wobble uridine modification; IMP:EcoCyc.
# GO_processGO:0032259methylation; IBA:GO_Central.
GO_processGO:0002098http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002098
GO_processGO:0032259http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032259
UniProtKBCMOA_ECOLIhttp://www.uniprot.org/uniprot/CMOA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYUAB_ECOLIhttp://www.uniprot.org/uniprot/YUAB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJIK_ECOLIhttp://www.uniprot.org/uniprot/YJIK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSE7_ECOLIhttp://www.uniprot.org/uniprot/INSE7_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1902765L-arginine import into cell; ISO:EcoCyc.
GO_processGO:1902765http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902765
UniProtKBARTQ_ECOLIhttp://www.uniprot.org/uniprot/ARTQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006464cellular protein modification process; IDA:EcoCyc.
GO_processGO:0006464http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006464
UniProtKBNRDI_ECOLIhttp://www.uniprot.org/uniprot/NRDI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGJV_ECOLIhttp://www.uniprot.org/uniprot/YGJV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IBA:GO_Central.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYADH_ECOLIhttp://www.uniprot.org/uniprot/YADH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBUIDR_ECOLIhttp://www.uniprot.org/uniprot/UIDR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYIEP_ECOLIhttp://www.uniprot.org/uniprot/YIEP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015757galactose transport; IDA:EcoCyc.
GO_processGO:0015757http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015757
UniProtKBYTFR_ECOLIhttp://www.uniprot.org/uniprot/YTFR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYSAB_ECOLIhttp://www.uniprot.org/uniprot/YSAB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSN1_ECOLIhttp://www.uniprot.org/uniprot/INSN1_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDIE_ECOLIhttp://www.uniprot.org/uniprot/YDIE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006935chemotaxis; IEA:UniProtKB-KW.
# GO_processGO:0050920regulation of chemotaxis; IEA:InterPro.
# GO_processGO:0071977bacterial-type flagellum-dependent swimming motility; IMP:EcoCyc.
GO_processGO:0006935http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006935
GO_processGO:0050920http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0050920
GO_processGO:0071977http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071977
UniProtKBCHEZ_ECOLIhttp://www.uniprot.org/uniprot/CHEZ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009236cobalamin biosynthetic process; IMP:EcoliWiki.
GO_processGO:0009236http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009236
UniProtKBCOBS_ECOLIhttp://www.uniprot.org/uniprot/COBS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBYEJO_ECOLIhttp://www.uniprot.org/uniprot/YEJO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009231riboflavin biosynthetic process; IDA:EcoCyc.
# GO_processGO:0022611dormancy process; IMP:EcoCyc.
GO_processGO:0009231http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009231
GO_processGO:0022611http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022611
UniProtKBYIGB_ECOLIhttp://www.uniprot.org/uniprot/YIGB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGJI_ECOLIhttp://www.uniprot.org/uniprot/YGJI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFED_ECOLIhttp://www.uniprot.org/uniprot/YFED_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHDP_ECOLIhttp://www.uniprot.org/uniprot/YHDP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBLRHA_ECOLIhttp://www.uniprot.org/uniprot/LRHA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009086methionine biosynthetic process; IBA:GO_Central.
# GO_processGO:0009088threonine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0009092homoserine metabolic process; IBA:GO_Central.
GO_processGO:0009086http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009086
GO_processGO:0009088http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009088
GO_processGO:0009092http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009092
UniProtKBKHSE_ECOLIhttp://www.uniprot.org/uniprot/KHSE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
# GO_processGO:0010501RNA secondary structure unwinding; IBA:GO_Central.
GO_processGO:0000027http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000027
GO_processGO:0010501http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010501
UniProtKBSRMB_ECOLIhttp://www.uniprot.org/uniprot/SRMB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0018378cytochrome c-heme linkage via heme-L-cysteine; IMP:EcoCyc.
GO_processGO:0018378http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018378
UniProtKBNRFF_ECOLIhttp://www.uniprot.org/uniprot/NRFF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0001407glycerophosphodiester transport; IDA:EcoCyc.
# GO_processGO:0015794glycerol-3-phosphate transport; IMP:EcoCyc.
GO_processGO:0001407http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0001407
GO_processGO:0015794http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015794
UniProtKBUGPA_ECOLIhttp://www.uniprot.org/uniprot/UGPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009436glyoxylate catabolic process; IMP:EcoCyc.
# GO_processGO:0009442allantoin assimilation pathway; IEP:EcoCyc.
# GO_processGO:0046296glycolate catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009436http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009436
GO_processGO:0009442http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009442
GO_processGO:0046296http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046296
UniProtKBGLXR_ECOLIhttp://www.uniprot.org/uniprot/GLXR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0031564transcription antitermination; IEA:UniProtKB-KW.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0060567negative regulation of DNA-templated transcription, termination; IEA:InterPro.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0031564http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031564
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
GO_processGO:0060567http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0060567
UniProtKBREQ1_ECOLIhttp://www.uniprot.org/uniprot/REQ1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051205protein insertion into membrane; IMP:EcoCyc.
GO_processGO:0051205http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051205
UniProtKBYIDD_ECOLIhttp://www.uniprot.org/uniprot/YIDD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBTORR_ECOLIhttp://www.uniprot.org/uniprot/TORR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071555cell wall organization; IEA:InterPro.
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBYHCA_ECOLIhttp://www.uniprot.org/uniprot/YHCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006633fatty acid biosynthetic process; IGI:EcoliWiki.
# GO_processGO:0018070peptidyl-serine phosphopantetheinylation; NAS:EcoliWiki.
# GO_processGO:0019878lysine biosynthetic process via aminoadipic acid; IBA:GO_Central.
GO_processGO:0006633http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006633
GO_processGO:0018070http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018070
GO_processGO:0019878http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019878
UniProtKBACPT_ECOLIhttp://www.uniprot.org/uniprot/ACPT_ECOLI
DataBaseIDURL or Descriptions
UniProtKBRACC_ECOLIhttp://www.uniprot.org/uniprot/RACC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006203dGTP catabolic process; IBA:GO_Central.
# GO_processGO:0009267cellular response to starvation; IMP:EcoCyc.
# GO_processGO:0046047TTP catabolic process; IBA:GO_Central.
# GO_processGO:0046052UTP catabolic process; IBA:GO_Central.
# GO_processGO:0046061dATP catabolic process; IBA:GO_Central.
# GO_processGO:0046076dTTP catabolic process; IBA:GO_Central.
# GO_processGO:0046081dUTP catabolic process; IBA:GO_Central.
GO_processGO:0006203http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006203
GO_processGO:0009267http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009267
GO_processGO:0046047http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046047
GO_processGO:0046052http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046052
GO_processGO:0046061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046061
GO_processGO:0046076http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046076
GO_processGO:0046081http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046081
UniProtKBMAZG_ECOLIhttp://www.uniprot.org/uniprot/MAZG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006108malate metabolic process; IEA:InterPro.
GO_processGO:0006108http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006108
UniProtKBMAO2_ECOLIhttp://www.uniprot.org/uniprot/MAO2_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBGATR_ECOLIhttp://www.uniprot.org/uniprot/GATR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBCUEO_ECOLIhttp://www.uniprot.org/uniprot/CUEO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0043471regulation of cellular carbohydrate catabolic process; IGI:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0043471http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043471
UniProtKBDCTR_ECOLIhttp://www.uniprot.org/uniprot/DCTR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0070301cellular response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0071454cellular response to anoxia; IMP:EcoCyc.
# GO_processGO:1900190regulation of single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0070301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070301
GO_processGO:0071454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071454
GO_processGO:1900190http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1900190
UniProtKBYFGF_ECOLIhttp://www.uniprot.org/uniprot/YFGF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006813potassium ion transport; IGI:EcoliWiki.
GO_processGO:0006813http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006813
UniProtKBKEFB_ECOLIhttp://www.uniprot.org/uniprot/KEFB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000455enzyme-directed rRNA pseudouridine synthesis; IBA:GO_Central.
# GO_processGO:0009408response to heat; IEP:EcoliWiki.
# GO_processGO:0034605cellular response to heat; IEP:EcoCyc.
GO_processGO:0000455http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000455
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0034605http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034605
UniProtKBHSLR_ECOLIhttp://www.uniprot.org/uniprot/HSLR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042354L-fucose metabolic process; IEA:UniProtKB-HAMAP.
GO_processGO:0042354http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042354
UniProtKBFUCM_ECOLIhttp://www.uniprot.org/uniprot/FUCM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006865amino acid transport; IBA:GO_Central.
GO_processGO:0006865http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006865
UniProtKBRHTC_ECOLIhttp://www.uniprot.org/uniprot/RHTC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006259DNA metabolic process; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006259http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006259
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBRCBA_ECOLIhttp://www.uniprot.org/uniprot/RCBA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006629lipid metabolic process; IBA:GO_Central.
GO_processGO:0006629http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006629
UniProtKBPLDB_ECOLIhttp://www.uniprot.org/uniprot/PLDB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDAY_ECOLIhttp://www.uniprot.org/uniprot/YDAY_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIDG_ECOLIhttp://www.uniprot.org/uniprot/YIDG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0015889cobalamin transport; IMP:EcoCyc.
# GO_processGO:0015891siderophore transport; TAS:EcoCyc.
# GO_processGO:0042914colicin transport; TAS:EcoCyc.
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0015889http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015889
GO_processGO:0015891http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015891
GO_processGO:0042914http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042914
UniProtKBTONB_ECOLIhttp://www.uniprot.org/uniprot/TONB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019521D-gluconate metabolic process; IEA:UniProtKB-KW.
GO_processGO:0019521http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019521
UniProtKBGNTU_ECOLIhttp://www.uniprot.org/uniprot/GNTU_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEAL_ECOLIhttp://www.uniprot.org/uniprot/YEAL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006207'de novo' pyrimidine nucleobase biosynthetic process; IMP:EcoCyc.
# GO_processGO:0044205'de novo' UMP biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006207http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006207
GO_processGO:0044205http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044205
UniProtKBPYRD_ECOLIhttp://www.uniprot.org/uniprot/PYRD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBASCG_ECOLIhttp://www.uniprot.org/uniprot/ASCG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0006417regulation of translation; IEA:UniProtKB-KW.
# GO_processGO:0043488regulation of mRNA stability; IMP:EcoliWiki.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
GO_processGO:0006417http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006417
GO_processGO:0043488http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043488
UniProtKBRS8_ECOLIhttp://www.uniprot.org/uniprot/RS8_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0030420establishment of competence for transformation; IEA:InterPro.
GO_processGO:0030420http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030420
UniProtKBYCAI_ECOLIhttp://www.uniprot.org/uniprot/YCAI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:InterPro.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYOEA_ECOLIhttp://www.uniprot.org/uniprot/YOEA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008643carbohydrate transport; IMP:CACAO.
# GO_processGO:0015767lactose transport; IDA:EcoCyc.
GO_processGO:0008643http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008643
GO_processGO:0015767http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015767
UniProtKBLACY_ECOLIhttp://www.uniprot.org/uniprot/LACY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1902765L-arginine import into cell; ISO:EcoCyc.
GO_processGO:1902765http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902765
UniProtKBARTM_ECOLIhttp://www.uniprot.org/uniprot/ARTM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBYDEO_ECOLIhttp://www.uniprot.org/uniprot/YDEO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
UniProtKBXYLS_ECOLIhttp://www.uniprot.org/uniprot/XYLS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009268response to pH; IMP:EcoCyc.
GO_processGO:0009268http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009268
UniProtKBHDED_ECOLIhttp://www.uniprot.org/uniprot/HDED_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006046N-acetylglucosamine catabolic process; IBA:GO_Central.
# GO_processGO:0006048UDP-N-acetylglucosamine biosynthetic process; IBA:GO_Central.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IBA:GO_Central.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006046http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006046
GO_processGO:0006048http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006048
GO_processGO:0019262http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019262
UniProtKBYIEK_ECOLIhttp://www.uniprot.org/uniprot/YIEK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006430lysyl-tRNA aminoacylation; IEA:InterPro.
# GO_processGO:0071915protein-lysine lysylation; IDA:EcoCyc.
# GO_processGO:0072581protein-N6-(L-lysyl)-L-lysine modification to protein-N6-(beta-lysyl)-L-lysine; IDA:EcoCyc.
GO_processGO:0006430http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006430
GO_processGO:0071915http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071915
GO_processGO:0072581http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0072581
UniProtKBEPMA_ECOLIhttp://www.uniprot.org/uniprot/EPMA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006432phenylalanyl-tRNA aminoacylation; IMP:EcoCyc.
GO_processGO:0006432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006432
UniProtKBSYFA_ECOLIhttp://www.uniprot.org/uniprot/SYFA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0015074DNA integration; IEA:UniProtKB-KW.
# RecNameSerine recombinase PinE {ECO:0000250|UniProtKBP03015}
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
UniProtKBPINE_ECOLIhttp://www.uniprot.org/uniprot/PINE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006402mRNA catabolic process; IDA:EcoCyc.
# GO_processGO:0006415translational termination; IDA:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006402http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006402
GO_processGO:0006415http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006415
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBYAFQ_ECOLIhttp://www.uniprot.org/uniprot/YAFQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006113fermentation; IEP:EcoCyc.
# GO_processGO:0006810transport; IEA:InterPro.
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0022904respiratory electron transport chain; IEA:InterPro.
GO_processGO:0006113http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006113
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0022904http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022904
UniProtKBCYBH_ECOLIhttp://www.uniprot.org/uniprot/CYBH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009234menaquinone biosynthetic process; IMP:CACAO.
GO_processGO:0009234http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009234
UniProtKBMENI_ECOLIhttp://www.uniprot.org/uniprot/MENI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBLDRA_ECOLIhttp://www.uniprot.org/uniprot/LDRA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBLPF_ECOLIhttp://www.uniprot.org/uniprot/LPF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:1900190regulation of single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:1900190http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1900190
UniProtKBYFJR_ECOLIhttp://www.uniprot.org/uniprot/YFJR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019594mannitol metabolic process; IEA:InterPro.
GO_processGO:0019594http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019594
UniProtKBYEIQ_ECOLIhttp://www.uniprot.org/uniprot/YEIQ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQGD_ECOLIhttp://www.uniprot.org/uniprot/YQGD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006635fatty acid beta-oxidation; IBA:GO_Central.
# GO_processGO:00712711-butanol biosynthetic process; IMP:CACAO.
GO_processGO:0006635http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006635
GO_processGO:0071271http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071271
UniProtKBYQEF_ECOLIhttp://www.uniprot.org/uniprot/YQEF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0042128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042128
UniProtKBNARP_ECOLIhttp://www.uniprot.org/uniprot/NARP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0033611oxalate catabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0071468cellular response to acidic pH; IMP:EcoCyc.
GO_processGO:0033611http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033611
GO_processGO:0071468http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071468
UniProtKBFCTA_ECOLIhttp://www.uniprot.org/uniprot/FCTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019076viral release from host cell; IEA:UniProtKB-KW.
# GO_processGO:0019835cytolysis; IEA:UniProtKB-KW.
GO_processGO:0019076http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019076
GO_processGO:0019835http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019835
UniProtKBRZOD_ECOLIhttp://www.uniprot.org/uniprot/RZOD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBLHR_ECOLIhttp://www.uniprot.org/uniprot/LHR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009097isoleucine biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009099valine biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009097http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009097
GO_processGO:0009099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009099
UniProtKBILVG_ECOLIhttp://www.uniprot.org/uniprot/ILVG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002143tRNA wobble position uridine thiolation; IMP:EcoCyc.
# GO_processGO:0006777Mo-molybdopterin cofactor biosynthetic process; IMP:EcoCyc.
GO_processGO:0002143http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002143
GO_processGO:0006777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006777
UniProtKBTUSA_ECOLIhttp://www.uniprot.org/uniprot/TUSA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IDA:EcoCyc.
GO_processGO:0006790http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006790
UniProtKBSUBI_ECOLIhttp://www.uniprot.org/uniprot/SUBI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IMP:EcoCyc.
# GO_processGO:2001061D-glycero-D-manno-heptose 7-phosphate biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
GO_processGO:2001061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2001061
UniProtKBGMHA_ECOLIhttp://www.uniprot.org/uniprot/GMHA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IBA:GO_Central.
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
# GO_processGO:0009061anaerobic respiration; IMP:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoCyc.
# GO_processGO:0051604protein maturation; IDA:EcoCyc.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IBA:GO_Central.
GO_processGO:0006790http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006790
GO_processGO:0009060http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009060
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
GO_processGO:0051604http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051604
GO_processGO:0097428http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0097428
UniProtKBERPA_ECOLIhttp://www.uniprot.org/uniprot/ERPA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFFP_ECOLIhttp://www.uniprot.org/uniprot/YFFP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCEH_ECOLIhttp://www.uniprot.org/uniprot/YCEH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019571D-arabinose catabolic process; IMP:EcoCyc.
# GO_processGO:0042355L-fucose catabolic process; IMP:EcoCyc.
GO_processGO:0019571http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019571
GO_processGO:0042355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042355
UniProtKBFUCI_ECOLIhttp://www.uniprot.org/uniprot/FUCI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0042128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042128
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBNAC_ECOLIhttp://www.uniprot.org/uniprot/NAC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IMP:EcoliWiki.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0043093FtsZ-dependent cytokinesis; IEA:UniProtKB-HAMAP.
# GO_processGO:0051301cell division; IMP:EcoliWiki.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0043093http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043093
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBFTSW_ECOLIhttp://www.uniprot.org/uniprot/FTSW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0045226extracellular polysaccharide biosynthetic process; IMP:EcoCyc.
GO_processGO:0045226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045226
UniProtKBYJBF_ECOLIhttp://www.uniprot.org/uniprot/YJBF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBARCA_ECOLIhttp://www.uniprot.org/uniprot/ARCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009266response to temperature stimulus; IEP:EcoCyc.
GO_processGO:0009266http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009266
UniProtKBPRP1_ECOLIhttp://www.uniprot.org/uniprot/PRP1_ECOLI
DataBaseIDURL or Descriptions
UniProtKBTRAX1_ECOLIhttp://www.uniprot.org/uniprot/TRAX1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
GO_processGO:0000027http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000027
UniProtKBDER_ECOLIhttp://www.uniprot.org/uniprot/DER_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0016579protein deubiquitination; IDA:EcoCyc.
GO_processGO:0016579http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016579
UniProtKBELAD_ECOLIhttp://www.uniprot.org/uniprot/ELAD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYRAQ_ECOLIhttp://www.uniprot.org/uniprot/YRAQ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYRDA_ECOLIhttp://www.uniprot.org/uniprot/YRDA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051224negative regulation of protein transport; IDA:EcoCyc.
GO_processGO:0051224http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051224
UniProtKBNAPD_ECOLIhttp://www.uniprot.org/uniprot/NAPD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJBS_ECOLIhttp://www.uniprot.org/uniprot/YJBS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
GO_processGO:0051607http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051607
UniProtKBCASC_ECOLIhttp://www.uniprot.org/uniprot/CASC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBSAFA_ECOLIhttp://www.uniprot.org/uniprot/SAFA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0090347regulation of cellular organohalogen metabolic process; IEP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
GO_processGO:0090347http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0090347
UniProtKBRCLR_ECOLIhttp://www.uniprot.org/uniprot/RCLR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBAPHA_ECOLIhttp://www.uniprot.org/uniprot/APHA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBEFTS_ECOLIhttp://www.uniprot.org/uniprot/EFTS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0033543fatty acid beta-oxidation, unsaturated, even number, reductase/isomerase pathway; IMP:EcoCyc.
GO_processGO:0033543http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033543
UniProtKBFADH_ECOLIhttp://www.uniprot.org/uniprot/FADH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
# GO_processGO:0043711pilus organization; IMP:EcoCyc.
GO_processGO:0009297http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009297
GO_processGO:0043711http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043711
UniProtKBELFC_ECOLIhttp://www.uniprot.org/uniprot/ELFC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006465signal peptide processing; IMP:EcoliWiki.
GO_processGO:0006465http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006465
UniProtKBSPPA_ECOLIhttp://www.uniprot.org/uniprot/SPPA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIFL_ECOLIhttp://www.uniprot.org/uniprot/YIFL_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEII_ECOLIhttp://www.uniprot.org/uniprot/YEII_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009637response to blue light; IDA:EcoCyc.
# GO_processGO:0018298protein-chromophore linkage; IEA:UniProtKB-KW.
# GO_processGO:0043433negative regulation of sequence-specific DNA binding transcription factor activity; IDA:EcoCyc.
GO_processGO:0009637http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009637
GO_processGO:0018298http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018298
GO_processGO:0043433http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043433
UniProtKBBLUF_ECOLIhttp://www.uniprot.org/uniprot/BLUF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYICN_ECOLIhttp://www.uniprot.org/uniprot/YICN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000918barrier septum site selection; IDA:EcoCyc.
# GO_processGO:0032955regulation of barrier septum assembly; IGI:EcoliWiki.
# GO_processGO:0051302regulation of cell division; IGI:EcoliWiki.
GO_processGO:0000918http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000918
GO_processGO:0032955http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032955
GO_processGO:0051302http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051302
UniProtKBMINE_ECOLIhttp://www.uniprot.org/uniprot/MINE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDFK_ECOLIhttp://www.uniprot.org/uniprot/YDFK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUBC_ECOLIhttp://www.uniprot.org/uniprot/YUBC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006464cellular protein modification process; IDA:EcoliWiki.
# GO_processGO:0006474N-terminal protein amino acid acetylation; IDA:EcoliWiki.
# GO_processGO:0017198N-terminal peptidyl-serine acetylation; IMP:EcoCyc.
GO_processGO:0006464http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006464
GO_processGO:0006474http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006474
GO_processGO:0017198http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0017198
UniProtKBRIML_ECOLIhttp://www.uniprot.org/uniprot/RIML_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYPHC_ECOLIhttp://www.uniprot.org/uniprot/YPHC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEHK_ECOLIhttp://www.uniprot.org/uniprot/YEHK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006002fructose 6-phosphate metabolic process; IBA:GO_Central.
# GO_processGO:0006048UDP-N-acetylglucosamine biosynthetic process; IMP:EcoCyc.
# GO_processGO:0006541glutamine metabolic process; IEA:UniProtKB-HAMAP.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006002http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006002
GO_processGO:0006048http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006048
GO_processGO:0006541http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006541
UniProtKBGLMS_ECOLIhttp://www.uniprot.org/uniprot/GLMS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006779porphyrin-containing compound biosynthetic process; ISS:UniProtKB.
# GO_processGO:0006782protoporphyrinogen IX biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006779http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006779
GO_processGO:0006782http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006782
UniProtKBYGGW_ECOLIhttp://www.uniprot.org/uniprot/YGGW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBBLC_ECOLIhttp://www.uniprot.org/uniprot/BLC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBHL_ECOLIhttp://www.uniprot.org/uniprot/YBHL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:InterPro.
GO_processGO:0006814http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006814
UniProtKBYAGG_ECOLIhttp://www.uniprot.org/uniprot/YAGG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006457protein folding; IMP:EcoCyc.
# GO_processGO:0015031protein transport; IEA:InterPro.
# GO_processGO:0043165Gram-negative-bacterium-type cell outer membrane assembly; IMP:EcoliWiki.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0050821protein stabilization; IMP:CACAO.
# GO_processGO:0051085chaperone mediated protein folding requiring cofactor; IMP:EcoCyc.
# GO_processGO:0060274maintenance of stationary phase; IMP:EcoliWiki.
GO_processGO:0006457http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006457
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0043165http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043165
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
GO_processGO:0050821http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0050821
GO_processGO:0051085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051085
GO_processGO:0060274http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0060274
UniProtKBSURA_ECOLIhttp://www.uniprot.org/uniprot/SURA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IMP:EcoCyc.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBSFMA_ECOLIhttp://www.uniprot.org/uniprot/SFMA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015716organic phosphonate transport; IEA:InterPro.
# GO_processGO:0019700organic phosphonate catabolic process; IMP:EcoCyc.
GO_processGO:0015716http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015716
GO_processGO:0019700http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019700
UniProtKBPHNG_ECOLIhttp://www.uniprot.org/uniprot/PHNG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006069ethanol oxidation; IEA:InterPro.
# GO_processGO:0046294formaldehyde catabolic process; IMP:EcoliWiki.
GO_processGO:0006069http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006069
GO_processGO:0046294http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046294
UniProtKBFRMA_ECOLIhttp://www.uniprot.org/uniprot/FRMA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046292formaldehyde metabolic process; IMP:EcoCyc.
# GO_processGO:0046294formaldehyde catabolic process; IEA:InterPro.
GO_processGO:0046292http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046292
GO_processGO:0046294http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046294
UniProtKBSFGH1_ECOLIhttp://www.uniprot.org/uniprot/SFGH1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-UniPathway.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
GO_processGO:0042128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042128
UniProtKBNIRB_ECOLIhttp://www.uniprot.org/uniprot/NIRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006808regulation of nitrogen utilization; IEA:InterPro.
# GO_processGO:0009399nitrogen fixation; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006808http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006808
GO_processGO:0009399http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009399
UniProtKBNTRC_ECOLIhttp://www.uniprot.org/uniprot/NTRC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBHSRA_ECOLIhttp://www.uniprot.org/uniprot/HSRA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006826iron ion transport; IEA:InterPro.
# GO_processGO:0006880intracellular sequestering of iron ion; IDA:EcoCyc.
GO_processGO:0006826http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006826
GO_processGO:0006880http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006880
UniProtKBBFR_ECOLIhttp://www.uniprot.org/uniprot/BFR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046336ethanolamine catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0046336http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046336
UniProtKBEUTG_ECOLIhttp://www.uniprot.org/uniprot/EUTG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0009254peptidoglycan turnover; IEA:UniProtKB-HAMAP.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0009254http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009254
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBMPL_ECOLIhttp://www.uniprot.org/uniprot/MPL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006631fatty acid metabolic process; IGI:EcoliWiki.
# GO_processGO:0008654phospholipid biosynthetic process; IGI:EcoliWiki.
GO_processGO:0006631http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006631
GO_processGO:0008654http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008654
UniProtKBAAS_ECOLIhttp://www.uniprot.org/uniprot/AAS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBAGAR_ECOLIhttp://www.uniprot.org/uniprot/AGAR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IMP:EcoliWiki.
# GO_processGO:0006270DNA replication initiation; IBA:GO_Central.
# GO_processGO:0006275regulation of DNA replication; IMP:EcoliWiki.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0008156negative regulation of DNA replication; IEA:UniProtKB-KW.
GO_processGO:0006260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006260
GO_processGO:0006270http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006270
GO_processGO:0006275http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006275
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0008156http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008156
UniProtKBDNAA_ECOLIhttp://www.uniprot.org/uniprot/DNAA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
UniProtKBAGAS_ECOLIhttp://www.uniprot.org/uniprot/AGAS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYGBI_ECOLIhttp://www.uniprot.org/uniprot/YGBI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBTRAP_ECOLIhttp://www.uniprot.org/uniprot/TRAP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IDA:UniProtKB.
# GO_processGO:0006396RNA processing; IDA:UniProtKB.
# GO_processGO:0006974cellular response to DNA damage stimulus; IDA:UniProtKB.
# GO_processGO:0042245RNA repair; TAS:UniProtKB.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
GO_processGO:0006396http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006396
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0042245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042245
UniProtKBRTCB_ECOLIhttp://www.uniprot.org/uniprot/RTCB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IEA:UniProtKB-KW.
# GO_processGO:0006276plasmid maintenance; IEA:UniProtKB-KW.
GO_processGO:0006260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006260
GO_processGO:0006276http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006276
UniProtKBREA1_ECOLIhttp://www.uniprot.org/uniprot/REA1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0016094polyprenol biosynthetic process; IMP:EcoCyc.
GO_processGO:0006744http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006744
GO_processGO:0016094http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016094
UniProtKBISPB_ECOLIhttp://www.uniprot.org/uniprot/ISPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009242colanic acid biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0042351'de novo' GDP-L-fucose biosynthetic process; IEA:UniProtKB-HAMAP.
GO_processGO:0009242http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009242
GO_processGO:0042351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042351
UniProtKBFCL_ECOLIhttp://www.uniprot.org/uniprot/FCL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IBA:GO_Central.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:UniProtKB.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IBA:GO_Central.
GO_processGO:0006790http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006790
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
GO_processGO:0097428http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0097428
UniProtKBISCA_ECOLIhttp://www.uniprot.org/uniprot/ISCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0030153bacteriocin immunity; IMP:EcoCyc.
GO_processGO:0030153http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030153
UniProtKBCBRC_ECOLIhttp://www.uniprot.org/uniprot/CBRC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000746conjugation; IMP:EcoliWiki.
# GO_processGO:0006810transport; IDA:EcoliWiki.
# GO_processGO:0006811ion transport; IDA:EcoliWiki.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0009597detection of virus; IMP:EcoliWiki.
# GO_processGO:0034220ion transmembrane transport; IDA:EcoCyc.
# GO_processGO:0046718viral entry into host cell; IMP:EcoliWiki.
GO_processGO:0000746http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000746
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009597http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009597
GO_processGO:0034220http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034220
GO_processGO:0046718http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046718
UniProtKBOMPA_ECOLIhttp://www.uniprot.org/uniprot/OMPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBCREB_ECOLIhttp://www.uniprot.org/uniprot/CREB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006071glycerol metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006071http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006071
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBGLPR_ECOLIhttp://www.uniprot.org/uniprot/GLPR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYNIB_ECOLIhttp://www.uniprot.org/uniprot/YNIB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCII_ECOLIhttp://www.uniprot.org/uniprot/YCII_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006281DNA repair; IMP:EcoCyc.
# GO_processGO:0006289nucleotide-excision repair; IEA:UniProtKB-HAMAP.
# GO_processGO:0009432SOS response; IEA:UniProtKB-HAMAP.
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
GO_processGO:0006289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006289
GO_processGO:0009432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009432
UniProtKBUVRA_ECOLIhttp://www.uniprot.org/uniprot/UVRA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHHL_ECOLIhttp://www.uniprot.org/uniprot/YHHL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015906sulfathiazole transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0015906http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015906
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBMDTO_ECOLIhttp://www.uniprot.org/uniprot/MDTO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0022610biological adhesion; IMP:EcoCyc.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
# GO_processGO:0071806protein transmembrane transport; IMP:EcoCyc.
GO_processGO:0022610http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022610
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
GO_processGO:0071806http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071806
UniProtKBCSGG_ECOLIhttp://www.uniprot.org/uniprot/CSGG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBPQIA_ECOLIhttp://www.uniprot.org/uniprot/PQIA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009234menaquinone biosynthetic process; IMP:EcoCyc.
GO_processGO:0009234http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009234
UniProtKBMENC_ECOLIhttp://www.uniprot.org/uniprot/MENC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYDCR_ECOLIhttp://www.uniprot.org/uniprot/YDCR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006400tRNA modification; IMP:EcoCyc.
# GO_processGO:0034605cellular response to heat; IMP:EcoCyc.
GO_processGO:0006400http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006400
GO_processGO:0034605http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034605
UniProtKBMIAA_ECOLIhttp://www.uniprot.org/uniprot/MIAA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDHZ_ECOLIhttp://www.uniprot.org/uniprot/YDHZ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015074DNA integration; IEA:UniProtKB-KW.
# RecNameSerine recombinase PinQ {ECO:0000250|UniProtKBP03015}
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
UniProtKBPINQ_ECOLIhttp://www.uniprot.org/uniprot/PINQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSC3_ECOLIhttp://www.uniprot.org/uniprot/INSC3_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IPI:EcoCyc.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
UniProtKBKPYK1_ECOLIhttp://www.uniprot.org/uniprot/KPYK1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006402mRNA catabolic process; IMP:EcoCyc.
GO_processGO:0006402http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006402
UniProtKBHICA_ECOLIhttp://www.uniprot.org/uniprot/HICA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000920cell separation after cytokinesis; IMP:EcoliWiki.
# GO_processGO:0001896autolysis; IGI:EcoliWiki.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0009273peptidoglycan-based cell wall biogenesis; IMP:EcoCyc.
# GO_processGO:0042493response to drug; IMP:EcoCyc.
# GO_processGO:0051345positive regulation of hydrolase activity; IDA:EcoCyc.
GO_processGO:0000920http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000920
GO_processGO:0001896http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0001896
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0009273http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009273
GO_processGO:0042493http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042493
GO_processGO:0051345http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051345
UniProtKBENVC_ECOLIhttp://www.uniprot.org/uniprot/ENVC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYGGR_ECOLIhttp://www.uniprot.org/uniprot/YGGR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYIJD_ECOLIhttp://www.uniprot.org/uniprot/YIJD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009117nucleotide metabolic process; IEA:InterPro.
# GO_processGO:0043094cellular metabolic compound salvage; IEA:InterPro.
GO_processGO:0009117http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009117
GO_processGO:0043094http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043094
UniProtKBYHFW_ECOLIhttp://www.uniprot.org/uniprot/YHFW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-HAMAP.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBRPOB_ECOLIhttp://www.uniprot.org/uniprot/RPOB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:2000144positive regulation of DNA-templated transcription, initiation; IEP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:2000144http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2000144
UniProtKBMNTR_ECOLIhttp://www.uniprot.org/uniprot/MNTR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
UniProtKBFRLB_ECOLIhttp://www.uniprot.org/uniprot/FRLB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYBIH_ECOLIhttp://www.uniprot.org/uniprot/YBIH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IMP:EcoCyc.
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
UniProtKBFUMA_ECOLIhttp://www.uniprot.org/uniprot/FUMA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0017004cytochrome complex assembly; IMP:EcoCyc.
GO_processGO:0017004http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0017004
UniProtKBCCMH_ECOLIhttp://www.uniprot.org/uniprot/CCMH_ECOLI
DataBaseIDURL or Descriptions
UniProtKBACOCT_ECOLIhttp://www.uniprot.org/uniprot/ACOCT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006396RNA processing; IEA:InterPro.
GO_processGO:0006396http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006396
UniProtKBYKFJ_ECOLIhttp://www.uniprot.org/uniprot/YKFJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IEA:InterPro.
# GO_processGO:0032196transposition; IEA:UniProtKB-KW.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
GO_processGO:0032196http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032196
UniProtKBINSF5_ECOLIhttp://www.uniprot.org/uniprot/INSF5_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0042938dipeptide transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0042938http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042938
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBDDPA_ECOLIhttp://www.uniprot.org/uniprot/DDPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006261DNA-dependent DNA replication; IMP:EcoCyc.
# GO_processGO:0006269DNA replication, synthesis of RNA primer; IEA:UniProtKB-KW.
# GO_processGO:0006270DNA replication initiation; IDA:EcoCyc.
GO_processGO:0006261http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006261
GO_processGO:0006269http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006269
GO_processGO:0006270http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006270
UniProtKBPRIC_ECOLIhttp://www.uniprot.org/uniprot/PRIC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009440cyanate catabolic process; IMP:EcoCyc.
# GO_processGO:0015976carbon utilization; IEA:InterPro.
GO_processGO:0009440http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009440
GO_processGO:0015976http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015976
UniProtKBCYNT_ECOLIhttp://www.uniprot.org/uniprot/CYNT_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYMFN_ECOLIhttp://www.uniprot.org/uniprot/YMFN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006208pyrimidine nucleobase catabolic process; IMP:EcoCyc.
# GO_processGO:0006210thymine catabolic process; IDA:CACAO.
# GO_processGO:0006212uracil catabolic process; IDA:UniProtKB.
# GO_processGO:0019740nitrogen utilization; IDA:UniProtKB.
# GO_processGO:0046306alkanesulfonate catabolic process; IBA:GO_Central.
GO_processGO:0006208http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006208
GO_processGO:0006210http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006210
GO_processGO:0006212http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006212
GO_processGO:0019740http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019740
GO_processGO:0046306http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046306
UniProtKBRUTA_ECOLIhttp://www.uniprot.org/uniprot/RUTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006970response to osmotic stress; IMP:EcoCyc.
GO_processGO:0006970http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006970
UniProtKBOSMY_ECOLIhttp://www.uniprot.org/uniprot/OSMY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBLACI_ECOLIhttp://www.uniprot.org/uniprot/LACI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:00193803-phenylpropionate catabolic process; IMP:EcoCyc.
# GO_processGO:0019439aromatic compound catabolic process; IEA:UniProtKB-HAMAP.
GO_processGO:0019380http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019380
GO_processGO:0019439http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019439
UniProtKBHCAC_ECOLIhttp://www.uniprot.org/uniprot/HCAC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDIU_ECOLIhttp://www.uniprot.org/uniprot/YDIU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0044010single-species biofilm formation; IGI:EcoCyc.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBALPA_ECOLIhttp://www.uniprot.org/uniprot/ALPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IBA:GO_Central.
# GO_processGO:0042254ribosome biogenesis; IBA:GO_Central.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
GO_processGO:0042254http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042254
UniProtKBRS13_ECOLIhttp://www.uniprot.org/uniprot/RS13_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0032074negative regulation of nuclease activity; IDA:EcoCyc.
# GO_processGO:0042278purine nucleoside metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0060701negative regulation of ribonuclease activity; IEA:UniProtKB-HAMAP.
# GO_processGO:1900231regulation of single-species biofilm formation on inanimate substrate; IMP:EcoCyc.
GO_processGO:0032074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032074
GO_processGO:0042278http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042278
GO_processGO:0060701http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0060701
GO_processGO:1900231http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1900231
UniProtKBYMDB_ECOLIhttp://www.uniprot.org/uniprot/YMDB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015761mannose transport; IDA:EcoCyc.
# GO_processGO:0061490glucose import into cell; IDA:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0015761http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015761
GO_processGO:0061490http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0061490
UniProtKBPTNAB_ECOLIhttp://www.uniprot.org/uniprot/PTNAB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002047phenazine biosynthetic process; IBA:GO_Central.
# GO_processGO:0009239enterobactin biosynthetic process; IDA:UniProtKB.
GO_processGO:0002047http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002047
GO_processGO:0009239http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009239
UniProtKBENTB_ECOLIhttp://www.uniprot.org/uniprot/ENTB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBJM_ECOLIhttp://www.uniprot.org/uniprot/YBJM_ECOLI
DataBaseIDURL or Descriptions
UniProtKBCBRB_ECOLIhttp://www.uniprot.org/uniprot/CBRB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBFIMG_ECOLIhttp://www.uniprot.org/uniprot/FIMG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBGFCA_ECOLIhttp://www.uniprot.org/uniprot/GFCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006730one-carbon metabolic process; IBA:GO_Central.
# GO_processGO:0009086methionine biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0035999tetrahydrofolate interconversion; IEA:UniProtKB-UniPathway.
# GO_processGO:0046654tetrahydrofolate biosynthetic process; IDA:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
GO_processGO:0006730http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006730
GO_processGO:0009086http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009086
GO_processGO:0035999http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0035999
GO_processGO:0046654http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046654
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
UniProtKBMETF_ECOLIhttp://www.uniprot.org/uniprot/METF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015829valine transport; IMP:EcoCyc.
GO_processGO:0015829http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015829
UniProtKBYGAH_ECOLIhttp://www.uniprot.org/uniprot/YGAH_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFDM_ECOLIhttp://www.uniprot.org/uniprot/YFDM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
# GO_processGO:0044550secondary metabolite biosynthetic process; IBA:GO_Central.
GO_processGO:0006744http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006744
GO_processGO:0044550http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044550
UniProtKBUBII_ECOLIhttp://www.uniprot.org/uniprot/UBII_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYKFB_ECOLIhttp://www.uniprot.org/uniprot/YKFB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015758glucose transport; IDA:EcoliWiki.
# GO_processGO:0015767lactose transport; IDA:EcoliWiki.
# GO_processGO:0036448cellular response to glucose-phosphate stress; IMP:EcoCyc.
GO_processGO:0015758http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015758
GO_processGO:0015767http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015767
GO_processGO:0036448http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0036448
UniProtKBSETA_ECOLIhttp://www.uniprot.org/uniprot/SETA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBPHOP_ECOLIhttp://www.uniprot.org/uniprot/PHOP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEAX_ECOLIhttp://www.uniprot.org/uniprot/YEAX_ECOLI
DataBaseIDURL or Descriptions
# COFACTORTRPE_ECOLIName=Mg(2+); Xref=ChEBI CHEBI 18420; Evidence={ECO 0000250|UniProtKB P00897}; Note=Binds 1 Mg(2+) ion per subunit. {ECO 0000250|UniProtKB P00897};
# GO_processGO:0000162tryptophan biosynthetic process; IDA:EcoCyc.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
GO_processGO:0000162http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000162
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
UniProtKBTRPE_ECOLIhttp://www.uniprot.org/uniprot/TRPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0055114oxidation-reduction process; IBA:GO_Central.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBYJHC_ECOLIhttp://www.uniprot.org/uniprot/YJHC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006749glutathione metabolic process; IBA:GO_Central.
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
GO_processGO:0006749http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006749
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
UniProtKBYFCG_ECOLIhttp://www.uniprot.org/uniprot/YFCG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042953lipoprotein transport; IDA:EcoCyc.
# GO_processGO:0044874lipoprotein localization to outer membrane; IMP:CACAO.
# GO_processGO:0089705protein localization to outer membrane; IDA:CACAO.
GO_processGO:0042953http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042953
GO_processGO:0044874http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044874
GO_processGO:0089705http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0089705
UniProtKBLOLD_ECOLIhttp://www.uniprot.org/uniprot/LOLD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0046688response to copper ion; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
GO_processGO:0046688http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046688
UniProtKBCOMR_ECOLIhttp://www.uniprot.org/uniprot/COMR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBPHOL_ECOLIhttp://www.uniprot.org/uniprot/PHOL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019242methylglyoxal biosynthetic process; IMP:EcoCyc.
GO_processGO:0019242http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019242
UniProtKBMGSA_ECOLIhttp://www.uniprot.org/uniprot/MGSA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDHR_ECOLIhttp://www.uniprot.org/uniprot/YDHR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoliWiki.
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
UniProtKBCYAY_ECOLIhttp://www.uniprot.org/uniprot/CYAY_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEED_ECOLIhttp://www.uniprot.org/uniprot/YEED_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009306protein secretion; IEA:InterPro.
# GO_processGO:0044780bacterial-type flagellum assembly; IMP:EcoCyc.
GO_processGO:0009306http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009306
GO_processGO:0044780http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044780
UniProtKBFLHA_ECOLIhttp://www.uniprot.org/uniprot/FLHA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009253peptidoglycan catabolic process; IEA:InterPro.
# GO_processGO:0016998cell wall macromolecule catabolic process; IEA:InterPro.
# GO_processGO:0042742defense response to bacterium; IEA:UniProtKB-KW.
# GO_processGO:0044659cytolysis by virus of host cell; IEA:InterPro.
GO_processGO:0009253http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009253
GO_processGO:0016998http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016998
GO_processGO:0042742http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042742
GO_processGO:0044659http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044659
UniProtKBLYSQ_ECOLIhttp://www.uniprot.org/uniprot/LYSQ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGIC_ECOLIhttp://www.uniprot.org/uniprot/YGIC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYAGP_ECOLIhttp://www.uniprot.org/uniprot/YAGP_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYPEC_ECOLIhttp://www.uniprot.org/uniprot/YPEC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBYGCW_ECOLIhttp://www.uniprot.org/uniprot/YGCW_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFFS_ECOLIhttp://www.uniprot.org/uniprot/YFFS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
UniProtKBFECE_ECOLIhttp://www.uniprot.org/uniprot/FECE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
UniProtKBYQCC_ECOLIhttp://www.uniprot.org/uniprot/YQCC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006434seryl-tRNA aminoacylation; IDA:UniProtKB.
# GO_processGO:0016260selenocysteine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0097056selenocysteinyl-tRNA(Sec) biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0006434http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006434
GO_processGO:0016260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016260
GO_processGO:0097056http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0097056
UniProtKBSYS_ECOLIhttp://www.uniprot.org/uniprot/SYS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006012galactose metabolic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006012http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006012
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBGALR_ECOLIhttp://www.uniprot.org/uniprot/GALR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0015836lipid-linked peptidoglycan transport; IDA:EcoCyc.
# GO_processGO:0034203glycolipid translocation; IMP:CACAO.
# GO_processGO:0034204lipid translocation; IDA:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0015836http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015836
GO_processGO:0034203http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034203
GO_processGO:0034204http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034204
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBMURJ_ECOLIhttp://www.uniprot.org/uniprot/MURJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IBA:GO_Central.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYFER_ECOLIhttp://www.uniprot.org/uniprot/YFER_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEHS_ECOLIhttp://www.uniprot.org/uniprot/YEHS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IEA:UniProtKB-HAMAP.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0007059chromosome segregation; IEA:UniProtKB-HAMAP.
# GO_processGO:0030261chromosome condensation; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
GO_processGO:0006260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006260
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0007059http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007059
GO_processGO:0030261http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030261
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
UniProtKBMUKF_ECOLIhttp://www.uniprot.org/uniprot/MUKF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYDDM_ECOLIhttp://www.uniprot.org/uniprot/YDDM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009267cellular response to starvation; IEP:EcoCyc.
GO_processGO:0009267http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009267
UniProtKBCSTA_ECOLIhttp://www.uniprot.org/uniprot/CSTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0044011single-species biofilm formation on inanimate substrate; IMP:EcoCyc.
# GO_processGO:0070301cellular response to hydrogen peroxide; IMP:EcoCyc.
# GO_processGO:0071276cellular response to cadmium ion; IMP:EcoCyc.
GO_processGO:0044011http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044011
GO_processGO:0070301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070301
GO_processGO:0071276http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071276
UniProtKBYGIW_ECOLIhttp://www.uniprot.org/uniprot/YGIW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0043953protein transport by the Tat complex; IDA:EcoCyc.
# GO_processGO:0065002intracellular protein transmembrane transport; IDA:EcoCyc.
GO_processGO:0043953http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043953
GO_processGO:0065002http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0065002
UniProtKBTATC_ECOLIhttp://www.uniprot.org/uniprot/TATC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBNAGC_ECOLIhttp://www.uniprot.org/uniprot/NAGC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006811ion transport; IEA:UniProtKB-KW.
# GO_processGO:0034219carbohydrate transmembrane transport; IDA:EcoCyc.
GO_processGO:0006811http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006811
GO_processGO:0034219http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034219
UniProtKBOMPG_ECOLIhttp://www.uniprot.org/uniprot/OMPG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1902021regulation of bacterial-type flagellum-dependent cell motility; IMP:EcoCyc.
GO_processGO:1902021http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902021
UniProtKBYNEF_ECOLIhttp://www.uniprot.org/uniprot/YNEF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0070482response to oxygen levels; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0070482http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070482
UniProtKBDOSP_ECOLIhttp://www.uniprot.org/uniprot/DOSP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0001680tRNA 3'-terminal CCA addition; IDA:EcoCyc.
# GO_processGO:0042245RNA repair; IMP:EcoCyc.
GO_processGO:0001680http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0001680
GO_processGO:0042245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042245
UniProtKBCCA_ECOLIhttp://www.uniprot.org/uniprot/CCA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHHW_ECOLIhttp://www.uniprot.org/uniprot/YHHW_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009440cyanate catabolic process; IMP:EcoCyc.
GO_processGO:0009440http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009440
UniProtKBCYNS_ECOLIhttp://www.uniprot.org/uniprot/CYNS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0048473D-methionine transport; IMP:CACAO.
GO_processGO:0048473http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0048473
UniProtKBMETN_ECOLIhttp://www.uniprot.org/uniprot/METN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IBA:GO_Central.
# GO_processGO:0006412translation; IBA:GO_Central.
GO_processGO:0000027http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000027
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRL23_ECOLIhttp://www.uniprot.org/uniprot/RL23_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006820anion transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
GO_processGO:0006820http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006820
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBGUDP_ECOLIhttp://www.uniprot.org/uniprot/GUDP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYIAG_ECOLIhttp://www.uniprot.org/uniprot/YIAG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0042128nitrate assimilation; IEA:UniProtKB-KW.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
# GO_processGO:0071249cellular response to nitrate; IEP:EcoCyc.
# GO_processGO:0071250cellular response to nitrite; IMP:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0042128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042128
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
GO_processGO:0071249http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071249
GO_processGO:0071250http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071250
UniProtKBNARX_ECOLIhttp://www.uniprot.org/uniprot/NARX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006730one-carbon metabolic process; IEA:UniProtKB-KW.
GO_processGO:0006730http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006730
UniProtKBFOLM_ECOLIhttp://www.uniprot.org/uniprot/FOLM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006146adenine catabolic process; IBA:GO_Central.
# GO_processGO:0046101hypoxanthine biosynthetic process; IBA:GO_Central.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006146http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006146
GO_processGO:0046101http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046101
UniProtKBAGAA_ECOLIhttp://www.uniprot.org/uniprot/AGAA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0045454cell redox homeostasis; IEA:InterPro.
GO_processGO:0045454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045454
UniProtKBDSBC_ECOLIhttp://www.uniprot.org/uniprot/DSBC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0018012N-terminal peptidyl-alanine trimethylation; IMP:EcoCyc.
# GO_processGO:0018023peptidyl-lysine trimethylation; IDA:EcoCyc.
GO_processGO:0018012http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018012
GO_processGO:0018023http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0018023
UniProtKBPRMA_ECOLIhttp://www.uniprot.org/uniprot/PRMA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBY4286_ECOLIhttp://www.uniprot.org/uniprot/Y4286_ECOLI
DataBaseIDURL or Descriptions
UniProtKBILVX_ECOLIhttp://www.uniprot.org/uniprot/ILVX_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEDI_ECOLIhttp://www.uniprot.org/uniprot/YEDI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006814sodium ion transport; IEA:UniProtKB-KW.
GO_processGO:0006814http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006814
UniProtKBYIDK_ECOLIhttp://www.uniprot.org/uniprot/YIDK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0022904respiratory electron transport chain; IBA:GO_Central.
GO_processGO:0022904http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022904
UniProtKBNUOE_ECOLIhttp://www.uniprot.org/uniprot/NUOE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0032264IMP salvage; IEA:UniProtKB-UniPathway.
GO_processGO:0032264http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032264
UniProtKBINGK_ECOLIhttp://www.uniprot.org/uniprot/INGK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
GO_processGO:0051607http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051607
UniProtKBYFJL_ECOLIhttp://www.uniprot.org/uniprot/YFJL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051604protein maturation; IMP:EcoCyc.
GO_processGO:0051604http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051604
UniProtKBFDHE_ECOLIhttp://www.uniprot.org/uniprot/FDHE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUBI_ECOLIhttp://www.uniprot.org/uniprot/YUBI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEDK_ECOLIhttp://www.uniprot.org/uniprot/YEDK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUAK_ECOLIhttp://www.uniprot.org/uniprot/YUAK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006414translational elongation; IBA:GO_Central.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006414http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006414
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBEFTU2_ECOLIhttp://www.uniprot.org/uniprot/EFTU2_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
GO_processGO:0051607http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051607
UniProtKBCSE1_ECOLIhttp://www.uniprot.org/uniprot/CSE1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IMP:EcoCyc.
GO_processGO:0010124http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010124
UniProtKBPAAG_ECOLIhttp://www.uniprot.org/uniprot/PAAG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
# GO_processGO:0009437carnitine metabolic process; EXP:EcoliWiki.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0009437http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009437
UniProtKBCAIF_ECOLIhttp://www.uniprot.org/uniprot/CAIF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006820anion transport; IBA:GO_Central.
# GO_processGO:0055085transmembrane transport; IBA:GO_Central.
GO_processGO:0006820http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006820
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBRHMT_ECOLIhttp://www.uniprot.org/uniprot/RHMT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IEP:EcoCyc.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
UniProtKBDMSB_ECOLIhttp://www.uniprot.org/uniprot/DMSB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015986ATP synthesis coupled proton transport; IEA:UniProtKB-HAMAP.
GO_processGO:0015986http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015986
UniProtKBATPB_ECOLIhttp://www.uniprot.org/uniprot/ATPB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBIROK_ECOLIhttp://www.uniprot.org/uniprot/IROK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCEI_ECOLIhttp://www.uniprot.org/uniprot/YCEI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGBK_ECOLIhttp://www.uniprot.org/uniprot/YGBK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008152metabolic process; IEA:InterPro.
GO_processGO:0008152http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008152
UniProtKBYIDJ_ECOLIhttp://www.uniprot.org/uniprot/YIDJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008616queuosine biosynthetic process; IMP:EcoCyc.
GO_processGO:0008616http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008616
UniProtKBQUEF_ECOLIhttp://www.uniprot.org/uniprot/QUEF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006798polyphosphate catabolic process; IMP:EcoCyc.
GO_processGO:0006798http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006798
UniProtKBPPX_ECOLIhttp://www.uniprot.org/uniprot/PPX_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGJJ_ECOLIhttp://www.uniprot.org/uniprot/YGJJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0001407glycerophosphodiester transport; IDA:EcoCyc.
# GO_processGO:0015794glycerol-3-phosphate transport; IDA:EcoCyc.
GO_processGO:0001407http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0001407
GO_processGO:0015794http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015794
UniProtKBUGPB_ECOLIhttp://www.uniprot.org/uniprot/UGPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0016036cellular response to phosphate starvation; IEP:EcoCyc.
GO_processGO:0016036http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016036
UniProtKBYIBD_ECOLIhttp://www.uniprot.org/uniprot/YIBD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0033317pantothenate biosynthetic process from valine; IMP:EcoCyc.
GO_processGO:0033317http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033317
UniProtKBPANE_ECOLIhttp://www.uniprot.org/uniprot/PANE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHIM_ECOLIhttp://www.uniprot.org/uniprot/YHIM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015937coenzyme A biosynthetic process; IDA:EcoCyc.
GO_processGO:0015937http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015937
UniProtKBCOAE_ECOLIhttp://www.uniprot.org/uniprot/COAE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006364rRNA processing; IMP:EcoliWiki.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
GO_processGO:0006364http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006364
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
UniProtKBRNG_ECOLIhttp://www.uniprot.org/uniprot/RNG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IMP:EcoCyc.
# GO_processGO:0006098pentose-phosphate shunt; IMP:EcoCyc.
# GO_processGO:0009372quorum sensing; IEA:UniProtKB-KW.
GO_processGO:0006006http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006006
GO_processGO:0006098http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006098
GO_processGO:0009372http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009372
UniProtKBG6PD_ECOLIhttp://www.uniprot.org/uniprot/G6PD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQJG_ECOLIhttp://www.uniprot.org/uniprot/YQJG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDFW_ECOLIhttp://www.uniprot.org/uniprot/YDFW_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQJE_ECOLIhttp://www.uniprot.org/uniprot/YQJE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJEO_ECOLIhttp://www.uniprot.org/uniprot/YJEO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005993trehalose catabolic process; IMP:EcoCyc.
# GO_processGO:0071474cellular hyperosmotic response; IEP:EcoCyc.
GO_processGO:0005993http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005993
GO_processGO:0071474http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071474
UniProtKBTREF_ECOLIhttp://www.uniprot.org/uniprot/TREF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IBA:GO_Central.
GO_processGO:0071978http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071978
UniProtKBFLGE_ECOLIhttp://www.uniprot.org/uniprot/FLGE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0032259methylation; IBA:GO_Central.
GO_processGO:0032259http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032259
UniProtKBYJHP_ECOLIhttp://www.uniprot.org/uniprot/YJHP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015628protein secretion by the type II secretion system; IEA:InterPro.
GO_processGO:0015628http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015628
UniProtKBGSPD_ECOLIhttp://www.uniprot.org/uniprot/GSPD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042773ATP synthesis coupled electron transport; IEA:InterPro.
GO_processGO:0042773http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042773
UniProtKBHYCC_ECOLIhttp://www.uniprot.org/uniprot/HYCC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEP:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBBOLA_ECOLIhttp://www.uniprot.org/uniprot/BOLA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYFDQ_ECOLIhttp://www.uniprot.org/uniprot/YFDQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006744ubiquinone biosynthetic process; IMP:EcoCyc.
GO_processGO:0006744http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006744
UniProtKBUBIA_ECOLIhttp://www.uniprot.org/uniprot/UBIA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0048870cell motility; IMP:EcoCyc.
GO_processGO:0048870http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0048870
UniProtKBYHJH_ECOLIhttp://www.uniprot.org/uniprot/YHJH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006886intracellular protein transport; IDA:EcoliWiki.
# GO_processGO:0009306protein secretion; IEA:InterPro.
# GO_processGO:0043952protein transport by the Sec complex; IDA:EcoCyc.
# GO_processGO:0065002intracellular protein transmembrane transport; IDA:EcoliWiki.
GO_processGO:0006886http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006886
GO_processGO:0009306http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009306
GO_processGO:0043952http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043952
GO_processGO:0065002http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0065002
UniProtKBSECG_ECOLIhttp://www.uniprot.org/uniprot/SECG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IMP:EcoCyc.
GO_processGO:0071978http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071978
UniProtKBYFIR_ECOLIhttp://www.uniprot.org/uniprot/YFIR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071805potassium ion transmembrane transport; ISS:UniProtKB.
GO_processGO:0071805http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071805
UniProtKBTRKH_ECOLIhttp://www.uniprot.org/uniprot/TRKH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IEA:UniProtKB-UniPathway.
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
UniProtKBCISY_ECOLIhttp://www.uniprot.org/uniprot/CISY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0030308negative regulation of cell growth; IMP:EcoCyc.
# GO_processGO:0043488regulation of mRNA stability; IDA:UniProtKB.
GO_processGO:0030308http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030308
GO_processGO:0043488http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043488
UniProtKBCHPB_ECOLIhttp://www.uniprot.org/uniprot/CHPB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCIY_ECOLIhttp://www.uniprot.org/uniprot/YCIY_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYMGD_ECOLIhttp://www.uniprot.org/uniprot/YMGD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
# GO_processGO:0009103lipopolysaccharide biosynthetic process; ISS:UniProtKB.
# GO_processGO:0009243O antigen biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0019305dTDP-rhamnose biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0045226extracellular polysaccharide biosynthetic process; ISS:UniProtKB.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
GO_processGO:0009243http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009243
GO_processGO:0019305http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019305
GO_processGO:0045226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045226
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBRMLC_ECOLIhttp://www.uniprot.org/uniprot/RMLC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015882L-ascorbic acid transport; IMP:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0015882http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015882
UniProtKBULAC_ECOLIhttp://www.uniprot.org/uniprot/ULAC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0051301cell division; IEA:UniProtKB-HAMAP.
# GO_processGO:0051302regulation of cell division; IGI:EcoCyc.
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0051302http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051302
UniProtKBCEDA_ECOLIhttp://www.uniprot.org/uniprot/CEDA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBJS_ECOLIhttp://www.uniprot.org/uniprot/YBJS_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCGJ_ECOLIhttp://www.uniprot.org/uniprot/YCGJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IEA:UniProtKB-HAMAP.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0030163protein catabolic process; IEA:InterPro.
GO_processGO:0006508http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006508
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0030163http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030163
UniProtKBCLPS_ECOLIhttp://www.uniprot.org/uniprot/CLPS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009970cellular response to sulfate starvation; IDA:EcoliWiki.
# GO_processGO:0033194response to hydroperoxide; IMP:EcoCyc.
# GO_processGO:0033195response to alkyl hydroperoxide; IMP:EcoCyc.
# GO_processGO:0033214iron assimilation by chelation and transport; IMP:CACAO.
# GO_processGO:0045454cell redox homeostasis; IEA:InterPro.
GO_processGO:0009970http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009970
GO_processGO:0033194http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033194
GO_processGO:0033195http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033195
GO_processGO:0033214http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033214
GO_processGO:0045454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045454
UniProtKBAHPC_ECOLIhttp://www.uniprot.org/uniprot/AHPC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHFG_ECOLIhttp://www.uniprot.org/uniprot/YHFG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYQFE_ECOLIhttp://www.uniprot.org/uniprot/YQFE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBFRLD_ECOLIhttp://www.uniprot.org/uniprot/FRLD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IBA:GO_Central.
# GO_processGO:0006662glycerol ether metabolic process; IEA:InterPro.
# GO_processGO:0034599cellular response to oxidative stress; IBA:GO_Central.
# GO_processGO:0045454cell redox homeostasis; IBA:GO_Central.
# GO_processGO:0061077chaperone-mediated protein folding; IDA:EcoCyc.
GO_processGO:0000103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000103
GO_processGO:0006662http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006662
GO_processGO:0034599http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034599
GO_processGO:0045454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045454
GO_processGO:0061077http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0061077
UniProtKBYBBN_ECOLIhttp://www.uniprot.org/uniprot/YBBN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006053N-acetylmannosamine catabolic process; IMP:EcoCyc.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IMP:EcoCyc.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006053http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006053
GO_processGO:0019262http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019262
UniProtKBNANE_ECOLIhttp://www.uniprot.org/uniprot/NANE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0009086methionine biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0043433negative regulation of sequence-specific DNA binding transcription factor activity; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0009086http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009086
GO_processGO:0043433http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043433
UniProtKBMALY_ECOLIhttp://www.uniprot.org/uniprot/MALY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0010033response to organic substance; IEA:InterPro.
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoliWiki.
# GO_processGO:0043165Gram-negative-bacterium-type cell outer membrane assembly; IMP:EcoCyc.
GO_processGO:0010033http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010033
GO_processGO:0015920http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015920
GO_processGO:0043165http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043165
UniProtKBLPTD_ECOLIhttp://www.uniprot.org/uniprot/LPTD_ECOLI
DataBaseIDURL or Descriptions
UniProtKBMSYB_ECOLIhttp://www.uniprot.org/uniprot/MSYB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IMP:EcoCyc.
# GO_processGO:0043171peptide catabolic process; IGI:EcoliWiki.
GO_processGO:0006508http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006508
GO_processGO:0043171http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043171
UniProtKBAMPN_ECOLIhttp://www.uniprot.org/uniprot/AMPN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019394glucarate catabolic process; IDA:EcoliWiki.
# GO_processGO:0042838D-glucarate catabolic process; IDA:EcoCyc.
# GO_processGO:0046392galactarate catabolic process; IDA:EcoCyc.
GO_processGO:0019394http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019394
GO_processGO:0042838http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042838
GO_processGO:0046392http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046392
UniProtKBGARL_ECOLIhttp://www.uniprot.org/uniprot/GARL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0015074DNA integration; IMP:EcoCyc.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
UniProtKBFIME_ECOLIhttp://www.uniprot.org/uniprot/FIME_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006189'de novo' IMP biosynthetic process; IEA:UniProtKB-HAMAP.
GO_processGO:0006189http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006189
UniProtKBPUR5_ECOLIhttp://www.uniprot.org/uniprot/PUR5_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0010124phenylacetate catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0010124http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010124
UniProtKBPAAI_ECOLIhttp://www.uniprot.org/uniprot/PAAI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYOBI_ECOLIhttp://www.uniprot.org/uniprot/YOBI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0042493response to drug; IMP:EcoCyc.
GO_processGO:0006855http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006855
GO_processGO:0042493http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042493
UniProtKBACRB_ECOLIhttp://www.uniprot.org/uniprot/ACRB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBMODA_ECOLIhttp://www.uniprot.org/uniprot/MODA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000731DNA synthesis involved in DNA repair; IMP:EcoliWiki.
# GO_processGO:0006260DNA replication; IEA:UniProtKB-HAMAP.
# GO_processGO:0006302double-strand break repair; IBA:GO_Central.
# GO_processGO:0009411response to UV; IMP:EcoliWiki.
# GO_processGO:0009432SOS response; IEA:UniProtKB-HAMAP.
GO_processGO:0000731http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000731
GO_processGO:0006260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006260
GO_processGO:0006302http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006302
GO_processGO:0009411http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009411
GO_processGO:0009432http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009432
UniProtKBRECF_ECOLIhttp://www.uniprot.org/uniprot/RECF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042128nitrate assimilation; IDA:UniProtKB.
# GO_processGO:0051131chaperone-mediated protein complex assembly; IDA:UniProtKB.
GO_processGO:0042128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042128
GO_processGO:0051131http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051131
UniProtKBNARJ_ECOLIhttp://www.uniprot.org/uniprot/NARJ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDJJ_ECOLIhttp://www.uniprot.org/uniprot/YDJJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006269DNA replication, synthesis of RNA primer; IMP:CACAO.
GO_processGO:0006269http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006269
UniProtKBDNAG_ECOLIhttp://www.uniprot.org/uniprot/DNAG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYMDF_ECOLIhttp://www.uniprot.org/uniprot/YMDF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEBZ_ECOLIhttp://www.uniprot.org/uniprot/YEBZ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0022900electron transport chain; IEA:InterPro.
GO_processGO:0022900http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022900
UniProtKBRSXG_ECOLIhttp://www.uniprot.org/uniprot/RSXG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009052pentose-phosphate shunt, non-oxidative branch; IBA:GO_Central.
# GO_processGO:0019323pentose catabolic process; IBA:GO_Central.
# GO_processGO:0044262cellular carbohydrate metabolic process; IBA:GO_Central.
GO_processGO:0009052http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009052
GO_processGO:0019323http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019323
GO_processGO:0044262http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044262
UniProtKBSGCE_ECOLIhttp://www.uniprot.org/uniprot/SGCE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYOHP_ECOLIhttp://www.uniprot.org/uniprot/YOHP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0034775glutathione transmembrane transport; IMP:EcoCyc.
GO_processGO:0034775http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034775
UniProtKBGSIA_ECOLIhttp://www.uniprot.org/uniprot/GSIA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCDZ_ECOLIhttp://www.uniprot.org/uniprot/YCDZ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBSIRB1_ECOLIhttp://www.uniprot.org/uniprot/SIRB1_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDEK_ECOLIhttp://www.uniprot.org/uniprot/YDEK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005980glycogen catabolic process; IMP:EcoCyc.
# GO_processGO:0016052carbohydrate catabolic process; IDA:EcoliWiki.
GO_processGO:0005980http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005980
GO_processGO:0016052http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016052
UniProtKBPHSG_ECOLIhttp://www.uniprot.org/uniprot/PHSG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBDDLB_ECOLIhttp://www.uniprot.org/uniprot/DDLB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBFIXX_ECOLIhttp://www.uniprot.org/uniprot/FIXX_ECOLI
DataBaseIDURL or Descriptions
# AltNameFlavin transferase {ECO:0000250|UniProtKBA5F5Y3}
# CATALYTIC ACTIVITYFAD + [protein]-L-threonine = [protein]-FMN-L- threonine + AMP. {ECO:0000250|UniProtKBA5F5Y3}.
# COFACTORAPBE_ECOLIName=Mg(2+); Xref=ChEBI CHEBI 18420; Evidence={ECO 0000250|UniProtKB A5F5Y3};
# FUNCTIONAPBE_ECOLIFlavin transferase that catalyzes the transfer of the FMN moiety of FAD and its covalent binding to the hydroxyl group of a threonine residue in a target flavoprotein such as NqrB and NqrC, two subunits of the NQR complex. {ECO 0000250|UniProtKB A5F5Y3}.
# GO_processGO:0017013protein flavinylation; IEA:InterPro.
# RecNameFAD:protein FMN transferase {ECO0000250|UniProtKB:A5F5Y3}
# SUBCELLULAR LOCATIONAPBE_ECOLICell inner membrane {ECO 0000250|UniProtKB P41780, ECO 0000255|PROSITE- ProRule PRU00303}; Lipid-anchor {ECO 0000250|UniProtKB P41780, ECO 0000255|PROSITE-ProRule PRU00303}; Periplasmic side {ECO 0000250|UniProtKB P41780}.
EC_numberEC:2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3}http://www.genome.jp/dbget-bin/www_bget?EC:2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3}
ENZYME2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3}http://enzyme.expasy.org/EC/2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3}
GO_processGO:0017013http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0017013
IntEnz2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3}http://www.ebi.ac.uk/intenz/query?cmd=Search&q=2.7.1.180 {ECO:0000250|UniProtKB:A5F5Y3}
UniProtKBAPBE_ECOLIhttp://www.uniprot.org/uniprot/APBE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYPHA_ECOLIhttp://www.uniprot.org/uniprot/YPHA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHDU_ECOLIhttp://www.uniprot.org/uniprot/YHDU_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYUBJ_ECOLIhttp://www.uniprot.org/uniprot/YUBJ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYNJH_ECOLIhttp://www.uniprot.org/uniprot/YNJH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009245lipid A biosynthetic process; IDA:UniProtKB.
GO_processGO:0009245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009245
UniProtKBLPXH_ECOLIhttp://www.uniprot.org/uniprot/LPXH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBNIKE_ECOLIhttp://www.uniprot.org/uniprot/NIKE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0042953lipoprotein transport; IDA:EcoCyc.
GO_processGO:0042953http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042953
UniProtKBLOLE_ECOLIhttp://www.uniprot.org/uniprot/LOLE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBCYST_ECOLIhttp://www.uniprot.org/uniprot/CYST_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCHE_ECOLIhttp://www.uniprot.org/uniprot/YCHE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009228thiamine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009229thiamine diphosphate biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009228http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009228
GO_processGO:0009229http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009229
UniProtKBTHIC_ECOLIhttp://www.uniprot.org/uniprot/THIC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0043093FtsZ-dependent cytokinesis; IEA:UniProtKB-HAMAP.
# GO_processGO:0051258protein polymerization; IDA:EcoliWiki.
# GO_processGO:0051301cell division; IGI:CACAO.
# GO_processGO:0090529cell septum assembly; IEA:UniProtKB-HAMAP.
GO_processGO:0043093http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043093
GO_processGO:0051258http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051258
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0090529http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0090529
UniProtKBFTSZ_ECOLIhttp://www.uniprot.org/uniprot/FTSZ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHGN_ECOLIhttp://www.uniprot.org/uniprot/YHGN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IMP:EcoCyc.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
UniProtKBRMUC_ECOLIhttp://www.uniprot.org/uniprot/RMUC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006537glutamate biosynthetic process; IEA:InterPro.
GO_processGO:0006537http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006537
UniProtKBAEGA_ECOLIhttp://www.uniprot.org/uniprot/AEGA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015747urate transport; IMP:EcoCyc.
# GO_processGO:0015992proton transport; IEA:UniProtKB-KW.
# GO_processGO:0042906xanthine transport; IMP:EcoCyc.
GO_processGO:0015747http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015747
GO_processGO:0015992http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015992
GO_processGO:0042906http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042906
UniProtKBUACT_ECOLIhttp://www.uniprot.org/uniprot/UACT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009061anaerobic respiration; IMP:EcoCyc.
GO_processGO:0009061http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009061
UniProtKBNAPB_ECOLIhttp://www.uniprot.org/uniprot/NAPB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYRBL_ECOLIhttp://www.uniprot.org/uniprot/YRBL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006468protein phosphorylation; IDA:EcoliWiki.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoliWiki.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoliWiki.
# GO_processGO:0071310cellular response to organic substance; IEP:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0006468http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006468
GO_processGO:0042542http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042542
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
GO_processGO:0071310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071310
UniProtKBBARA_ECOLIhttp://www.uniprot.org/uniprot/BARA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008152metabolic process; IEA:InterPro.
GO_processGO:0008152http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008152
UniProtKBYEJM_ECOLIhttp://www.uniprot.org/uniprot/YEJM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006208pyrimidine nucleobase catabolic process; IDA:UniProtKB.
GO_processGO:0006208http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006208
UniProtKBPRET_ECOLIhttp://www.uniprot.org/uniprot/PRET_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0003333amino acid transmembrane transport; IDA:EcoCyc.
# GO_processGO:0051454intracellular pH elevation; IMP:EcoCyc.
GO_processGO:0003333http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0003333
GO_processGO:0051454http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051454
UniProtKBADIC_ECOLIhttp://www.uniprot.org/uniprot/ADIC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYDHC_ECOLIhttp://www.uniprot.org/uniprot/YDHC_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYSAA_ECOLIhttp://www.uniprot.org/uniprot/YSAA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBED_ECOLIhttp://www.uniprot.org/uniprot/YBED_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009094L-phenylalanine biosynthetic process; IGI:EcoliWiki.
# GO_processGO:0033585L-phenylalanine biosynthetic process from chorismate via phenylpyruvate; IMP:EcoCyc.
GO_processGO:0009094http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009094
GO_processGO:0033585http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033585
UniProtKBAAT_ECOLIhttp://www.uniprot.org/uniprot/AAT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006790sulfur compound metabolic process; IBA:GO_Central.
# GO_processGO:0006979response to oxidative stress; IMP:EcoCyc.
# GO_processGO:0010106cellular response to iron ion starvation; IMP:EcoCyc.
# GO_processGO:0015976carbon utilization; IMP:EcoCyc.
# GO_processGO:0016226iron-sulfur cluster assembly; IDA:EcoliWiki.
# GO_processGO:0097428protein maturation by iron-sulfur cluster transfer; IDA:EcoCyc.
GO_processGO:0006790http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006790
GO_processGO:0006979http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006979
GO_processGO:0010106http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010106
GO_processGO:0015976http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015976
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
GO_processGO:0097428http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0097428
UniProtKBNFUA_ECOLIhttp://www.uniprot.org/uniprot/NFUA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBFG_ECOLIhttp://www.uniprot.org/uniprot/YBFG_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDHS_ECOLIhttp://www.uniprot.org/uniprot/YDHS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
GO_processGO:0070475http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070475
UniProtKBRSMG_ECOLIhttp://www.uniprot.org/uniprot/RSMG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:1902210positive regulation of bacterial-type flagellum assembly; IMP:EcoCyc.
GO_processGO:1902210http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:1902210
UniProtKBBDM_ECOLIhttp://www.uniprot.org/uniprot/BDM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006769nicotinamide metabolic process; IBA:GO_Central.
# GO_processGO:0019363pyridine nucleotide biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0019674NAD metabolic process; IBA:GO_Central.
GO_processGO:0006769http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006769
GO_processGO:0019363http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019363
GO_processGO:0019674http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019674
UniProtKBPNCA_ECOLIhttp://www.uniprot.org/uniprot/PNCA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0033194response to hydroperoxide; IEP:EcoCyc.
GO_processGO:0033194http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033194
UniProtKBBTUE_ECOLIhttp://www.uniprot.org/uniprot/BTUE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006749glutathione metabolic process; IBA:GO_Central.
# GO_processGO:0042542response to hydrogen peroxide; IMP:EcoCyc.
GO_processGO:0006749http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006749
GO_processGO:0042542http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042542
UniProtKBGSTA_ECOLIhttp://www.uniprot.org/uniprot/GSTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051301cell division; IMP:EcoCyc.
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
UniProtKBYCJY_ECOLIhttp://www.uniprot.org/uniprot/YCJY_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0032263GMP salvage; IMP:EcoCyc.
# GO_processGO:0032264IMP salvage; IDA:EcoCyc.
# GO_processGO:0032265XMP salvage; IMP:EcoCyc.
GO_processGO:0032263http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032263
GO_processGO:0032264http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032264
GO_processGO:0032265http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0032265
UniProtKBXGPT_ECOLIhttp://www.uniprot.org/uniprot/XGPT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:InterPro.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBHEXR_ECOLIhttp://www.uniprot.org/uniprot/HEXR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006523alanine biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
# GO_processGO:0019272L-alanine biosynthetic process from pyruvate; IMP:EcoCyc.
# GO_processGO:0030632D-alanine biosynthetic process; IMP:UniProtKB.
# GO_processGO:0046677response to antibiotic; IMP:EcoCyc.
GO_processGO:0006523http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006523
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0019272http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019272
GO_processGO:0030632http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030632
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBALAA_ECOLIhttp://www.uniprot.org/uniprot/ALAA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0016226iron-sulfur cluster assembly; IMP:EcoCyc.
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
GO_processGO:0016226http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016226
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBFER_ECOLIhttp://www.uniprot.org/uniprot/FER_ECOLI
DataBaseIDURL or Descriptions
UniProtKBBISC_ECOLIhttp://www.uniprot.org/uniprot/BISC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IBA:GO_Central.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRS18_ECOLIhttp://www.uniprot.org/uniprot/RS18_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRL19_ECOLIhttp://www.uniprot.org/uniprot/RL19_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0034219carbohydrate transmembrane transport; IBA:GO_Central.
# GO_processGO:0045912negative regulation of carbohydrate metabolic process; IDA:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0034219http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034219
GO_processGO:0045912http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045912
UniProtKBPTGA_ECOLIhttp://www.uniprot.org/uniprot/PTGA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006554lysine catabolic process; IDA:EcoliWiki.
GO_processGO:0006554http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006554
UniProtKBDCLZ_ECOLIhttp://www.uniprot.org/uniprot/DCLZ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006655phosphatidylglycerol biosynthetic process; IBA:GO_Central.
# GO_processGO:0016024CDP-diacylglycerol biosynthetic process; IDA:EcoCyc.
GO_processGO:0006655http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006655
GO_processGO:0016024http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016024
UniProtKBCDSA_ECOLIhttp://www.uniprot.org/uniprot/CDSA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IBA:GO_Central.
# GO_processGO:0034219carbohydrate transmembrane transport; IBA:GO_Central.
# GO_processGO:0043610regulation of carbohydrate utilization; IBA:GO_Central.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0034219http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0034219
GO_processGO:0043610http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043610
UniProtKBPTIBC_ECOLIhttp://www.uniprot.org/uniprot/PTIBC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0015741fumarate transport; IDA:EcoliWiki.
# GO_processGO:0070778L-aspartate transport; IDA:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0015741http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015741
GO_processGO:0070778http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070778
UniProtKBDCTA_ECOLIhttp://www.uniprot.org/uniprot/DCTA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006569tryptophan catabolic process; IMP:EcoCyc.
# GO_processGO:0031556transcriptional attenuation by ribosome; IDA:EcoCyc.
GO_processGO:0006569http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006569
GO_processGO:0031556http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031556
UniProtKBLPTN_ECOLIhttp://www.uniprot.org/uniprot/LPTN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006605protein targeting; IEA:UniProtKB-HAMAP.
# GO_processGO:0015031protein transport; IBA:GO_Central.
# GO_processGO:0043952protein transport by the Sec complex; IEA:UniProtKB-HAMAP.
# GO_processGO:0065002intracellular protein transmembrane transport; IEA:UniProtKB-HAMAP.
GO_processGO:0006605http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006605
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0043952http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043952
GO_processGO:0065002http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0065002
UniProtKBSECF_ECOLIhttp://www.uniprot.org/uniprot/SECF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHCE_ECOLIhttp://www.uniprot.org/uniprot/YHCE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0033345asparagine catabolic process via L-aspartate; IMP:EcoCyc.
GO_processGO:0033345http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033345
UniProtKBASPG1_ECOLIhttp://www.uniprot.org/uniprot/ASPG1_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEAH_ECOLIhttp://www.uniprot.org/uniprot/YEAH_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJCF_ECOLIhttp://www.uniprot.org/uniprot/YJCF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYPFM_ECOLIhttp://www.uniprot.org/uniprot/YPFM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
UniProtKBYAJQ_ECOLIhttp://www.uniprot.org/uniprot/YAJQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009103lipopolysaccharide biosynthetic process; IEA:UniProtKB-KW.
# GO_processGO:0045228slime layer polysaccharide biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0009103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009103
GO_processGO:0045228http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045228
UniProtKBWCAL_ECOLIhttp://www.uniprot.org/uniprot/WCAL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006457protein folding; IEA:InterPro.
# GO_processGO:0009408response to heat; IDA:EcoCyc.
GO_processGO:0006457http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006457
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
UniProtKBGRPE_ECOLIhttp://www.uniprot.org/uniprot/GRPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000027ribosomal large subunit assembly; IMP:EcoCyc.
# GO_processGO:0006412translation; IBA:GO_Central.
GO_processGO:0000027http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000027
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
UniProtKBRL5_ECOLIhttp://www.uniprot.org/uniprot/RL5_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000105histidine biosynthetic process; IDA:EcoCyc.
GO_processGO:0000105http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000105
UniProtKBHIS1_ECOLIhttp://www.uniprot.org/uniprot/HIS1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006119oxidative phosphorylation; IEA:UniProtKB-UniPathway.
# GO_processGO:0019646aerobic electron transport chain; IDA:EcoCyc.
GO_processGO:0006119http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006119
GO_processGO:0019646http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019646
UniProtKBAPPB_ECOLIhttp://www.uniprot.org/uniprot/APPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0071978bacterial-type flagellum-dependent swarming motility; IMP:EcoliWiki.
GO_processGO:0071978http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071978
UniProtKBYCIG_ECOLIhttp://www.uniprot.org/uniprot/YCIG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IDA:UniProtKB.
GO_processGO:0009102http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009102
UniProtKBBIOH_ECOLIhttp://www.uniprot.org/uniprot/BIOH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IBA:GO_Central.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
UniProtKBYEEL_ECOLIhttp://www.uniprot.org/uniprot/YEEL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IMP:EcoCyc.
GO_processGO:0009102http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009102
UniProtKBBIOF_ECOLIhttp://www.uniprot.org/uniprot/BIOF_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCEF_ECOLIhttp://www.uniprot.org/uniprot/YCEF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019324L-lyxose metabolic process; IMP:EcoCyc.
GO_processGO:0019324http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019324
UniProtKBSGBU_ECOLIhttp://www.uniprot.org/uniprot/SGBU_ECOLI
DataBaseIDURL or Descriptions
UniProtKBNOHD_ECOLIhttp://www.uniprot.org/uniprot/NOHD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0031167rRNA methylation; IDA:UniProtKB.
# GO_processGO:0070475rRNA base methylation; IMP:EcoCyc.
GO_processGO:0031167http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0031167
GO_processGO:0070475http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070475
UniProtKBRSMJ_ECOLIhttp://www.uniprot.org/uniprot/RSMJ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0008360regulation of cell shape; IMP:EcoliWiki.
# GO_processGO:0009252peptidoglycan biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0071555cell wall organization; IMP:EcoliWiki.
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBMURB_ECOLIhttp://www.uniprot.org/uniprot/MURB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYECM_ECOLIhttp://www.uniprot.org/uniprot/YECM_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoCyc.
GO_processGO:0006508http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006508
UniProtKBYPDF_ECOLIhttp://www.uniprot.org/uniprot/YPDF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006145purine nucleobase catabolic process; IBA:GO_Central.
# GO_processGO:0009442allantoin assimilation pathway; IDA:EcoCyc.
GO_processGO:0006145http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006145
GO_processGO:0009442http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009442
UniProtKBALLB_ECOLIhttp://www.uniprot.org/uniprot/ALLB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009297pilus assembly; IBA:GO_Central.
GO_processGO:0009297http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009297
UniProtKBYQIG_ECOLIhttp://www.uniprot.org/uniprot/YQIG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006869lipid transport; IMP:EcoCyc.
GO_processGO:0006869http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006869
UniProtKBMSBA_ECOLIhttp://www.uniprot.org/uniprot/MSBA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBHYFI_ECOLIhttp://www.uniprot.org/uniprot/HYFI_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006400tRNA modification; IBA:GO_Central.
# GO_processGO:0006419alanyl-tRNA aminoacylation; IDA:EcoCyc.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006400http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006400
GO_processGO:0006419http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006419
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBSYA_ECOLIhttp://www.uniprot.org/uniprot/SYA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006474N-terminal protein amino acid acetylation; IBA:GO_Central.
GO_processGO:0006474http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006474
UniProtKBYJHQ_ECOLIhttp://www.uniprot.org/uniprot/YJHQ_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0061077chaperone-mediated protein folding; IEA:UniProtKB-HAMAP.
GO_processGO:0061077http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0061077
UniProtKBDMSD_ECOLIhttp://www.uniprot.org/uniprot/DMSD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006150hypoxanthine oxidation; IMP:EcoliWiki.
# GO_processGO:0006166purine ribonucleoside salvage; IEA:UniProtKB-KW.
GO_processGO:0006150http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006150
GO_processGO:0006166http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006166
UniProtKBXDHB_ECOLIhttp://www.uniprot.org/uniprot/XDHB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006006glucose metabolic process; IBA:GO_Central.
# GO_processGO:0033499galactose catabolic process via UDP-galactose; IBA:GO_Central.
# GO_processGO:0044010single-species biofilm formation; IMP:EcoCyc.
GO_processGO:0006006http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006006
GO_processGO:0033499http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033499
GO_processGO:0044010http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044010
UniProtKBYIHR_ECOLIhttp://www.uniprot.org/uniprot/YIHR_ECOLI
DataBaseIDURL or Descriptions
UniProtKBBICB_ECOLIhttp://www.uniprot.org/uniprot/BICB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000302response to reactive oxygen species; IMP:EcoCyc.
GO_processGO:0000302http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000302
UniProtKBYQHD_ECOLIhttp://www.uniprot.org/uniprot/YQHD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006813potassium ion transport; IDA:EcoliWiki.
# GO_processGO:0006885regulation of pH; IDA:EcoliWiki.
# GO_processGO:0009636response to toxic substance; IMP:EcoCyc.
# GO_processGO:0051595response to methylglyoxal; IMP:EcoCyc.
GO_processGO:0006813http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006813
GO_processGO:0006885http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006885
GO_processGO:0009636http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009636
GO_processGO:0051595http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051595
UniProtKBKEFC_ECOLIhttp://www.uniprot.org/uniprot/KEFC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0008360regulation of cell shape; IEA:UniProtKB-KW.
# GO_processGO:0009252peptidoglycan biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0043164Gram-negative-bacterium-type cell wall biogenesis; IMP:EcoCyc.
# GO_processGO:0044036cell wall macromolecule metabolic process; IMP:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0008360http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008360
GO_processGO:0009252http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009252
GO_processGO:0043164http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0043164
GO_processGO:0044036http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044036
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBYNHG_ECOLIhttp://www.uniprot.org/uniprot/YNHG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:InterPro.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
UniProtKBYAIT_ECOLIhttp://www.uniprot.org/uniprot/YAIT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002143tRNA wobble position uridine thiolation; IMP:EcoCyc.
GO_processGO:0002143http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002143
UniProtKBTUSB_ECOLIhttp://www.uniprot.org/uniprot/TUSB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046294formaldehyde catabolic process; IMP:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:EcoCyc.
GO_processGO:0046294http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046294
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
UniProtKBSFGH2_ECOLIhttp://www.uniprot.org/uniprot/SFGH2_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBZNTR_ECOLIhttp://www.uniprot.org/uniprot/ZNTR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045892negative regulation of transcription, DNA-templated; IMP:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045892http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045892
UniProtKBYGAV_ECOLIhttp://www.uniprot.org/uniprot/YGAV_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGEF_ECOLIhttp://www.uniprot.org/uniprot/YGEF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006835dicarboxylic acid transport; IMP:EcoCyc.
# GO_processGO:0015810aspartate transport; IEA:InterPro.
# GO_processGO:0015813L-glutamate transport; IEA:InterPro.
GO_processGO:0006835http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006835
GO_processGO:0015810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015810
GO_processGO:0015813http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015813
UniProtKBGLTP_ECOLIhttp://www.uniprot.org/uniprot/GLTP_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006270DNA replication initiation; IEA:InterPro.
GO_processGO:0006270http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006270
UniProtKBPEAD_ECOLIhttp://www.uniprot.org/uniprot/PEAD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009107lipoate biosynthetic process; IMP:EcoliWiki.
# GO_processGO:0009249protein lipoylation; IDA:EcoliWiki.
GO_processGO:0009107http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009107
GO_processGO:0009249http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009249
UniProtKBLIPA_ECOLIhttp://www.uniprot.org/uniprot/LIPA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBARAJ_ECOLIhttp://www.uniprot.org/uniprot/ARAJ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYDDK_ECOLIhttp://www.uniprot.org/uniprot/YDDK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBRTCR_ECOLIhttp://www.uniprot.org/uniprot/RTCR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006418tRNA aminoacylation for protein translation; IDA:EcoCyc.
# GO_processGO:0006421asparaginyl-tRNA aminoacylation; IDA:EcoCyc.
GO_processGO:0006418http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006418
GO_processGO:0006421http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006421
UniProtKBSYN_ECOLIhttp://www.uniprot.org/uniprot/SYN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015682ferric iron transport; IMP:EcoCyc.
# GO_processGO:0015891siderophore transport; IEA:InterPro.
# GO_processGO:0055072iron ion homeostasis; IEA:UniProtKB-KW.
GO_processGO:0015682http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015682
GO_processGO:0015891http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015891
GO_processGO:0055072http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055072
UniProtKBFECA_ECOLIhttp://www.uniprot.org/uniprot/FECA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000738DNA catabolic process, exonucleolytic; IDA:UniProtKB.
# GO_processGO:0006281DNA repair; IEA:UniProtKB-KW.
# GO_processGO:0006308DNA catabolic process; IDA:EcoCyc.
GO_processGO:0000738http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000738
GO_processGO:0006281http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006281
GO_processGO:0006308http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006308
UniProtKBEX1_ECOLIhttp://www.uniprot.org/uniprot/EX1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046296glycolate catabolic process; IMP:EcoCyc.
GO_processGO:0046296http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046296
UniProtKBGLCE_ECOLIhttp://www.uniprot.org/uniprot/GLCE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002128tRNA nucleoside ribose methylation; IBA:GO_Central.
GO_processGO:0002128http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002128
UniProtKBLAST_ECOLIhttp://www.uniprot.org/uniprot/LAST_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006260DNA replication; IMP:EcoliWiki.
# GO_processGO:0006261DNA-dependent DNA replication; IBA:GO_Central.
GO_processGO:0006260http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006260
GO_processGO:0006261http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006261
UniProtKBDPO3X_ECOLIhttp://www.uniprot.org/uniprot/DPO3X_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019076viral release from host cell; IEA:InterPro.
# GO_processGO:0019835cytolysis; IEA:UniProtKB-KW.
# GO_processGO:0042742defense response to bacterium; IEA:UniProtKB-KW.
GO_processGO:0019076http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019076
GO_processGO:0019835http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019835
GO_processGO:0042742http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042742
UniProtKBRZPD_ECOLIhttp://www.uniprot.org/uniprot/RZPD_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; ISS:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
UniProtKBYAHB_ECOLIhttp://www.uniprot.org/uniprot/YAHB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0046685response to arsenic-containing substance; IMP:EcoCyc.
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0046685http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046685
UniProtKBARSC_ECOLIhttp://www.uniprot.org/uniprot/ARSC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055085transmembrane transport; IEA:InterPro.
GO_processGO:0055085http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055085
UniProtKBYGIS_ECOLIhttp://www.uniprot.org/uniprot/YGIS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IEA:UniProtKB-HAMAP.
# GO_processGO:0006790sulfur compound metabolic process; IMP:EcoliWiki.
# GO_processGO:0070814hydrogen sulfide biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0000103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000103
GO_processGO:0006790http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006790
GO_processGO:0070814http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070814
UniProtKBCYSN_ECOLIhttp://www.uniprot.org/uniprot/CYSN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015031protein transport; IEA:UniProtKB-KW.
# GO_processGO:0015833peptide transport; IEA:UniProtKB-KW.
GO_processGO:0015031http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015031
GO_processGO:0015833http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015833
UniProtKBDDPF_ECOLIhttp://www.uniprot.org/uniprot/DDPF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009244lipopolysaccharide core region biosynthetic process; IBA:GO_Central.
# GO_processGO:0009245lipid A biosynthetic process; IDA:EcoCyc.
GO_processGO:0009244http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009244
GO_processGO:0009245http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009245
UniProtKBEPTB_ECOLIhttp://www.uniprot.org/uniprot/EPTB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051607defense response to virus; IMP:EcoCyc.
GO_processGO:0051607http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051607
UniProtKBCSE2_ECOLIhttp://www.uniprot.org/uniprot/CSE2_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYJDF_ECOLIhttp://www.uniprot.org/uniprot/YJDF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009401phosphoenolpyruvate-dependent sugar phosphotransferase system; IDA:EcoCyc.
# GO_processGO:0015882L-ascorbic acid transport; IMP:EcoCyc.
GO_processGO:0009401http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009401
GO_processGO:0015882http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015882
UniProtKBULAA_ECOLIhttp://www.uniprot.org/uniprot/ULAA_ECOLI
DataBaseIDURL or Descriptions
UniProtKBSLYX_ECOLIhttp://www.uniprot.org/uniprot/SLYX_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009060aerobic respiration; IMP:EcoCyc.
GO_processGO:0009060http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009060
UniProtKBNUOF_ECOLIhttp://www.uniprot.org/uniprot/NUOF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006829zinc II ion transport; IMP:CACAO.
# GO_processGO:0070574cadmium ion transmembrane transport; IDA:EcoCyc.
# GO_processGO:0071577zinc II ion transmembrane transport; IBA:GO_Central.
GO_processGO:0006829http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006829
GO_processGO:0070574http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070574
GO_processGO:0071577http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071577
UniProtKBZUPT_ECOLIhttp://www.uniprot.org/uniprot/ZUPT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006810transport; IEA:UniProtKB-KW.
GO_processGO:0006810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006810
UniProtKBYHES_ECOLIhttp://www.uniprot.org/uniprot/YHES_ECOLI
DataBaseIDURL or Descriptions
UniProtKBPFLE_ECOLIhttp://www.uniprot.org/uniprot/PFLE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCIU_ECOLIhttp://www.uniprot.org/uniprot/YCIU_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoCyc.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
# GO_processGO:0046777protein autophosphorylation; IDA:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
UniProtKBATOS_ECOLIhttp://www.uniprot.org/uniprot/ATOS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0045893positive regulation of transcription, DNA-templated; IEA:InterPro.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0045893http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0045893
UniProtKBBGLG_ECOLIhttp://www.uniprot.org/uniprot/BGLG_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0015920lipopolysaccharide transport; IMP:EcoCyc.
GO_processGO:0015920http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015920
UniProtKBLPTF_ECOLIhttp://www.uniprot.org/uniprot/LPTF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0019323pentose catabolic process; IBA:GO_Central.
# GO_processGO:0019852L-ascorbic acid metabolic process; IEP:EcoCyc.
# GO_processGO:0019854L-ascorbic acid catabolic process; IEA:UniProtKB-UniPathway.
GO_processGO:0019323http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019323
GO_processGO:0019852http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019852
GO_processGO:0019854http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019854
UniProtKBULAF_ECOLIhttp://www.uniprot.org/uniprot/ULAF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009408response to heat; IMP:EcoCyc.
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
UniProtKBYEBS_ECOLIhttp://www.uniprot.org/uniprot/YEBS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBYBFL_ECOLIhttp://www.uniprot.org/uniprot/YBFL_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IEA:InterPro.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:UniProtKB-KW.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBYGEH_ECOLIhttp://www.uniprot.org/uniprot/YGEH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0046618drug export; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0046618http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046618
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBMACA_ECOLIhttp://www.uniprot.org/uniprot/MACA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006208pyrimidine nucleobase catabolic process; IMP:EcoCyc.
# GO_processGO:0006212uracil catabolic process; IDA:UniProtKB.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019740nitrogen utilization; IDA:UniProtKB.
GO_processGO:0006208http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006208
GO_processGO:0006212http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006212
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0019740http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019740
UniProtKBRUTE_ECOLIhttp://www.uniprot.org/uniprot/RUTE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0033539fatty acid beta-oxidation using acyl-CoA dehydrogenase; IBA:GO_Central.
# GO_processGO:0055088lipid homeostasis; IBA:GO_Central.
GO_processGO:0033539http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0033539
GO_processGO:0055088http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055088
UniProtKBYDIR_ECOLIhttp://www.uniprot.org/uniprot/YDIR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006355regulation of transcription, DNA-templated; IEA:InterPro.
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBCSIE_ECOLIhttp://www.uniprot.org/uniprot/CSIE_ECOLI
DataBaseIDURL or Descriptions
UniProtKBNOHA_ECOLIhttp://www.uniprot.org/uniprot/NOHA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006051N-acetylmannosamine metabolic process; IEA:UniProtKB-HAMAP.
# GO_processGO:0006974cellular response to DNA damage stimulus; IEP:EcoliWiki.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IDA:EcoCyc.
GO_processGO:0006051http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006051
GO_processGO:0006974http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006974
GO_processGO:0019262http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019262
UniProtKBNANK_ECOLIhttp://www.uniprot.org/uniprot/NANK_ECOLI
DataBaseIDURL or Descriptions
UniProtKBLSRF_ECOLIhttp://www.uniprot.org/uniprot/LSRF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0051604protein maturation; IMP:EcoCyc.
GO_processGO:0051604http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051604
UniProtKBHYBE_ECOLIhttp://www.uniprot.org/uniprot/HYBE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0006355regulation of transcription, DNA-templated; IDA:EcoCyc.
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0006355http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006355
UniProtKBGALS_ECOLIhttp://www.uniprot.org/uniprot/GALS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0007155cell adhesion; IEA:UniProtKB-KW.
# GO_processGO:0010810regulation of cell-substrate adhesion; IMP:EcoCyc.
GO_processGO:0007155http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007155
GO_processGO:0010810http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0010810
UniProtKBNLPE_ECOLIhttp://www.uniprot.org/uniprot/NLPE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006099tricarboxylic acid cycle; IEA:UniProtKB-HAMAP.
GO_processGO:0006099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006099
UniProtKBMQO_ECOLIhttp://www.uniprot.org/uniprot/MQO_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006535cysteine biosynthetic process from serine; IDA:EcoCyc.
# GO_processGO:0008652cellular amino acid biosynthetic process; IEA:UniProtKB-KW.
GO_processGO:0006535http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006535
GO_processGO:0008652http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0008652
UniProtKBCYSM_ECOLIhttp://www.uniprot.org/uniprot/CYSM_ECOLI
DataBaseIDURL or Descriptions
UniProtKBRTN_ECOLIhttp://www.uniprot.org/uniprot/RTN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006532aspartate biosynthetic process; IGI:EcoliWiki.
# GO_processGO:0009097isoleucine biosynthetic process; IEA:UniProtKB-UniPathway.
# GO_processGO:0009098leucine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009099valine biosynthetic process; IDA:EcoCyc.
GO_processGO:0006532http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006532
GO_processGO:0009097http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009097
GO_processGO:0009098http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009098
GO_processGO:0009099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009099
UniProtKBILVE_ECOLIhttp://www.uniprot.org/uniprot/ILVE_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000160phosphorelay signal transduction system; IDA:EcoliWiki.
# GO_processGO:0006470protein dephosphorylation; IDA:EcoliWiki.
# GO_processGO:0016310phosphorylation; IDA:EcoliWiki.
# GO_processGO:0046777protein autophosphorylation; IMP:CACAO.
# GO_processGO:0047484regulation of response to osmotic stress; IMP:EcoCyc.
GO_processGO:0000160http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000160
GO_processGO:0006470http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006470
GO_processGO:0016310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016310
GO_processGO:0046777http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046777
GO_processGO:0047484http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0047484
UniProtKBENVZ_ECOLIhttp://www.uniprot.org/uniprot/ENVZ_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYGFS_ECOLIhttp://www.uniprot.org/uniprot/YGFS_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0002184cytoplasmic translational termination; IDA:EcoCyc.
GO_processGO:0002184http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0002184
UniProtKBRRF_ECOLIhttp://www.uniprot.org/uniprot/RRF_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006002fructose 6-phosphate metabolic process; IEA:InterPro.
# GO_processGO:0006007glucose catabolic process; IMP:EcoliWiki.
# GO_processGO:0006096glycolytic process; IDA:EcoliWiki.
# GO_processGO:0044275cellular carbohydrate catabolic process; IMP:EcoliWiki.
# GO_processGO:0051289protein homotetramerization; IPI:EcoCyc.
GO_processGO:0006002http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006002
GO_processGO:0006007http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006007
GO_processGO:0006096http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006096
GO_processGO:0044275http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044275
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
UniProtKBPFKA_ECOLIhttp://www.uniprot.org/uniprot/PFKA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009102biotin biosynthetic process; IDA:EcoCyc.
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
GO_processGO:0009102http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009102
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBMIOC_ECOLIhttp://www.uniprot.org/uniprot/MIOC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0030541plasmid partitioning; IEA:UniProtKB-KW.
GO_processGO:0030541http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0030541
UniProtKBSOPB_ECOLIhttp://www.uniprot.org/uniprot/SOPB_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEBB_ECOLIhttp://www.uniprot.org/uniprot/YEBB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006412translation; IEA:UniProtKB-HAMAP.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006412http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006412
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBRL22_ECOLIhttp://www.uniprot.org/uniprot/RL22_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYOHO_ECOLIhttp://www.uniprot.org/uniprot/YOHO_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYHIN_ECOLIhttp://www.uniprot.org/uniprot/YHIN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009253peptidoglycan catabolic process; IDA:EcoCyc.
# GO_processGO:0071555cell wall organization; IEA:UniProtKB-KW.
GO_processGO:0009253http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009253
GO_processGO:0071555http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071555
UniProtKBSLT_ECOLIhttp://www.uniprot.org/uniprot/SLT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006414translational elongation; IBA:GO_Central.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006414http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006414
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBEFTU1_ECOLIhttp://www.uniprot.org/uniprot/EFTU1_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSC5_ECOLIhttp://www.uniprot.org/uniprot/INSC5_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0055114oxidation-reduction process; IEA:UniProtKB-KW.
GO_processGO:0055114http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0055114
UniProtKBYCCM_ECOLIhttp://www.uniprot.org/uniprot/YCCM_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYBFA_ECOLIhttp://www.uniprot.org/uniprot/YBFA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0000103sulfate assimilation; IEA:UniProtKB-HAMAP.
# GO_processGO:0016310phosphorylation; IMP:EcoCyc.
# GO_processGO:0070814hydrogen sulfide biosynthetic process; IEA:UniProtKB-UniPathway.
GO_processGO:0000103http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0000103
GO_processGO:0016310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016310
GO_processGO:0070814http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0070814
UniProtKBCYSC_ECOLIhttp://www.uniprot.org/uniprot/CYSC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006276plasmid maintenance; IMP:EcoliWiki.
# GO_processGO:0006313transposition, DNA-mediated; IEA:UniProtKB-HAMAP.
# GO_processGO:0007049cell cycle; IEA:UniProtKB-KW.
# GO_processGO:0007059chromosome segregation; IEA:UniProtKB-HAMAP.
# GO_processGO:0042150plasmid recombination; IMP:EcoliWiki.
# GO_processGO:0051301cell division; IEA:UniProtKB-KW.
# GO_processGO:0071139resolution of recombination intermediates; IDA:EcoliWiki.
GO_processGO:0006276http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006276
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
GO_processGO:0007049http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007049
GO_processGO:0007059http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0007059
GO_processGO:0042150http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0042150
GO_processGO:0051301http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051301
GO_processGO:0071139http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0071139
UniProtKBXERC_ECOLIhttp://www.uniprot.org/uniprot/XERC_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSC6_ECOLIhttp://www.uniprot.org/uniprot/INSC6_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0005975carbohydrate metabolic process; IEA:UniProtKB-KW.
# GO_processGO:0006046N-acetylglucosamine catabolic process; IDA:UniProtKB.
# GO_processGO:0019262N-acetylneuraminate catabolic process; IMP:EcoCyc.
# GO_processGO:0051289protein homotetramerization; IDA:UniProtKB.
GO_processGO:0005975http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0005975
GO_processGO:0006046http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006046
GO_processGO:0019262http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0019262
GO_processGO:0051289http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0051289
UniProtKBNAGA_ECOLIhttp://www.uniprot.org/uniprot/NAGA_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006986response to unfolded protein; IDA:EcoCyc.
# GO_processGO:0009408response to heat; IMP:EcoCyc.
# GO_processGO:0016485protein processing; IEA:InterPro.
GO_processGO:0006986http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006986
GO_processGO:0009408http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009408
GO_processGO:0016485http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0016485
UniProtKBCLPB_ECOLIhttp://www.uniprot.org/uniprot/CLPB_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0009097isoleucine biosynthetic process; IDA:EcoCyc.
# GO_processGO:0009099valine biosynthetic process; IDA:EcoCyc.
GO_processGO:0009097http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009097
GO_processGO:0009099http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0009099
UniProtKBILVH_ECOLIhttp://www.uniprot.org/uniprot/ILVH_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006855drug transmembrane transport; IMP:EcoCyc.
# GO_processGO:0015906sulfathiazole transport; IMP:EcoCyc.
# GO_processGO:0046677response to antibiotic; IEA:UniProtKB-KW.
GO_processGO:0006855http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006855
GO_processGO:0015906http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015906
GO_processGO:0046677http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0046677
UniProtKBMDTN_ECOLIhttp://www.uniprot.org/uniprot/MDTN_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
UniProtKBINSA8_ECOLIhttp://www.uniprot.org/uniprot/INSA8_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYEHR_ECOLIhttp://www.uniprot.org/uniprot/YEHR_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006313transposition, DNA-mediated; IEA:InterPro.
# GO_processGO:0015074DNA integration; IEA:InterPro.
GO_processGO:0006313http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006313
GO_processGO:0015074http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0015074
UniProtKBINSI4_ECOLIhttp://www.uniprot.org/uniprot/INSI4_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYTFK_ECOLIhttp://www.uniprot.org/uniprot/YTFK_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006310DNA recombination; IEA:UniProtKB-KW.
# GO_processGO:0006351transcription, DNA-templated; IEA:UniProtKB-KW.
# GO_processGO:0044349DNA excision; IMP:EcoCyc.
# GO_processGO:2000143negative regulation of DNA-templated transcription, initiation; IDA:EcoCyc.
GO_processGO:0006310http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006310
GO_processGO:0006351http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006351
GO_processGO:0044349http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0044349
GO_processGO:2000143http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:2000143
UniProtKBTORI_ECOLIhttp://www.uniprot.org/uniprot/TORI_ECOLI
DataBaseIDURL or Descriptions
UniProtKBYCJV_ECOLIhttp://www.uniprot.org/uniprot/YCJV_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0006508proteolysis; IDA:EcoCyc.
GO_processGO:0006508http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0006508
UniProtKBOMPT_ECOLIhttp://www.uniprot.org/uniprot/OMPT_ECOLI
DataBaseIDURL or Descriptions
# GO_processGO:0022611dormancy process; IDA:UniProtKB.
GO_processGO:0022611http://amigo.geneontology.org/cgi-bin/amigo/term_details?term=GO:0022611
U